CHANGELOG.mdown000064400000023674146412134770007126 0ustar00### 1.11.0 (2014-09-30) * Break: The NewRelicHandler extra and context data are now prefixed with extra_ and context_ to avoid clashes. Watch out if you have scripts reading those from the API and rely on names * Added WhatFailureGroupHandler to suppress any exception coming from the wrapped handlers and avoid chain failures if a logging service fails * Added MandrillHandler to send emails via the Mandrillapp.com API * Added SlackHandler to log records to a Slack.com account * Added FleepHookHandler to log records to a Fleep.io account * Added LogglyHandler::addTag to allow adding tags to an existing handler * Added $ignoreEmptyContextAndExtra to LineFormatter to avoid empty [] at the end * Added $useLocking to StreamHandler and RotatingFileHandler to enable flock() while writing * Added support for PhpAmqpLib in the AmqpHandler * Added FingersCrossedHandler::clear and BufferHandler::clear to reset them between batches in long running jobs * Added support for adding extra fields from $_SERVER in the WebProcessor * Fixed support for non-string values in PrsLogMessageProcessor * Fixed SwiftMailer messages being sent with the wrong date in long running scripts * Fixed minor PHP 5.6 compatibility issues * Fixed BufferHandler::close being called twice ### 1.10.0 (2014-06-04) * Added Logger::getHandlers() and Logger::getProcessors() methods * Added $passthruLevel argument to FingersCrossedHandler to let it always pass some records through even if the trigger level is not reached * Added support for extra data in NewRelicHandler * Added $expandNewlines flag to the ErrorLogHandler to create multiple log entries when a message has multiple lines ### 1.9.1 (2014-04-24) * Fixed regression in RotatingFileHandler file permissions * Fixed initialization of the BufferHandler to make sure it gets flushed after receiving records * Fixed ChromePHPHandler and FirePHPHandler's activation strategies to be more conservative ### 1.9.0 (2014-04-20) * Added LogEntriesHandler to send logs to a LogEntries account * Added $filePermissions to tweak file mode on StreamHandler and RotatingFileHandler * Added $useFormatting flag to MemoryProcessor to make it send raw data in bytes * Added support for table formatting in FirePHPHandler via the table context key * Added a TagProcessor to add tags to records, and support for tags in RavenHandler * Added $appendNewline flag to the JsonFormatter to enable using it when logging to files * Added sound support to the PushoverHandler * Fixed multi-threading support in StreamHandler * Fixed empty headers issue when ChromePHPHandler received no records * Fixed default format of the ErrorLogHandler ### 1.8.0 (2014-03-23) * Break: the LineFormatter now strips newlines by default because this was a bug, set $allowInlineLineBreaks to true if you need them * Added BrowserConsoleHandler to send logs to any browser's console via console.log() injection in the output * Added FilterHandler to filter records and only allow those of a given list of levels through to the wrapped handler * Added FlowdockHandler to send logs to a Flowdock account * Added RollbarHandler to send logs to a Rollbar account * Added HtmlFormatter to send prettier log emails with colors for each log level * Added GitProcessor to add the current branch/commit to extra record data * Added a Monolog\Registry class to allow easier global access to pre-configured loggers * Added support for the new official graylog2/gelf-php lib for GelfHandler, upgrade if you can by replacing the mlehner/gelf-php requirement * Added support for HHVM * Added support for Loggly batch uploads * Added support for tweaking the content type and encoding in NativeMailerHandler * Added $skipClassesPartials to tweak the ignored classes in the IntrospectionProcessor * Fixed batch request support in GelfHandler ### 1.7.0 (2013-11-14) * Added ElasticSearchHandler to send logs to an Elastic Search server * Added DynamoDbHandler and ScalarFormatter to send logs to Amazon's Dynamo DB * Added SyslogUdpHandler to send logs to a remote syslogd server * Added LogglyHandler to send logs to a Loggly account * Added $level to IntrospectionProcessor so it only adds backtraces when needed * Added $version to LogstashFormatter to allow using the new v1 Logstash format * Added $appName to NewRelicHandler * Added configuration of Pushover notification retries/expiry * Added $maxColumnWidth to NativeMailerHandler to change the 70 chars default * Added chainability to most setters for all handlers * Fixed RavenHandler batch processing so it takes the message from the record with highest priority * Fixed HipChatHandler batch processing so it sends all messages at once * Fixed issues with eAccelerator * Fixed and improved many small things ### 1.6.0 (2013-07-29) * Added HipChatHandler to send logs to a HipChat chat room * Added ErrorLogHandler to send logs to PHP's error_log function * Added NewRelicHandler to send logs to NewRelic's service * Added Monolog\ErrorHandler helper class to register a Logger as exception/error/fatal handler * Added ChannelLevelActivationStrategy for the FingersCrossedHandler to customize levels by channel * Added stack traces output when normalizing exceptions (json output & co) * Added Monolog\Logger::API constant (currently 1) * Added support for ChromePHP's v4.0 extension * Added support for message priorities in PushoverHandler, see $highPriorityLevel and $emergencyLevel * Added support for sending messages to multiple users at once with the PushoverHandler * Fixed RavenHandler's support for batch sending of messages (when behind a Buffer or FingersCrossedHandler) * Fixed normalization of Traversables with very large data sets, only the first 1000 items are shown now * Fixed issue in RotatingFileHandler when an open_basedir restriction is active * Fixed minor issues in RavenHandler and bumped the API to Raven 0.5.0 * Fixed SyslogHandler issue when many were used concurrently with different facilities ### 1.5.0 (2013-04-23) * Added ProcessIdProcessor to inject the PID in log records * Added UidProcessor to inject a unique identifier to all log records of one request/run * Added support for previous exceptions in the LineFormatter exception serialization * Added Monolog\Logger::getLevels() to get all available levels * Fixed ChromePHPHandler so it avoids sending headers larger than Chrome can handle ### 1.4.1 (2013-04-01) * Fixed exception formatting in the LineFormatter to be more minimalistic * Fixed RavenHandler's handling of context/extra data, requires Raven client >0.1.0 * Fixed log rotation in RotatingFileHandler to work with long running scripts spanning multiple days * Fixed WebProcessor array access so it checks for data presence * Fixed Buffer, Group and FingersCrossed handlers to make use of their processors ### 1.4.0 (2013-02-13) * Added RedisHandler to log to Redis via the Predis library or the phpredis extension * Added ZendMonitorHandler to log to the Zend Server monitor * Added the possibility to pass arrays of handlers and processors directly in the Logger constructor * Added `$useSSL` option to the PushoverHandler which is enabled by default * Fixed ChromePHPHandler and FirePHPHandler issue when multiple instances are used simultaneously * Fixed header injection capability in the NativeMailHandler ### 1.3.1 (2013-01-11) * Fixed LogstashFormatter to be usable with stream handlers * Fixed GelfMessageFormatter levels on Windows ### 1.3.0 (2013-01-08) * Added PSR-3 compliance, the `Monolog\Logger` class is now an instance of `Psr\Log\LoggerInterface` * Added PsrLogMessageProcessor that you can selectively enable for full PSR-3 compliance * Added LogstashFormatter (combine with SocketHandler or StreamHandler to send logs to Logstash) * Added PushoverHandler to send mobile notifications * Added CouchDBHandler and DoctrineCouchDBHandler * Added RavenHandler to send data to Sentry servers * Added support for the new MongoClient class in MongoDBHandler * Added microsecond precision to log records' timestamps * Added `$flushOnOverflow` param to BufferHandler to flush by batches instead of losing the oldest entries * Fixed normalization of objects with cyclic references ### 1.2.1 (2012-08-29) * Added new $logopts arg to SyslogHandler to provide custom openlog options * Fixed fatal error in SyslogHandler ### 1.2.0 (2012-08-18) * Added AmqpHandler (for use with AMQP servers) * Added CubeHandler * Added NativeMailerHandler::addHeader() to send custom headers in mails * Added the possibility to specify more than one recipient in NativeMailerHandler * Added the possibility to specify float timeouts in SocketHandler * Added NOTICE and EMERGENCY levels to conform with RFC 5424 * Fixed the log records to use the php default timezone instead of UTC * Fixed BufferHandler not being flushed properly on PHP fatal errors * Fixed normalization of exotic resource types * Fixed the default format of the SyslogHandler to avoid duplicating datetimes in syslog ### 1.1.0 (2012-04-23) * Added Monolog\Logger::isHandling() to check if a handler will handle the given log level * Added ChromePHPHandler * Added MongoDBHandler * Added GelfHandler (for use with Graylog2 servers) * Added SocketHandler (for use with syslog-ng for example) * Added NormalizerFormatter * Added the possibility to change the activation strategy of the FingersCrossedHandler * Added possibility to show microseconds in logs * Added `server` and `referer` to WebProcessor output ### 1.0.2 (2011-10-24) * Fixed bug in IE with large response headers and FirePHPHandler ### 1.0.1 (2011-08-25) * Added MemoryPeakUsageProcessor and MemoryUsageProcessor * Added Monolog\Logger::getName() to get a logger's channel name ### 1.0.0 (2011-07-06) * Added IntrospectionProcessor to get info from where the logger was called * Fixed WebProcessor in CLI ### 1.0.0-RC1 (2011-07-01) * Initial release LICENSE000064400000002047146412134770005565 0ustar00Copyright (c) 2011-2014 Jordi Boggiano Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. README.mdown000064400000033410146412134770006561 0ustar00Monolog - Logging for PHP 5.3+ [![Build Status](https://secure.travis-ci.org/Seldaek/monolog.png)](http://travis-ci.org/Seldaek/monolog) ============================== [![Total Downloads](https://poser.pugx.org/monolog/monolog/downloads.png)](https://packagist.org/packages/monolog/monolog) [![Latest Stable Version](https://poser.pugx.org/monolog/monolog/v/stable.png)](https://packagist.org/packages/monolog/monolog) [![Reference Status](https://www.versioneye.com/php/monolog:monolog/reference_badge.svg)](https://www.versioneye.com/php/monolog:monolog/references) Monolog sends your logs to files, sockets, inboxes, databases and various web services. See the complete list of handlers below. Special handlers allow you to build advanced logging strategies. This library implements the [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md) interface that you can type-hint against in your own libraries to keep a maximum of interoperability. You can also use it in your applications to make sure you can always use another compatible logger at a later time. As of 1.11.0 Monolog public APIs will also accept PSR-3 log levels. Internally Monolog still uses its own level scheme since it predates PSR-3. Usage ----- ```php pushHandler(new StreamHandler('path/to/your.log', Logger::WARNING)); // add records to the log $log->addWarning('Foo'); $log->addError('Bar'); ``` Core Concepts ------------- Every `Logger` instance has a channel (name) and a stack of handlers. Whenever you add a record to the logger, it traverses the handler stack. Each handler decides whether it handled fully the record, and if so, the propagation of the record ends there. This allows for flexible logging setups, for example having a `StreamHandler` at the bottom of the stack that will log anything to disk, and on top of that add a `MailHandler` that will send emails only when an error message is logged. Handlers also have a `$bubble` property which defines whether they block the record or not if they handled it. In this example, setting the `MailHandler`'s `$bubble` argument to false means that records handled by the `MailHandler` will not propagate to the `StreamHandler` anymore. You can create many `Logger`s, each defining a channel (e.g.: db, request, router, ..) and each of them combining various handlers, which can be shared or not. The channel is reflected in the logs and allows you to easily see or filter records. Each Handler also has a Formatter, a default one with settings that make sense will be created if you don't set one. The formatters normalize and format incoming records so that they can be used by the handlers to output useful information. Custom severity levels are not available. Only the eight [RFC 5424](http://tools.ietf.org/html/rfc5424) levels (debug, info, notice, warning, error, critical, alert, emergency) are present for basic filtering purposes, but for sorting and other use cases that would require flexibility, you should add Processors to the Logger that can add extra information (tags, user ip, ..) to the records before they are handled. Log Levels ---------- Monolog supports the logging levels described by [RFC 5424](http://tools.ietf.org/html/rfc5424). - **DEBUG** (100): Detailed debug information. - **INFO** (200): Interesting events. Examples: User logs in, SQL logs. - **NOTICE** (250): Normal but significant events. - **WARNING** (300): Exceptional occurrences that are not errors. Examples: Use of deprecated APIs, poor use of an API, undesirable things that are not necessarily wrong. - **ERROR** (400): Runtime errors that do not require immediate action but should typically be logged and monitored. - **CRITICAL** (500): Critical conditions. Example: Application component unavailable, unexpected exception. - **ALERT** (550): Action must be taken immediately. Example: Entire website down, database unavailable, etc. This should trigger the SMS alerts and wake you up. - **EMERGENCY** (600): Emergency: system is unusable. Docs ==== **See the `doc` directory for more detailed documentation. The following is only a list of all parts that come with Monolog.** Handlers -------- ### Log to files and syslog - _StreamHandler_: Logs records into any PHP stream, use this for log files. - _RotatingFileHandler_: Logs records to a file and creates one logfile per day. It will also delete files older than `$maxFiles`. You should use [logrotate](http://linuxcommand.org/man_pages/logrotate8.html) for high profile setups though, this is just meant as a quick and dirty solution. - _SyslogHandler_: Logs records to the syslog. - _ErrorLogHandler_: Logs records to PHP's [`error_log()`](http://docs.php.net/manual/en/function.error-log.php) function. ### Send alerts and emails - _NativeMailerHandler_: Sends emails using PHP's [`mail()`](http://php.net/manual/en/function.mail.php) function. - _SwiftMailerHandler_: Sends emails using a [`Swift_Mailer`](http://swiftmailer.org/) instance. - _PushoverHandler_: Sends mobile notifications via the [Pushover](https://www.pushover.net/) API. - _HipChatHandler_: Logs records to a [HipChat](http://hipchat.com) chat room using its API. - _FlowdockHandler_: Logs records to a [Flowdock](https://www.flowdock.com/) account. - _SlackHandler_: Logs records to a [Slack](https://www.slack.com/) account. - _MandrillHandler_: Sends emails via the Mandrill API using a [`Swift_Message`](http://swiftmailer.org/) instance. - _FleepHookHandler_: Logs records to a [Fleep](https://fleep.io/) conversation using Webhooks. ### Log specific servers and networked logging - _SocketHandler_: Logs records to [sockets](http://php.net/fsockopen), use this for UNIX and TCP sockets. See an [example](https://github.com/Seldaek/monolog/blob/master/doc/sockets.md). - _AmqpHandler_: Logs records to an [amqp](http://www.amqp.org/) compatible server. Requires the [php-amqp](http://pecl.php.net/package/amqp) extension (1.0+). - _GelfHandler_: Logs records to a [Graylog2](http://www.graylog2.org) server. - _CubeHandler_: Logs records to a [Cube](http://square.github.com/cube/) server. - _RavenHandler_: Logs records to a [Sentry](http://getsentry.com/) server using [raven](https://packagist.org/packages/raven/raven). - _ZendMonitorHandler_: Logs records to the Zend Monitor present in Zend Server. - _NewRelicHandler_: Logs records to a [NewRelic](http://newrelic.com/) application. - _LogglyHandler_: Logs records to a [Loggly](http://www.loggly.com/) account. - _RollbarHandler_: Logs records to a [Rollbar](https://rollbar.com/) account. - _SyslogUdpHandler_: Logs records to a remote [Syslogd](http://www.rsyslog.com/) server. - _LogEntriesHandler_: Logs records to a [LogEntries](http://logentries.com/) account. ### Logging in development - _FirePHPHandler_: Handler for [FirePHP](http://www.firephp.org/), providing inline `console` messages within [FireBug](http://getfirebug.com/). - _ChromePHPHandler_: Handler for [ChromePHP](http://www.chromephp.com/), providing inline `console` messages within Chrome. - _BrowserConsoleHandler_: Handler to send logs to browser's Javascript `console` with no browser extension required. Most browsers supporting `console` API are supported. ### Log to databases - _RedisHandler_: Logs records to a [redis](http://redis.io) server. - _MongoDBHandler_: Handler to write records in MongoDB via a [Mongo](http://pecl.php.net/package/mongo) extension connection. - _CouchDBHandler_: Logs records to a CouchDB server. - _DoctrineCouchDBHandler_: Logs records to a CouchDB server via the Doctrine CouchDB ODM. - _ElasticSearchHandler_: Logs records to an Elastic Search server. - _DynamoDbHandler_: Logs records to a DynamoDB table with the [AWS SDK](https://github.com/aws/aws-sdk-php). ### Wrappers / Special Handlers - _FingersCrossedHandler_: A very interesting wrapper. It takes a logger as parameter and will accumulate log records of all levels until a record exceeds the defined severity level. At which point it delivers all records, including those of lower severity, to the handler it wraps. This means that until an error actually happens you will not see anything in your logs, but when it happens you will have the full information, including debug and info records. This provides you with all the information you need, but only when you need it. - _NullHandler_: Any record it can handle will be thrown away. This can be used to put on top of an existing handler stack to disable it temporarily. - _BufferHandler_: This handler will buffer all the log records it receives until `close()` is called at which point it will call `handleBatch()` on the handler it wraps with all the log messages at once. This is very useful to send an email with all records at once for example instead of having one mail for every log record. - _GroupHandler_: This handler groups other handlers. Every record received is sent to all the handlers it is configured with. - _FilterHandler_: This handler only lets records of the given levels through to the wrapped handler. - _TestHandler_: Used for testing, it records everything that is sent to it and has accessors to read out the information. - _WhatFailureGroupHandler_: This handle extends the _GroupHandler_ ignoring exceptions raised by each child handler. This allows you to ignore issues where a remote tcp connection may have died but you do not want your entire application to crash and may wish to continue to log to other handlers. Formatters ---------- - _LineFormatter_: Formats a log record into a one-line string. - _HtmlFormatter_: Used to format log records into a human readable html table, mainly suitable for emails. - _NormalizerFormatter_: Normalizes objects/resources down to strings so a record can easily be serialized/encoded. - _ScalarFormatter_: Used to format log records into an associative array of scalar values. - _JsonFormatter_: Encodes a log record into json. - _WildfireFormatter_: Used to format log records into the Wildfire/FirePHP protocol, only useful for the FirePHPHandler. - _ChromePHPFormatter_: Used to format log records into the ChromePHP format, only useful for the ChromePHPHandler. - _GelfMessageFormatter_: Used to format log records into Gelf message instances, only useful for the GelfHandler. - _LogstashFormatter_: Used to format log records into [logstash](http://logstash.net/) event json, useful for any handler listed under inputs [here](http://logstash.net/docs/latest). - _ElasticaFormatter_: Used to format log records into an Elastica\Document object, only useful for the ElasticSearchHandler. - _LogglyFormatter_: Used to format log records into Loggly messages, only useful for the LogglyHandler. - _FlowdockFormatter_: Used to format log records into Flowdock messages, only useful for the FlowdockHandler. Processors ---------- - _IntrospectionProcessor_: Adds the line/file/class/method from which the log call originated. - _WebProcessor_: Adds the current request URI, request method and client IP to a log record. - _MemoryUsageProcessor_: Adds the current memory usage to a log record. - _MemoryPeakUsageProcessor_: Adds the peak memory usage to a log record. - _ProcessIdProcessor_: Adds the process id to a log record. - _UidProcessor_: Adds a unique identifier to a log record. - _GitProcessor_: Adds the current git branch and commit to a log record. - _TagProcessor_: Adds an array of predefined tags to a log record. Utilities --------- - _Registry_: The `Monolog\Registry` class lets you configure global loggers that you can then statically access from anywhere. It is not really a best practice but can help in some older codebases or for ease of use. - _ErrorHandler_: The `Monolog\ErrorHandler` class allows you to easily register a Logger instance as an exception handler, error handler or fatal error handler. - _ErrorLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain log level is reached. - _ChannelLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain log level is reached, depending on which channel received the log record. About ===== Requirements ------------ - Monolog works with PHP 5.3 or above, and is also tested to work with HHVM. Submitting bugs and feature requests ------------------------------------ Bugs and feature request are tracked on [GitHub](https://github.com/Seldaek/monolog/issues) Frameworks Integration ---------------------- - Frameworks and libraries using [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md) can be used very easily with Monolog since it implements the interface. - [Symfony2](http://symfony.com) comes out of the box with Monolog. - [Silex](http://silex.sensiolabs.org/) comes out of the box with Monolog. - [Laravel 4](http://laravel.com/) comes out of the box with Monolog. - [PPI](http://www.ppi.io/) comes out of the box with Monolog. - [CakePHP](http://cakephp.org/) is usable with Monolog via the [cakephp-monolog](https://github.com/jadb/cakephp-monolog) plugin. - [Slim](http://www.slimframework.com/) is usable with Monolog via the [Slim-Monolog](https://github.com/Flynsarmy/Slim-Monolog) log writer. - [XOOPS 2.6](http://xoops.org/) comes out of the box with Monolog. - [Aura.Web_Project](https://github.com/auraphp/Aura.Web_Project) comes out of the box with Monolog. Author ------ Jordi Boggiano - -
See also the list of [contributors](https://github.com/Seldaek/monolog/contributors) which participated in this project. License ------- Monolog is licensed under the MIT License - see the `LICENSE` file for details Acknowledgements ---------------- This library is heavily inspired by Python's [Logbook](http://packages.python.org/Logbook/) library, although most concepts have been adjusted to fit to the PHP world. composer.json000064400000003406146412134770007302 0ustar00{ "name": "monolog/monolog", "description": "Sends your logs to files, sockets, inboxes, databases and various web services", "keywords": ["log", "logging", "psr-3"], "homepage": "http://github.com/Seldaek/monolog", "type": "library", "license": "MIT", "authors": [ { "name": "Jordi Boggiano", "email": "j.boggiano@seld.be", "homepage": "http://seld.be" } ], "require": { "php": ">=5.3.0", "psr/log": "~1.0" }, "require-dev": { "phpunit/phpunit": "~3.7.0", "graylog2/gelf-php": "~1.0", "raven/raven": "~0.5", "ruflin/elastica": "0.90.*", "doctrine/couchdb": "~1.0@dev", "aws/aws-sdk-php": "~2.4, >2.4.8", "videlalvaro/php-amqplib": "~2.4" }, "suggest": { "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server", "raven/raven": "Allow sending log messages to a Sentry server", "doctrine/couchdb": "Allow sending log messages to a CouchDB server", "ruflin/elastica": "Allow sending log messages to an Elastic Search server", "videlalvaro/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib", "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)", "ext-mongo": "Allow sending log messages to a MongoDB server", "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB", "rollbar/rollbar": "Allow sending log messages to Rollbar" }, "autoload": { "psr-4": {"Monolog\\": "src/Monolog"} }, "provide": { "psr/log-implementation": "1.0.0" }, "extra": { "branch-alias": { "dev-master": "1.11.x-dev" } } } doc/extending.md000064400000004152146412134770007633 0ustar00Extending Monolog ================= Monolog is fully extensible, allowing you to adapt your logger to your needs. Writing your own handler ------------------------ Monolog provides many built-in handlers. But if the one you need does not exist, you can write it and use it in your logger. The only requirement is to implement `Monolog\Handler\HandlerInterface`. Let's write a PDOHandler to log records to a database. We will extend the abstract class provided by Monolog to keep things DRY. ```php pdo = $pdo; parent::__construct($level, $bubble); } protected function write(array $record) { if (!$this->initialized) { $this->initialize(); } $this->statement->execute(array( 'channel' => $record['channel'], 'level' => $record['level'], 'message' => $record['formatted'], 'time' => $record['datetime']->format('U'), )); } private function initialize() { $this->pdo->exec( 'CREATE TABLE IF NOT EXISTS monolog ' .'(channel VARCHAR(255), level INTEGER, message LONGTEXT, time INTEGER UNSIGNED)' ); $this->statement = $this->pdo->prepare( 'INSERT INTO monolog (channel, level, message, time) VALUES (:channel, :level, :message, :time)' ); $this->initialized = true; } } ``` You can now use this handler in your logger: ```php pushHandler(new PDOHandler(new PDO('sqlite:logs.sqlite'))); // You can now use your logger $logger->addInfo('My logger is now ready'); ``` The `Monolog\Handler\AbstractProcessingHandler` class provides most of the logic needed for the handler, including the use of processors and the formatting of the record (which is why we use ``$record['formatted']`` instead of ``$record['message']``). doc/sockets.md000064400000001613146412134770007320 0ustar00Sockets Handler =============== This handler allows you to write your logs to sockets using [fsockopen](http://php.net/fsockopen) or [pfsockopen](http://php.net/pfsockopen). Persistent sockets are mainly useful in web environments where you gain some performance not closing/opening the connections between requests. Basic Example ------------- ```php setPersistent(true); // Now add the handler $logger->pushHandler($handler, Logger::DEBUG); // You can now use your logger $logger->addInfo('My logger is now ready'); ``` In this example, using syslog-ng, you should see the log on the log server: cweb1 [2012-02-26 00:12:03] my_logger.INFO: My logger is now ready [] [] doc/usage.md000064400000012060146412134770006747 0ustar00Using Monolog ============= Installation ------------ Monolog is available on Packagist ([monolog/monolog](http://packagist.org/packages/monolog/monolog)) and as such installable via [Composer](http://getcomposer.org/). ```bash php composer.phar require monolog/monolog '~1.7' ``` If you do not use Composer, you can grab the code from GitHub, and use any PSR-0 compatible autoloader (e.g. the [Symfony2 ClassLoader component](https://github.com/symfony/ClassLoader)) to load Monolog classes. Configuring a logger -------------------- Here is a basic setup to log to a file and to firephp on the DEBUG level: ```php pushHandler(new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG)); $logger->pushHandler(new FirePHPHandler()); // You can now use your logger $logger->addInfo('My logger is now ready'); ``` Let's explain it. The first step is to create the logger instance which will be used in your code. The argument is a channel name, which is useful when you use several loggers (see below for more details about it). The logger itself does not know how to handle a record. It delegates it to some handlers. The code above registers two handlers in the stack to allow handling records in two different ways. Note that the FirePHPHandler is called first as it is added on top of the stack. This allows you to temporarily add a logger with bubbling disabled if you want to override other configured loggers. Adding extra data in the records -------------------------------- Monolog provides two different ways to add extra informations along the simple textual message. ### Using the logging context The first way is the context, allowing to pass an array of data along the record: ```php addInfo('Adding a new user', array('username' => 'Seldaek')); ``` Simple handlers (like the StreamHandler for instance) will simply format the array to a string but richer handlers can take advantage of the context (FirePHP is able to display arrays in pretty way for instance). ### Using processors The second way is to add extra data for all records by using a processor. Processors can be any callable. They will get the record as parameter and must return it after having eventually changed the `extra` part of it. Let's write a processor adding some dummy data in the record: ```php pushProcessor(function ($record) { $record['extra']['dummy'] = 'Hello world!'; return $record; }); ``` Monolog provides some built-in processors that can be used in your project. Look at the [README file](https://github.com/Seldaek/monolog/blob/master/README.mdown) for the list. > Tip: processors can also be registered on a specific handler instead of the logger to apply only for this handler. Leveraging channels ------------------- Channels are a great way to identify to which part of the application a record is related. This is useful in big applications (and is leveraged by MonologBundle in Symfony2). Picture two loggers sharing a handler that writes to a single log file. Channels would allow you to identify the logger that issued every record. You can easily grep through the log files filtering this or that channel. ```php pushHandler($stream); $logger->pushHandler($firephp); // Create a logger for the security-related stuff with a different channel $securityLogger = new Logger('security'); $securityLogger->pushHandler($stream); $securityLogger->pushHandler($firephp); ``` Customizing log format ---------------------- In Monolog it's easy to customize the format of the logs written into files, sockets, mails, databases and other handlers. Most of the handlers use the ```php $record['formatted'] ``` value to be automatically put into the log device. This value depends on the formatter settings. You can choose between predefined formatter classes or write your own (e.g. a multiline text file for human-readable output). To configure a predefined formatter class, just set it as the handler's field: ```php // the default date format is "Y-m-d H:i:s" $dateFormat = "Y n j, g:i a"; // the default output format is "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n" $output = "%datetime% > %level_name% > %message% %context% %extra%\n"; // finally, create a formatter $formatter = new LineFormatter($output, $dateFormat); // Create a handler $stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG); $stream->setFormatter($formatter); // bind it to a logger object $securityLogger = new Logger('security'); $securityLogger->pushHandler($stream); ``` You may also reuse the same formatter between multiple handlers and share those handlers between multiple loggers. phpunit.xml.dist000064400000000606146412134770007732 0ustar00 tests/Monolog/ src/Monolog/ src/Monolog/ErrorHandler.php000064400000015576146412134770012074 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog; use Psr\Log\LoggerInterface; use Psr\Log\LogLevel; /** * Monolog error handler * * A facility to enable logging of runtime errors, exceptions and fatal errors. * * Quick setup: ErrorHandler::register($logger); * * @author Jordi Boggiano */ class ErrorHandler { private $logger; private $previousExceptionHandler; private $uncaughtExceptionLevel; private $previousErrorHandler; private $errorLevelMap; private $fatalLevel; private $reservedMemory; private static $fatalErrors = array(E_ERROR, E_PARSE, E_CORE_ERROR, E_COMPILE_ERROR, E_USER_ERROR); public function __construct(LoggerInterface $logger) { $this->logger = $logger; } /** * Registers a new ErrorHandler for a given Logger * * By default it will handle errors, exceptions and fatal errors * * @param LoggerInterface $logger * @param array|false $errorLevelMap an array of E_* constant to LogLevel::* constant mapping, or false to disable error handling * @param int|false $exceptionLevel a LogLevel::* constant, or false to disable exception handling * @param int|false $fatalLevel a LogLevel::* constant, or false to disable fatal error handling * @return ErrorHandler */ public static function register(LoggerInterface $logger, $errorLevelMap = array(), $exceptionLevel = null, $fatalLevel = null) { $handler = new static($logger); if ($errorLevelMap !== false) { $handler->registerErrorHandler($errorLevelMap); } if ($exceptionLevel !== false) { $handler->registerExceptionHandler($exceptionLevel); } if ($fatalLevel !== false) { $handler->registerFatalHandler($fatalLevel); } return $handler; } public function registerExceptionHandler($level = null, $callPrevious = true) { $prev = set_exception_handler(array($this, 'handleException')); $this->uncaughtExceptionLevel = $level; if ($callPrevious && $prev) { $this->previousExceptionHandler = $prev; } } public function registerErrorHandler(array $levelMap = array(), $callPrevious = true, $errorTypes = -1) { $prev = set_error_handler(array($this, 'handleError'), $errorTypes); $this->errorLevelMap = array_replace($this->defaultErrorLevelMap(), $levelMap); if ($callPrevious) { $this->previousErrorHandler = $prev ?: true; } } public function registerFatalHandler($level = null, $reservedMemorySize = 20) { register_shutdown_function(array($this, 'handleFatalError')); $this->reservedMemory = str_repeat(' ', 1024 * $reservedMemorySize); $this->fatalLevel = $level; } protected function defaultErrorLevelMap() { return array( E_ERROR => LogLevel::CRITICAL, E_WARNING => LogLevel::WARNING, E_PARSE => LogLevel::ALERT, E_NOTICE => LogLevel::NOTICE, E_CORE_ERROR => LogLevel::CRITICAL, E_CORE_WARNING => LogLevel::WARNING, E_COMPILE_ERROR => LogLevel::ALERT, E_COMPILE_WARNING => LogLevel::WARNING, E_USER_ERROR => LogLevel::ERROR, E_USER_WARNING => LogLevel::WARNING, E_USER_NOTICE => LogLevel::NOTICE, E_STRICT => LogLevel::NOTICE, E_RECOVERABLE_ERROR => LogLevel::ERROR, E_DEPRECATED => LogLevel::NOTICE, E_USER_DEPRECATED => LogLevel::NOTICE, ); } /** * @private */ public function handleException(\Exception $e) { $this->logger->log( $this->uncaughtExceptionLevel === null ? LogLevel::ERROR : $this->uncaughtExceptionLevel, sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()), array('exception' => $e) ); if ($this->previousExceptionHandler) { call_user_func($this->previousExceptionHandler, $e); } } /** * @private */ public function handleError($code, $message, $file = '', $line = 0, $context = array()) { if (!(error_reporting() & $code)) { return; } $level = isset($this->errorLevelMap[$code]) ? $this->errorLevelMap[$code] : LogLevel::CRITICAL; $this->logger->log($level, self::codeToString($code).': '.$message, array('code' => $code, 'message' => $message, 'file' => $file, 'line' => $line)); if ($this->previousErrorHandler === true) { return false; } elseif ($this->previousErrorHandler) { return call_user_func($this->previousErrorHandler, $code, $message, $file, $line, $context); } } /** * @private */ public function handleFatalError() { $this->reservedMemory = null; $lastError = error_get_last(); if ($lastError && in_array($lastError['type'], self::$fatalErrors)) { $this->logger->log( $this->fatalLevel === null ? LogLevel::ALERT : $this->fatalLevel, 'Fatal Error ('.self::codeToString($lastError['type']).'): '.$lastError['message'], array('code' => $lastError['type'], 'message' => $lastError['message'], 'file' => $lastError['file'], 'line' => $lastError['line']) ); } } private static function codeToString($code) { switch ($code) { case E_ERROR: return 'E_ERROR'; case E_WARNING: return 'E_WARNING'; case E_PARSE: return 'E_PARSE'; case E_NOTICE: return 'E_NOTICE'; case E_CORE_ERROR: return 'E_CORE_ERROR'; case E_CORE_WARNING: return 'E_CORE_WARNING'; case E_COMPILE_ERROR: return 'E_COMPILE_ERROR'; case E_COMPILE_WARNING: return 'E_COMPILE_WARNING'; case E_USER_ERROR: return 'E_USER_ERROR'; case E_USER_WARNING: return 'E_USER_WARNING'; case E_USER_NOTICE: return 'E_USER_NOTICE'; case E_STRICT: return 'E_STRICT'; case E_RECOVERABLE_ERROR: return 'E_RECOVERABLE_ERROR'; case E_DEPRECATED: return 'E_DEPRECATED'; case E_USER_DEPRECATED: return 'E_USER_DEPRECATED'; } return 'Unknown PHP error'; } } src/Monolog/Formatter/ChromePHPFormatter.php000064400000004027146412134770015106 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; /** * Formats a log message according to the ChromePHP array format * * @author Christophe Coevoet */ class ChromePHPFormatter implements FormatterInterface { /** * Translates Monolog log levels to Wildfire levels. */ private $logLevels = array( Logger::DEBUG => 'log', Logger::INFO => 'info', Logger::NOTICE => 'info', Logger::WARNING => 'warn', Logger::ERROR => 'error', Logger::CRITICAL => 'error', Logger::ALERT => 'error', Logger::EMERGENCY => 'error', ); /** * {@inheritdoc} */ public function format(array $record) { // Retrieve the line and file if set and remove them from the formatted extra $backtrace = 'unknown'; if (isset($record['extra']['file']) && isset($record['extra']['line'])) { $backtrace = $record['extra']['file'].' : '.$record['extra']['line']; unset($record['extra']['file']); unset($record['extra']['line']); } $message = array('message' => $record['message']); if ($record['context']) { $message['context'] = $record['context']; } if ($record['extra']) { $message['extra'] = $record['extra']; } if (count($message) === 1) { $message = reset($message); } return array( $record['channel'], $message, $backtrace, $this->logLevels[$record['level']], ); } public function formatBatch(array $records) { $formatted = array(); foreach ($records as $record) { $formatted[] = $this->format($record); } return $formatted; } } src/Monolog/Formatter/ElasticaFormatter.php000064400000003317146412134770015047 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Elastica\Document; /** * Format a log message into an Elastica Document * * @author Jelle Vink */ class ElasticaFormatter extends NormalizerFormatter { /** * @var string Elastic search index name */ protected $index; /** * @var string Elastic search document type */ protected $type; /** * @param string $index Elastic Search index name * @param string $type Elastic Search document type */ public function __construct($index, $type) { parent::__construct(\DateTime::ISO8601); $this->index = $index; $this->type = $type; } /** * {@inheritdoc} */ public function format(array $record) { $record = parent::format($record); return $this->getDocument($record); } /** * Getter index * @return string */ public function getIndex() { return $this->index; } /** * Getter type * @return string */ public function getType() { return $this->type; } /** * Convert a log message into an Elastica Document * * @param array $record Log message * @return Document */ protected function getDocument($record) { $document = new Document(); $document->setData($record); $document->setType($this->type); $document->setIndex($this->index); return $document; } } src/Monolog/Formatter/FlowdockFormatter.php000064400000004212146412134770015065 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * formats the record to be used in the FlowdockHandler * * @author Dominik Liebler */ class FlowdockFormatter implements FormatterInterface { /** * @var string */ private $source; /** * @var string */ private $sourceEmail; /** * @param string $source * @param string $sourceEmail */ public function __construct($source, $sourceEmail) { $this->source = $source; $this->sourceEmail = $sourceEmail; } /** * {@inheritdoc} */ public function format(array $record) { $tags = array( '#logs', '#' . strtolower($record['level_name']), '#' . $record['channel'], ); foreach ($record['extra'] as $value) { $tags[] = '#' . $value; } $subject = sprintf( 'in %s: %s - %s', $this->source, $record['level_name'], $this->getShortMessage($record['message']) ); $record['flowdock'] = array( 'source' => $this->source, 'from_address' => $this->sourceEmail, 'subject' => $subject, 'content' => $record['message'], 'tags' => $tags, 'project' => $this->source, ); return $record; } /** * {@inheritdoc} */ public function formatBatch(array $records) { $formatted = array(); foreach ($records as $record) { $formatted[] = $this->format($record); } return $formatted; } /** * @param string $message * * @return string */ public function getShortMessage($message) { $maxLength = 45; if (strlen($message) > $maxLength) { $message = substr($message, 0, $maxLength - 4) . ' ...'; } return $message; } } src/Monolog/Formatter/FormatterInterface.php000064400000001423146412134770015216 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * Interface for formatters * * @author Jordi Boggiano */ interface FormatterInterface { /** * Formats a log record. * * @param array $record A record to format * @return mixed The formatted record */ public function format(array $record); /** * Formats a set of log records. * * @param array $records A set of records to format * @return mixed The formatted set of records */ public function formatBatch(array $records); } src/Monolog/Formatter/GelfMessageFormatter.php000064400000005662146412134770015511 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; use Gelf\Message; /** * Serializes a log message to GELF * @see http://www.graylog2.org/about/gelf * * @author Matt Lehner */ class GelfMessageFormatter extends NormalizerFormatter { /** * @var string the name of the system for the Gelf log message */ protected $systemName; /** * @var string a prefix for 'extra' fields from the Monolog record (optional) */ protected $extraPrefix; /** * @var string a prefix for 'context' fields from the Monolog record (optional) */ protected $contextPrefix; /** * Translates Monolog log levels to Graylog2 log priorities. */ private $logLevels = array( Logger::DEBUG => 7, Logger::INFO => 6, Logger::NOTICE => 5, Logger::WARNING => 4, Logger::ERROR => 3, Logger::CRITICAL => 2, Logger::ALERT => 1, Logger::EMERGENCY => 0, ); public function __construct($systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_') { parent::__construct('U.u'); $this->systemName = $systemName ?: gethostname(); $this->extraPrefix = $extraPrefix; $this->contextPrefix = $contextPrefix; } /** * {@inheritdoc} */ public function format(array $record) { $record = parent::format($record); $message = new Message(); $message ->setTimestamp($record['datetime']) ->setShortMessage((string) $record['message']) ->setFacility($record['channel']) ->setHost($this->systemName) ->setLine(isset($record['extra']['line']) ? $record['extra']['line'] : null) ->setFile(isset($record['extra']['file']) ? $record['extra']['file'] : null) ->setLevel($this->logLevels[$record['level']]); // Do not duplicate these values in the additional fields unset($record['extra']['line']); unset($record['extra']['file']); foreach ($record['extra'] as $key => $val) { $message->setAdditional($this->extraPrefix . $key, is_scalar($val) ? $val : $this->toJson($val)); } foreach ($record['context'] as $key => $val) { $message->setAdditional($this->contextPrefix . $key, is_scalar($val) ? $val : $this->toJson($val)); } if (null === $message->getFile() && isset($record['context']['exception'])) { if (preg_match("/^(.+):([0-9]+)$/", $record['context']['exception']['file'], $matches)) { $message->setFile($matches[1]); $message->setLine($matches[2]); } } return $message; } } src/Monolog/Formatter/HtmlFormatter.php000064400000010606146412134770014225 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; /** * Formats incoming records into an HTML table * * This is especially useful for html email logging * * @author Tiago Brito */ class HtmlFormatter extends NormalizerFormatter { /** * Translates Monolog log levels to html color priorities. */ private $logLevels = array( Logger::DEBUG => '#cccccc', Logger::INFO => '#468847', Logger::NOTICE => '#3a87ad', Logger::WARNING => '#c09853', Logger::ERROR => '#f0ad4e', Logger::CRITICAL => '#FF7708', Logger::ALERT => '#C12A19', Logger::EMERGENCY => '#000000', ); /** * @param string $dateFormat The format of the timestamp: one supported by DateTime::format */ public function __construct($dateFormat = null) { parent::__construct($dateFormat); } /** * Creates an HTML table row * * @param string $th Row header content * @param string $td Row standard cell content * @param bool $escapeTd false if td content must not be html escaped * @return string */ private function addRow($th, $td = ' ', $escapeTd = true) { $th = htmlspecialchars($th, ENT_NOQUOTES, 'UTF-8'); if ($escapeTd) { $td = '
'.htmlspecialchars($td, ENT_NOQUOTES, 'UTF-8').'
'; } return "\n$th:\n".$td."\n"; } /** * Create a HTML h1 tag * * @param string $title Text to be in the h1 * @param integer $level Error level * @return string */ private function addTitle($title, $level) { $title = htmlspecialchars($title, ENT_NOQUOTES, 'UTF-8'); return '

'.$title.'

'; } /** * Formats a log record. * * @param array $record A record to format * @return mixed The formatted record */ public function format(array $record) { $output = $this->addTitle($record['level_name'], $record['level']); $output .= ''; $output .= $this->addRow('Message', (string) $record['message']); $output .= $this->addRow('Time', $record['datetime']->format($this->dateFormat)); $output .= $this->addRow('Channel', $record['channel']); if ($record['context']) { $embeddedTable = '
'; foreach ($record['context'] as $key => $value) { $embeddedTable .= $this->addRow($key, $this->convertToString($value)); } $embeddedTable .= '
'; $output .= $this->addRow('Context', $embeddedTable, false); } if ($record['extra']) { $embeddedTable = ''; foreach ($record['extra'] as $key => $value) { $embeddedTable .= $this->addRow($key, $this->convertToString($value)); } $embeddedTable .= '
'; $output .= $this->addRow('Extra', $embeddedTable, false); } return $output.''; } /** * Formats a set of log records. * * @param array $records A set of records to format * @return mixed The formatted set of records */ public function formatBatch(array $records) { $message = ''; foreach ($records as $record) { $message .= $this->format($record); } return $message; } protected function convertToString($data) { if (null === $data || is_scalar($data)) { return (string) $data; } $data = $this->normalize($data); if (version_compare(PHP_VERSION, '5.4.0', '>=')) { return json_encode($data, JSON_PRETTY_PRINT | JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); } return str_replace('\\/', '/', json_encode($data)); } } src/Monolog/Formatter/JsonFormatter.php000064400000005313146412134770014231 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * Encodes whatever record data is passed to it as json * * This can be useful to log to databases or remote APIs * * @author Jordi Boggiano */ class JsonFormatter implements FormatterInterface { protected $batchMode; protected $appendNewline; const BATCH_MODE_JSON = 1; const BATCH_MODE_NEWLINES = 2; /** * @param int $batchMode */ public function __construct($batchMode = self::BATCH_MODE_JSON, $appendNewline = true) { $this->batchMode = $batchMode; $this->appendNewline = $appendNewline; } /** * The batch mode option configures the formatting style for * multiple records. By default, multiple records will be * formatted as a JSON-encoded array. However, for * compatibility with some API endpoints, alternive styles * are available. * * @return int */ public function getBatchMode() { return $this->batchMode; } /** * True if newlines are appended to every formatted record * * @return bool */ public function isAppendingNewlines() { return $this->appendNewline; } /** * {@inheritdoc} */ public function format(array $record) { return json_encode($record) . ($this->appendNewline ? "\n" : ''); } /** * {@inheritdoc} */ public function formatBatch(array $records) { switch ($this->batchMode) { case static::BATCH_MODE_NEWLINES: return $this->formatBatchNewlines($records); case static::BATCH_MODE_JSON: default: return $this->formatBatchJson($records); } } /** * Return a JSON-encoded array of records. * * @param array $records * @return string */ protected function formatBatchJson(array $records) { return json_encode($records); } /** * Use new lines to separate records instead of a * JSON-encoded array. * * @param array $records * @return string */ protected function formatBatchNewlines(array $records) { $instance = $this; $oldNewline = $this->appendNewline; $this->appendNewline = false; array_walk($records, function (&$value, $key) use ($instance) { $value = $instance->format($value); }); $this->appendNewline = $oldNewline; return implode("\n", $records); } } src/Monolog/Formatter/LineFormatter.php000064400000007542146412134770014215 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Exception; /** * Formats incoming records into a one-line string * * This is especially useful for logging to files * * @author Jordi Boggiano * @author Christophe Coevoet */ class LineFormatter extends NormalizerFormatter { const SIMPLE_FORMAT = "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n"; protected $format; protected $allowInlineLineBreaks; protected $ignoreEmptyContextAndExtra; /** * @param string $format The format of the message * @param string $dateFormat The format of the timestamp: one supported by DateTime::format * @param bool $allowInlineLineBreaks Whether to allow inline line breaks in log entries * @param bool $ignoreEmptyContextAndExtra */ public function __construct($format = null, $dateFormat = null, $allowInlineLineBreaks = false, $ignoreEmptyContextAndExtra = false) { $this->format = $format ?: static::SIMPLE_FORMAT; $this->allowInlineLineBreaks = $allowInlineLineBreaks; $this->ignoreEmptyContextAndExtra = $ignoreEmptyContextAndExtra; parent::__construct($dateFormat); } /** * {@inheritdoc} */ public function format(array $record) { $vars = parent::format($record); $output = $this->format; foreach ($vars['extra'] as $var => $val) { if (false !== strpos($output, '%extra.'.$var.'%')) { $output = str_replace('%extra.'.$var.'%', $this->replaceNewlines($this->convertToString($val)), $output); unset($vars['extra'][$var]); } } if ($this->ignoreEmptyContextAndExtra) { if (empty($vars['context'])) { unset($vars['context']); $output = str_replace('%context%', '', $output); } if (empty($vars['extra'])) { unset($vars['extra']); $output = str_replace('%extra%', '', $output); } } foreach ($vars as $var => $val) { if (false !== strpos($output, '%'.$var.'%')) { $output = str_replace('%'.$var.'%', $this->replaceNewlines($this->convertToString($val)), $output); } } return $output; } public function formatBatch(array $records) { $message = ''; foreach ($records as $record) { $message .= $this->format($record); } return $message; } protected function normalizeException(Exception $e) { $previousText = ''; if ($previous = $e->getPrevious()) { do { $previousText .= ', '.get_class($previous).': '.$previous->getMessage().' at '.$previous->getFile().':'.$previous->getLine(); } while ($previous = $previous->getPrevious()); } return '[object] ('.get_class($e).': '.$e->getMessage().' at '.$e->getFile().':'.$e->getLine().$previousText.')'; } protected function convertToString($data) { if (null === $data || is_bool($data)) { return var_export($data, true); } if (is_scalar($data)) { return (string) $data; } if (version_compare(PHP_VERSION, '5.4.0', '>=')) { return $this->toJson($data, true); } return str_replace('\\/', '/', @json_encode($data)); } protected function replaceNewlines($str) { if ($this->allowInlineLineBreaks) { return $str; } return strtr($str, array("\r\n" => ' ', "\r" => ' ', "\n" => ' ')); } } src/Monolog/Formatter/LogglyFormatter.php000064400000002456146412134770014562 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * Encodes message information into JSON in a format compatible with Loggly. * * @author Adam Pancutt */ class LogglyFormatter extends JsonFormatter { /** * Overrides the default batch mode to new lines for compatibility with the * Loggly bulk API. * * @param integer $batchMode */ public function __construct($batchMode = self::BATCH_MODE_NEWLINES, $appendNewline = false) { parent::__construct($batchMode, $appendNewline); } /** * Appends the 'timestamp' parameter for indexing by Loggly. * * @see https://www.loggly.com/docs/automated-parsing/#json * @see \Monolog\Formatter\JsonFormatter::format() */ public function format(array $record) { if (isset($record["datetime"]) && ($record["datetime"] instanceof \DateTime)) { $record["timestamp"] = $record["datetime"]->format("Y-m-d\TH:i:s.uO"); // TODO 2.0 unset the 'datetime' parameter, retained for BC } return parent::format($record); } } src/Monolog/Formatter/LogstashFormatter.php000064400000012146146412134770015106 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * Serializes a log message to Logstash Event Format * * @see http://logstash.net/ * @see https://github.com/logstash/logstash/blob/master/lib/logstash/event.rb * * @author Tim Mower */ class LogstashFormatter extends NormalizerFormatter { const V0 = 0; const V1 = 1; /** * @var string the name of the system for the Logstash log message, used to fill the @source field */ protected $systemName; /** * @var string an application name for the Logstash log message, used to fill the @type field */ protected $applicationName; /** * @var string a prefix for 'extra' fields from the Monolog record (optional) */ protected $extraPrefix; /** * @var string a prefix for 'context' fields from the Monolog record (optional) */ protected $contextPrefix; /** * @var integer logstash format version to use */ protected $version; /** * @param string $applicationName the application that sends the data, used as the "type" field of logstash * @param string $systemName the system/machine name, used as the "source" field of logstash, defaults to the hostname of the machine * @param string $extraPrefix prefix for extra keys inside logstash "fields" * @param string $contextPrefix prefix for context keys inside logstash "fields", defaults to ctxt_ */ public function __construct($applicationName, $systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_', $version = self::V0) { // logstash requires a ISO 8601 format date with optional millisecond precision. parent::__construct('Y-m-d\TH:i:s.uP'); $this->systemName = $systemName ?: gethostname(); $this->applicationName = $applicationName; $this->extraPrefix = $extraPrefix; $this->contextPrefix = $contextPrefix; $this->version = $version; } /** * {@inheritdoc} */ public function format(array $record) { $record = parent::format($record); if ($this->version === self::V1) { $message = $this->formatV1($record); } else { $message = $this->formatV0($record); } return $this->toJson($message) . "\n"; } protected function formatV0(array $record) { if (empty($record['datetime'])) { $record['datetime'] = gmdate('c'); } $message = array( '@timestamp' => $record['datetime'], '@source' => $this->systemName, '@fields' => array() ); if (isset($record['message'])) { $message['@message'] = $record['message']; } if (isset($record['channel'])) { $message['@tags'] = array($record['channel']); $message['@fields']['channel'] = $record['channel']; } if (isset($record['level'])) { $message['@fields']['level'] = $record['level']; } if ($this->applicationName) { $message['@type'] = $this->applicationName; } if (isset($record['extra']['server'])) { $message['@source_host'] = $record['extra']['server']; } if (isset($record['extra']['url'])) { $message['@source_path'] = $record['extra']['url']; } if (!empty($record['extra'])) { foreach ($record['extra'] as $key => $val) { $message['@fields'][$this->extraPrefix . $key] = $val; } } if (!empty($record['context'])) { foreach ($record['context'] as $key => $val) { $message['@fields'][$this->contextPrefix . $key] = $val; } } return $message; } protected function formatV1(array $record) { if (empty($record['datetime'])) { $record['datetime'] = gmdate('c'); } $message = array( '@timestamp' => $record['datetime'], '@version' => 1, 'host' => $this->systemName, ); if (isset($record['message'])) { $message['message'] = $record['message']; } if (isset($record['channel'])) { $message['type'] = $record['channel']; $message['channel'] = $record['channel']; } if (isset($record['level_name'])) { $message['level'] = $record['level_name']; } if ($this->applicationName) { $message['type'] = $this->applicationName; } if (!empty($record['extra'])) { foreach ($record['extra'] as $key => $val) { $message[$this->extraPrefix . $key] = $val; } } if (!empty($record['context'])) { foreach ($record['context'] as $key => $val) { $message[$this->contextPrefix . $key] = $val; } } return $message; } } src/Monolog/Formatter/NormalizerFormatter.php000064400000007167146412134770015453 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Exception; /** * Normalizes incoming records to remove objects/resources so it's easier to dump to various targets * * @author Jordi Boggiano */ class NormalizerFormatter implements FormatterInterface { const SIMPLE_DATE = "Y-m-d H:i:s"; protected $dateFormat; /** * @param string $dateFormat The format of the timestamp: one supported by DateTime::format */ public function __construct($dateFormat = null) { $this->dateFormat = $dateFormat ?: static::SIMPLE_DATE; if (!function_exists('json_encode')) { throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s NormalizerFormatter'); } } /** * {@inheritdoc} */ public function format(array $record) { return $this->normalize($record); } /** * {@inheritdoc} */ public function formatBatch(array $records) { foreach ($records as $key => $record) { $records[$key] = $this->format($record); } return $records; } protected function normalize($data) { if (null === $data || is_scalar($data)) { return $data; } if (is_array($data) || $data instanceof \Traversable) { $normalized = array(); $count = 1; foreach ($data as $key => $value) { if ($count++ >= 1000) { $normalized['...'] = 'Over 1000 items, aborting normalization'; break; } $normalized[$key] = $this->normalize($value); } return $normalized; } if ($data instanceof \DateTime) { return $data->format($this->dateFormat); } if (is_object($data)) { if ($data instanceof Exception) { return $this->normalizeException($data); } return sprintf("[object] (%s: %s)", get_class($data), $this->toJson($data, true)); } if (is_resource($data)) { return '[resource]'; } return '[unknown('.gettype($data).')]'; } protected function normalizeException(Exception $e) { $data = array( 'class' => get_class($e), 'message' => $e->getMessage(), 'file' => $e->getFile().':'.$e->getLine(), ); $trace = $e->getTrace(); foreach ($trace as $frame) { if (isset($frame['file'])) { $data['trace'][] = $frame['file'].':'.$frame['line']; } else { $data['trace'][] = json_encode($frame); } } if ($previous = $e->getPrevious()) { $data['previous'] = $this->normalizeException($previous); } return $data; } protected function toJson($data, $ignoreErrors = false) { // suppress json_encode errors since it's twitchy with some inputs if ($ignoreErrors) { if (version_compare(PHP_VERSION, '5.4.0', '>=')) { return @json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); } return @json_encode($data); } if (version_compare(PHP_VERSION, '5.4.0', '>=')) { return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); } return json_encode($data); } } src/Monolog/Formatter/ScalarFormatter.php000064400000002020146412134770014515 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * Formats data into an associative array of scalar values. * Objects and arrays will be JSON encoded. * * @author Andrew Lawson */ class ScalarFormatter extends NormalizerFormatter { /** * {@inheritdoc} */ public function format(array $record) { foreach ($record as $key => $value) { $record[$key] = $this->normalizeValue($value); } return $record; } /** * @param mixed $value * @return mixed */ protected function normalizeValue($value) { $normalized = $this->normalize($value); if (is_array($normalized) || is_object($normalized)) { return $this->toJson($normalized, true); } return $normalized; } } src/Monolog/Formatter/WildfireFormatter.php000064400000006242146412134770015067 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; /** * Serializes a log message according to Wildfire's header requirements * * @author Eric Clemmons (@ericclemmons) * @author Christophe Coevoet * @author Kirill chEbba Chebunin */ class WildfireFormatter extends NormalizerFormatter { const TABLE = 'table'; /** * Translates Monolog log levels to Wildfire levels. */ private $logLevels = array( Logger::DEBUG => 'LOG', Logger::INFO => 'INFO', Logger::NOTICE => 'INFO', Logger::WARNING => 'WARN', Logger::ERROR => 'ERROR', Logger::CRITICAL => 'ERROR', Logger::ALERT => 'ERROR', Logger::EMERGENCY => 'ERROR', ); /** * {@inheritdoc} */ public function format(array $record) { // Retrieve the line and file if set and remove them from the formatted extra $file = $line = ''; if (isset($record['extra']['file'])) { $file = $record['extra']['file']; unset($record['extra']['file']); } if (isset($record['extra']['line'])) { $line = $record['extra']['line']; unset($record['extra']['line']); } $record = $this->normalize($record); $message = array('message' => $record['message']); $handleError = false; if ($record['context']) { $message['context'] = $record['context']; $handleError = true; } if ($record['extra']) { $message['extra'] = $record['extra']; $handleError = true; } if (count($message) === 1) { $message = reset($message); } if (isset($record['context'][self::TABLE])) { $type = 'TABLE'; $label = $record['channel'] .': '. $record['message']; $message = $record['context'][self::TABLE]; } else { $type = $this->logLevels[$record['level']]; $label = $record['channel']; } // Create JSON object describing the appearance of the message in the console $json = $this->toJson(array( array( 'Type' => $type, 'File' => $file, 'Line' => $line, 'Label' => $label, ), $message, ), $handleError); // The message itself is a serialization of the above JSON object + it's length return sprintf( '%s|%s|', strlen($json), $json ); } public function formatBatch(array $records) { throw new \BadMethodCallException('Batch formatting does not make sense for the WildfireFormatter'); } protected function normalize($data) { if (is_object($data) && !$data instanceof \DateTime) { return $data; } return parent::normalize($data); } } src/Monolog/Handler/AbstractHandler.php000064400000007720146412134770014113 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Formatter\FormatterInterface; use Monolog\Formatter\LineFormatter; /** * Base Handler class providing the Handler structure * * @author Jordi Boggiano */ abstract class AbstractHandler implements HandlerInterface { protected $level = Logger::DEBUG; protected $bubble = true; /** * @var FormatterInterface */ protected $formatter; protected $processors = array(); /** * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($level = Logger::DEBUG, $bubble = true) { $this->setLevel($level); $this->bubble = $bubble; } /** * {@inheritdoc} */ public function isHandling(array $record) { return $record['level'] >= $this->level; } /** * {@inheritdoc} */ public function handleBatch(array $records) { foreach ($records as $record) { $this->handle($record); } } /** * Closes the handler. * * This will be called automatically when the object is destroyed */ public function close() { } /** * {@inheritdoc} */ public function pushProcessor($callback) { if (!is_callable($callback)) { throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given'); } array_unshift($this->processors, $callback); return $this; } /** * {@inheritdoc} */ public function popProcessor() { if (!$this->processors) { throw new \LogicException('You tried to pop from an empty processor stack.'); } return array_shift($this->processors); } /** * {@inheritdoc} */ public function setFormatter(FormatterInterface $formatter) { $this->formatter = $formatter; return $this; } /** * {@inheritdoc} */ public function getFormatter() { if (!$this->formatter) { $this->formatter = $this->getDefaultFormatter(); } return $this->formatter; } /** * Sets minimum logging level at which this handler will be triggered. * * @param integer $level * @return self */ public function setLevel($level) { $this->level = Logger::toMonologLevel($level); return $this; } /** * Gets minimum logging level at which this handler will be triggered. * * @return integer */ public function getLevel() { return $this->level; } /** * Sets the bubbling behavior. * * @param Boolean $bubble true means that this handler allows bubbling. * false means that bubbling is not permitted. * @return self */ public function setBubble($bubble) { $this->bubble = $bubble; return $this; } /** * Gets the bubbling behavior. * * @return Boolean true means that this handler allows bubbling. * false means that bubbling is not permitted. */ public function getBubble() { return $this->bubble; } public function __destruct() { try { $this->close(); } catch (\Exception $e) { // do nothing } } /** * Gets the default formatter. * * @return FormatterInterface */ protected function getDefaultFormatter() { return new LineFormatter(); } } src/Monolog/Handler/AbstractProcessingHandler.php000064400000002732146412134770016146 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; /** * Base Handler class providing the Handler structure * * Classes extending it should (in most cases) only implement write($record) * * @author Jordi Boggiano * @author Christophe Coevoet */ abstract class AbstractProcessingHandler extends AbstractHandler { /** * {@inheritdoc} */ public function handle(array $record) { if (!$this->isHandling($record)) { return false; } $record = $this->processRecord($record); $record['formatted'] = $this->getFormatter()->format($record); $this->write($record); return false === $this->bubble; } /** * Writes the record down to the log of the implementing handler * * @param array $record * @return void */ abstract protected function write(array $record); /** * Processes a record. * * @param array $record * @return array */ protected function processRecord(array $record) { if ($this->processors) { foreach ($this->processors as $processor) { $record = call_user_func($processor, $record); } } return $record; } } src/Monolog/Handler/AbstractSyslogHandler.php000064400000005475146412134770015321 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Formatter\LineFormatter; /** * Common syslog functionality */ abstract class AbstractSyslogHandler extends AbstractProcessingHandler { protected $facility; /** * Translates Monolog log levels to syslog log priorities. */ protected $logLevels = array( Logger::DEBUG => LOG_DEBUG, Logger::INFO => LOG_INFO, Logger::NOTICE => LOG_NOTICE, Logger::WARNING => LOG_WARNING, Logger::ERROR => LOG_ERR, Logger::CRITICAL => LOG_CRIT, Logger::ALERT => LOG_ALERT, Logger::EMERGENCY => LOG_EMERG, ); /** * List of valid log facility names. */ protected $facilities = array( 'auth' => LOG_AUTH, 'authpriv' => LOG_AUTHPRIV, 'cron' => LOG_CRON, 'daemon' => LOG_DAEMON, 'kern' => LOG_KERN, 'lpr' => LOG_LPR, 'mail' => LOG_MAIL, 'news' => LOG_NEWS, 'syslog' => LOG_SYSLOG, 'user' => LOG_USER, 'uucp' => LOG_UUCP, ); /** * @param mixed $facility * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($facility = LOG_USER, $level = Logger::DEBUG, $bubble = true) { parent::__construct($level, $bubble); if (!defined('PHP_WINDOWS_VERSION_BUILD')) { $this->facilities['local0'] = LOG_LOCAL0; $this->facilities['local1'] = LOG_LOCAL1; $this->facilities['local2'] = LOG_LOCAL2; $this->facilities['local3'] = LOG_LOCAL3; $this->facilities['local4'] = LOG_LOCAL4; $this->facilities['local5'] = LOG_LOCAL5; $this->facilities['local6'] = LOG_LOCAL6; $this->facilities['local7'] = LOG_LOCAL7; } // convert textual description of facility to syslog constant if (array_key_exists(strtolower($facility), $this->facilities)) { $facility = $this->facilities[strtolower($facility)]; } elseif (!in_array($facility, array_values($this->facilities), true)) { throw new \UnexpectedValueException('Unknown facility value "'.$facility.'" given'); } $this->facility = $facility; } /** * {@inheritdoc} */ protected function getDefaultFormatter() { return new LineFormatter('%channel%.%level_name%: %message% %context% %extra%'); } } src/Monolog/Handler/AmqpHandler.php000064400000005276146412134770013252 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Formatter\JsonFormatter; use PhpAmqpLib\Message\AMQPMessage; use PhpAmqpLib\Channel\AMQPChannel; use AMQPExchange; class AmqpHandler extends AbstractProcessingHandler { /** * @var AMQPExchange|AMQPChannel $exchange */ protected $exchange; /** * @var string */ protected $exchangeName; /** * @param AMQPExchange|AMQPChannel $exchange AMQPExchange (php AMQP ext) or PHP AMQP lib channel, ready for use * @param string $exchangeName * @param int $level * @param bool $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($exchange, $exchangeName = 'log', $level = Logger::DEBUG, $bubble = true) { if ($exchange instanceof AMQPExchange) { $exchange->setName($exchangeName); } elseif ($exchange instanceof AMQPChannel) { $this->exchangeName = $exchangeName; } else { throw new \InvalidArgumentException('PhpAmqpLib\Channel\AMQPChannel or AMQPExchange instance required'); } $this->exchange = $exchange; parent::__construct($level, $bubble); } /** * {@inheritDoc} */ protected function write(array $record) { $data = $record["formatted"]; $routingKey = sprintf( '%s.%s', // TODO 2.0 remove substr call substr($record['level_name'], 0, 4), $record['channel'] ); if ($this->exchange instanceof AMQPExchange) { $this->exchange->publish( $data, strtolower($routingKey), 0, array( 'delivery_mode' => 2, 'Content-type' => 'application/json' ) ); } else { $this->exchange->basic_publish( new AMQPMessage( (string) $data, array( 'delivery_mode' => 2, 'content_type' => 'application/json' ) ), $this->exchangeName, strtolower($routingKey) ); } } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); } } src/Monolog/Handler/BrowserConsoleHandler.php000064400000013221146412134770015307 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\LineFormatter; /** * Handler sending logs to browser's javascript console with no browser extension required * * @author Olivier Poitrey */ class BrowserConsoleHandler extends AbstractProcessingHandler { protected static $initialized = false; protected static $records = array(); /** * {@inheritDoc} * * Formatted output may contain some formatting markers to be transfered to `console.log` using the %c format. * * Example of formatted string: * * You can do [[blue text]]{color: blue} or [[green background]]{background-color: green; color: white} * */ protected function getDefaultFormatter() { return new LineFormatter('[[%channel%]]{macro: autolabel} [[%level_name%]]{font-weight: bold} %message%'); } /** * {@inheritDoc} */ protected function write(array $record) { // Accumulate records self::$records[] = $record; // Register shutdown handler if not already done if (PHP_SAPI !== 'cli' && !self::$initialized) { self::$initialized = true; register_shutdown_function(array('Monolog\Handler\BrowserConsoleHandler', 'send')); } } /** * Convert records to javascript console commands and send it to the browser. * This method is automatically called on PHP shutdown if output is HTML. */ public static function send() { // Check content type foreach (headers_list() as $header) { if (stripos($header, 'content-type:') === 0) { if (stripos($header, 'text/html') === false) { // This handler only works with HTML outputs return; } break; } } if (count(self::$records)) { echo ''; self::reset(); } } /** * Forget all logged records */ public static function reset() { self::$records = array(); } private static function generateScript() { $script = array(); foreach (self::$records as $record) { $context = self::dump('Context', $record['context']); $extra = self::dump('Extra', $record['extra']); if (empty($context) && empty($extra)) { $script[] = self::call_array('log', self::handleStyles($record['formatted'])); } else { $script = array_merge($script, array(self::call_array('groupCollapsed', self::handleStyles($record['formatted']))), $context, $extra, array(self::call('groupEnd')) ); } } return "(function (c) {if (c && c.groupCollapsed) {\n" . implode("\n", $script) . "\n}})(console);"; } private static function handleStyles($formatted) { $args = array(self::quote('font-weight: normal')); $format = '%c' . $formatted; preg_match_all('/\[\[(.*?)\]\]\{([^}]*)\}/s', $format, $matches, PREG_OFFSET_CAPTURE | PREG_SET_ORDER); foreach (array_reverse($matches) as $match) { $args[] = self::quote(self::handleCustomStyles($match[2][0], $match[1][0])); $args[] = '"font-weight: normal"'; $pos = $match[0][1]; $format = substr($format, 0, $pos) . '%c' . $match[1][0] . '%c' . substr($format, $pos + strlen($match[0][0])); } array_unshift($args, self::quote($format)); return $args; } private static function handleCustomStyles($style, $string) { static $colors = array('blue', 'green', 'red', 'magenta', 'orange', 'black', 'grey'); static $labels = array(); return preg_replace_callback('/macro\s*:(.*?)(?:;|$)/', function ($m) use ($string, &$colors, &$labels) { if (trim($m[1]) === 'autolabel') { // Format the string as a label with consistent auto assigned background color if (!isset($labels[$string])) { $labels[$string] = $colors[count($labels) % count($colors)]; } $color = $labels[$string]; return "background-color: $color; color: white; border-radius: 3px; padding: 0 2px 0 2px"; } return $m[1]; }, $style); } private static function dump($title, array $dict) { $script = array(); $dict = array_filter($dict); if (empty($dict)) { return $script; } $script[] = self::call('log', self::quote('%c%s'), self::quote('font-weight: bold'), self::quote($title)); foreach ($dict as $key => $value) { $value = json_encode($value); if (empty($value)) { $value = self::quote(''); } $script[] = self::call('log', self::quote('%s: %o'), self::quote($key), $value); } return $script; } private static function quote($arg) { return '"' . addcslashes($arg, "\"\n") . '"'; } private static function call() { $args = func_get_args(); $method = array_shift($args); return self::call_array($method, $args); } private static function call_array($method, array $args) { return 'c.' . $method . '(' . implode(', ', $args) . ');'; } } src/Monolog/Handler/BufferHandler.php000064400000006554146412134770013565 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Buffers all records until closing the handler and then pass them as batch. * * This is useful for a MailHandler to send only one mail per request instead of * sending one per log message. * * @author Christophe Coevoet */ class BufferHandler extends AbstractHandler { protected $handler; protected $bufferSize = 0; protected $bufferLimit; protected $flushOnOverflow; protected $buffer = array(); protected $initialized = false; /** * @param HandlerInterface $handler Handler. * @param integer $bufferLimit How many entries should be buffered at most, beyond that the oldest items are removed from the buffer. * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param Boolean $flushOnOverflow If true, the buffer is flushed when the max size has been reached, by default oldest entries are discarded */ public function __construct(HandlerInterface $handler, $bufferLimit = 0, $level = Logger::DEBUG, $bubble = true, $flushOnOverflow = false) { parent::__construct($level, $bubble); $this->handler = $handler; $this->bufferLimit = (int) $bufferLimit; $this->flushOnOverflow = $flushOnOverflow; } /** * {@inheritdoc} */ public function handle(array $record) { if ($record['level'] < $this->level) { return false; } if (!$this->initialized) { // __destructor() doesn't get called on Fatal errors register_shutdown_function(array($this, 'close')); $this->initialized = true; } if ($this->bufferLimit > 0 && $this->bufferSize === $this->bufferLimit) { if ($this->flushOnOverflow) { $this->flush(); } else { array_shift($this->buffer); $this->bufferSize--; } } if ($this->processors) { foreach ($this->processors as $processor) { $record = call_user_func($processor, $record); } } $this->buffer[] = $record; $this->bufferSize++; return false === $this->bubble; } public function flush() { if ($this->bufferSize === 0) { return; } $this->handler->handleBatch($this->buffer); $this->clear(); } public function __destruct() { // suppress the parent behavior since we already have register_shutdown_function() // to call close(), and the reference contained there will prevent this from being // GC'd until the end of the request } /** * {@inheritdoc} */ public function close() { $this->flush(); } /** * Clears the buffer without flushing any messages down to the wrapped handler. */ public function clear() { $this->bufferSize = 0; $this->buffer = array(); } } src/Monolog/Handler/ChromePHPHandler.php000064400000012331146412134770014127 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\ChromePHPFormatter; use Monolog\Logger; /** * Handler sending logs to the ChromePHP extension (http://www.chromephp.com/) * * @author Christophe Coevoet */ class ChromePHPHandler extends AbstractProcessingHandler { /** * Version of the extension */ const VERSION = '4.0'; /** * Header name */ const HEADER_NAME = 'X-ChromeLogger-Data'; protected static $initialized = false; /** * Tracks whether we sent too much data * * Chrome limits the headers to 256KB, so when we sent 240KB we stop sending * * @var Boolean */ protected static $overflowed = false; protected static $json = array( 'version' => self::VERSION, 'columns' => array('label', 'log', 'backtrace', 'type'), 'rows' => array(), ); protected static $sendHeaders = true; /** * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($level = Logger::DEBUG, $bubble = true) { parent::__construct($level, $bubble); if (!function_exists('json_encode')) { throw new \RuntimeException('PHP\'s json extension is required to use Monolog\'s ChromePHPHandler'); } } /** * {@inheritdoc} */ public function handleBatch(array $records) { $messages = array(); foreach ($records as $record) { if ($record['level'] < $this->level) { continue; } $messages[] = $this->processRecord($record); } if (!empty($messages)) { $messages = $this->getFormatter()->formatBatch($messages); self::$json['rows'] = array_merge(self::$json['rows'], $messages); $this->send(); } } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new ChromePHPFormatter(); } /** * Creates & sends header for a record * * @see sendHeader() * @see send() * @param array $record */ protected function write(array $record) { self::$json['rows'][] = $record['formatted']; $this->send(); } /** * Sends the log header * * @see sendHeader() */ protected function send() { if (self::$overflowed || !self::$sendHeaders) { return; } if (!self::$initialized) { self::$initialized = true; self::$sendHeaders = $this->headersAccepted(); if (!self::$sendHeaders) { return; } self::$json['request_uri'] = isset($_SERVER['REQUEST_URI']) ? $_SERVER['REQUEST_URI'] : ''; } $json = @json_encode(self::$json); $data = base64_encode(utf8_encode($json)); if (strlen($data) > 240*1024) { self::$overflowed = true; $record = array( 'message' => 'Incomplete logs, chrome header size limit reached', 'context' => array(), 'level' => Logger::WARNING, 'level_name' => Logger::getLevelName(Logger::WARNING), 'channel' => 'monolog', 'datetime' => new \DateTime(), 'extra' => array(), ); self::$json['rows'][count(self::$json['rows']) - 1] = $this->getFormatter()->format($record); $json = @json_encode(self::$json); $data = base64_encode(utf8_encode($json)); } if (trim($data) !== '') { $this->sendHeader(self::HEADER_NAME, $data); } } /** * Send header string to the client * * @param string $header * @param string $content */ protected function sendHeader($header, $content) { if (!headers_sent() && self::$sendHeaders) { header(sprintf('%s: %s', $header, $content)); } } /** * Verifies if the headers are accepted by the current user agent * * @return Boolean */ protected function headersAccepted() { if (empty($_SERVER['HTTP_USER_AGENT'])) { return false; } return preg_match('{\bChrome/\d+[\.\d+]*\b}', $_SERVER['HTTP_USER_AGENT']); } /** * BC getter for the sendHeaders property that has been made static */ public function __get($property) { if ('sendHeaders' !== $property) { throw new \InvalidArgumentException('Undefined property '.$property); } return static::$sendHeaders; } /** * BC setter for the sendHeaders property that has been made static */ public function __set($property, $value) { if ('sendHeaders' !== $property) { throw new \InvalidArgumentException('Undefined property '.$property); } static::$sendHeaders = $value; } } src/Monolog/Handler/CouchDBHandler.php000064400000003640146412134770013614 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\JsonFormatter; use Monolog\Logger; /** * CouchDB handler * * @author Markus Bachmann */ class CouchDBHandler extends AbstractProcessingHandler { private $options; public function __construct(array $options = array(), $level = Logger::DEBUG, $bubble = true) { $this->options = array_merge(array( 'host' => 'localhost', 'port' => 5984, 'dbname' => 'logger', 'username' => null, 'password' => null, ), $options); parent::__construct($level, $bubble); } /** * {@inheritDoc} */ protected function write(array $record) { $basicAuth = null; if ($this->options['username']) { $basicAuth = sprintf('%s:%s@', $this->options['username'], $this->options['password']); } $url = 'http://'.$basicAuth.$this->options['host'].':'.$this->options['port'].'/'.$this->options['dbname']; $context = stream_context_create(array( 'http' => array( 'method' => 'POST', 'content' => $record['formatted'], 'ignore_errors' => true, 'max_redirects' => 0, 'header' => 'Content-type: application/json', ) )); if (false === @file_get_contents($url, null, $context)) { throw new \RuntimeException(sprintf('Could not connect to %s', $url)); } } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); } } src/Monolog/Handler/CubeHandler.php000064400000010531146412134770013220 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Logs to Cube. * * @link http://square.github.com/cube/ * @author Wan Chen */ class CubeHandler extends AbstractProcessingHandler { private $udpConnection = null; private $httpConnection = null; private $scheme = null; private $host = null; private $port = null; private $acceptedSchemes = array('http', 'udp'); /** * Create a Cube handler * * @throws UnexpectedValueException when given url is not a valid url. * A valid url must consists of three parts : protocol://host:port * Only valid protocol used by Cube are http and udp */ public function __construct($url, $level = Logger::DEBUG, $bubble = true) { $urlInfos = parse_url($url); if (!isset($urlInfos['scheme']) || !isset($urlInfos['host']) || !isset($urlInfos['port'])) { throw new \UnexpectedValueException('URL "'.$url.'" is not valid'); } if (!in_array($urlInfos['scheme'], $this->acceptedSchemes)) { throw new \UnexpectedValueException( 'Invalid protocol (' . $urlInfos['scheme'] . ').' . ' Valid options are ' . implode(', ', $this->acceptedSchemes)); } $this->scheme = $urlInfos['scheme']; $this->host = $urlInfos['host']; $this->port = $urlInfos['port']; parent::__construct($level, $bubble); } /** * Establish a connection to an UDP socket * * @throws LogicException when unable to connect to the socket */ protected function connectUdp() { if (!extension_loaded('sockets')) { throw new MissingExtensionException('The sockets extension is required to use udp URLs with the CubeHandler'); } $this->udpConnection = socket_create(AF_INET, SOCK_DGRAM, 0); if (!$this->udpConnection) { throw new \LogicException('Unable to create a socket'); } if (!socket_connect($this->udpConnection, $this->host, $this->port)) { throw new \LogicException('Unable to connect to the socket at ' . $this->host . ':' . $this->port); } } /** * Establish a connection to a http server */ protected function connectHttp() { if (!extension_loaded('curl')) { throw new \LogicException('The curl extension is needed to use http URLs with the CubeHandler'); } $this->httpConnection = curl_init('http://'.$this->host.':'.$this->port.'/1.0/event/put'); if (!$this->httpConnection) { throw new \LogicException('Unable to connect to ' . $this->host . ':' . $this->port); } curl_setopt($this->httpConnection, CURLOPT_CUSTOMREQUEST, "POST"); curl_setopt($this->httpConnection, CURLOPT_RETURNTRANSFER, true); } /** * {@inheritdoc} */ protected function write(array $record) { $date = $record['datetime']; $data = array('time' => $date->format('Y-m-d\TH:i:s.uO')); unset($record['datetime']); if (isset($record['context']['type'])) { $data['type'] = $record['context']['type']; unset($record['context']['type']); } else { $data['type'] = $record['channel']; } $data['data'] = $record['context']; $data['data']['level'] = $record['level']; $this->{'write'.$this->scheme}(json_encode($data)); } private function writeUdp($data) { if (!$this->udpConnection) { $this->connectUdp(); } socket_send($this->udpConnection, $data, strlen($data), 0); } private function writeHttp($data) { if (!$this->httpConnection) { $this->connectHttp(); } curl_setopt($this->httpConnection, CURLOPT_POSTFIELDS, '['.$data.']'); curl_setopt($this->httpConnection, CURLOPT_HTTPHEADER, array( 'Content-Type: application/json', 'Content-Length: ' . strlen('['.$data.']')) ); return curl_exec($this->httpConnection); } } src/Monolog/Handler/DoctrineCouchDBHandler.php000064400000001750146412134770015304 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Formatter\NormalizerFormatter; use Doctrine\CouchDB\CouchDBClient; /** * CouchDB handler for Doctrine CouchDB ODM * * @author Markus Bachmann */ class DoctrineCouchDBHandler extends AbstractProcessingHandler { private $client; public function __construct(CouchDBClient $client, $level = Logger::DEBUG, $bubble = true) { $this->client = $client; parent::__construct($level, $bubble); } /** * {@inheritDoc} */ protected function write(array $record) { $this->client->postDocument($record['formatted']); } protected function getDefaultFormatter() { return new NormalizerFormatter; } } src/Monolog/Handler/DynamoDbHandler.php000064400000004157146412134770014046 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Aws\Common\Aws; use Aws\DynamoDb\DynamoDbClient; use Monolog\Formatter\ScalarFormatter; use Monolog\Logger; /** * Amazon DynamoDB handler (http://aws.amazon.com/dynamodb/) * * @link https://github.com/aws/aws-sdk-php/ * @author Andrew Lawson */ class DynamoDbHandler extends AbstractProcessingHandler { const DATE_FORMAT = 'Y-m-d\TH:i:s.uO'; /** * @var DynamoDbClient */ protected $client; /** * @var string */ protected $table; /** * @param DynamoDbClient $client * @param string $table * @param integer $level * @param boolean $bubble */ public function __construct(DynamoDbClient $client, $table, $level = Logger::DEBUG, $bubble = true) { if (!defined('Aws\Common\Aws::VERSION') || version_compare('3.0', Aws::VERSION, '<=')) { throw new \RuntimeException('The DynamoDbHandler is only known to work with the AWS SDK 2.x releases'); } $this->client = $client; $this->table = $table; parent::__construct($level, $bubble); } /** * {@inheritdoc} */ protected function write(array $record) { $filtered = $this->filterEmptyFields($record['formatted']); $formatted = $this->client->formatAttributes($filtered); $this->client->putItem(array( 'TableName' => $this->table, 'Item' => $formatted )); } /** * @param array $record * @return array */ protected function filterEmptyFields(array $record) { return array_filter($record, function ($value) { return !empty($value) || false === $value || 0 === $value; }); } /** * {@inheritdoc} */ protected function getDefaultFormatter() { return new ScalarFormatter(self::DATE_FORMAT); } } src/Monolog/Handler/ElasticSearchHandler.php000064400000006531146412134770015061 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\FormatterInterface; use Monolog\Formatter\ElasticaFormatter; use Monolog\Logger; use Elastica\Client; use Elastica\Exception\ExceptionInterface; /** * Elastic Search handler * * Usage example: * * $client = new \Elastica\Client(); * $options = array( * 'index' => 'elastic_index_name', * 'type' => 'elastic_doc_type', * ); * $handler = new ElasticSearchHandler($client, $options); * $log = new Logger('application'); * $log->pushHandler($handler); * * @author Jelle Vink */ class ElasticSearchHandler extends AbstractProcessingHandler { /** * @var Client */ protected $client; /** * @var array Handler config options */ protected $options = array(); /** * @param Client $client Elastica Client object * @param array $options Handler configuration * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct(Client $client, array $options = array(), $level = Logger::DEBUG, $bubble = true) { parent::__construct($level, $bubble); $this->client = $client; $this->options = array_merge( array( 'index' => 'monolog', // Elastic index name 'type' => 'record', // Elastic document type 'ignore_error' => false, // Suppress Elastica exceptions ), $options ); } /** * {@inheritDoc} */ protected function write(array $record) { $this->bulkSend(array($record['formatted'])); } /** * {@inheritdoc} */ public function setFormatter(FormatterInterface $formatter) { if ($formatter instanceof ElasticaFormatter) { return parent::setFormatter($formatter); } throw new \InvalidArgumentException('ElasticSearchHandler is only compatible with ElasticaFormatter'); } /** * Getter options * @return array */ public function getOptions() { return $this->options; } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new ElasticaFormatter($this->options['index'], $this->options['type']); } /** * {@inheritdoc} */ public function handleBatch(array $records) { $documents = $this->getFormatter()->formatBatch($records); $this->bulkSend($documents); } /** * Use Elasticsearch bulk API to send list of documents * @param array $documents * @throws \RuntimeException */ protected function bulkSend(array $documents) { try { $this->client->addDocuments($documents); } catch (ExceptionInterface $e) { if (!$this->options['ignore_error']) { throw new \RuntimeException("Error sending messages to Elasticsearch", 0, $e); } } } } src/Monolog/Handler/ErrorLogHandler.php000064400000004514146412134770014101 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\LineFormatter; use Monolog\Logger; /** * Stores to PHP error_log() handler. * * @author Elan Ruusamäe */ class ErrorLogHandler extends AbstractProcessingHandler { const OPERATING_SYSTEM = 0; const SAPI = 4; protected $messageType; protected $expandNewlines; /** * @param integer $messageType Says where the error should go. * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param Boolean $expandNewlines If set to true, newlines in the message will be expanded to be take multiple log entries */ public function __construct($messageType = self::OPERATING_SYSTEM, $level = Logger::DEBUG, $bubble = true, $expandNewlines = false) { parent::__construct($level, $bubble); if (false === in_array($messageType, self::getAvailableTypes())) { $message = sprintf('The given message type "%s" is not supported', print_r($messageType, true)); throw new \InvalidArgumentException($message); } $this->messageType = $messageType; $this->expandNewlines = $expandNewlines; } /** * @return array With all available types */ public static function getAvailableTypes() { return array( self::OPERATING_SYSTEM, self::SAPI, ); } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new LineFormatter('[%datetime%] %channel%.%level_name%: %message% %context% %extra%'); } /** * {@inheritdoc} */ protected function write(array $record) { if ($this->expandNewlines) { $lines = preg_split('{[\r\n]+}', (string) $record['formatted']); foreach ($lines as $line) { error_log($line, $this->messageType); } } else { error_log((string) $record['formatted'], $this->messageType); } } } src/Monolog/Handler/ExceptionTestHandler.php000064400000001426146412134770015143 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Used for testing purposes. * * It records all records and gives you access to them for verification. It * throws an exception from handle and handleBatch to test the * WhatFailureGroupHandler Class. * * @author Craig D'Amelio */ class ExceptionTestHandler extends TestHandler { /** * {@inheritdoc} */ public function handle(array $record) { $return = parent::handle($record); throw new \Exception("ExceptionTestHandler::handle"); } } src/Monolog/Handler/FilterHandler.php000064400000010473146412134770013574 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Simple handler wrapper that filters records based on a list of levels * * It can be configured with an exact list of levels to allow, or a min/max level. * * @author Hennadiy Verkh * @author Jordi Boggiano */ class FilterHandler extends AbstractHandler { /** * Handler or factory callable($record, $this) * * @var callable|\Monolog\Handler\HandlerInterface */ protected $handler; /** * Minimum level for logs that are passes to handler * * @var int[] */ protected $acceptedLevels; /** * Whether the messages that are handled can bubble up the stack or not * * @var Boolean */ protected $bubble; /** * @param callable|HandlerInterface $handler Handler or factory callable($record, $this). * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided * @param int $maxLevel Maximum level to accept, only used if $minLevelOrList is not an array * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($handler, $minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY, $bubble = true) { $this->handler = $handler; $this->bubble = $bubble; $this->setAcceptedLevels($minLevelOrList, $maxLevel); } /** * @return array */ public function getAcceptedLevels() { return array_flip($this->acceptedLevels); } /** * @param int|array $minLevelOrList A list of levels to accept or a minimum level if maxLevel is provided * @param int $maxLevel Maximum level to accept, only used if $minLevelOrList is not an array */ public function setAcceptedLevels($minLevelOrList = Logger::DEBUG, $maxLevel = Logger::EMERGENCY) { if (is_array($minLevelOrList)) { $acceptedLevels = array_map('Monolog\Logger::toMonologLevel', $minLevelOrList); } else { $minLevelOrList = Logger::toMonologLevel($minLevelOrList); $maxLevel = Logger::toMonologLevel($maxLevel); $acceptedLevels = array_values(array_filter(Logger::getLevels(), function ($level) use ($minLevelOrList, $maxLevel) { return $level >= $minLevelOrList && $level <= $maxLevel; })); } $this->acceptedLevels = array_flip($acceptedLevels); } /** * {@inheritdoc} */ public function isHandling(array $record) { return isset($this->acceptedLevels[$record['level']]); } /** * {@inheritdoc} */ public function handle(array $record) { if (!$this->isHandling($record)) { return false; } // The same logic as in FingersCrossedHandler if (!$this->handler instanceof HandlerInterface) { if (!is_callable($this->handler)) { throw new \RuntimeException( "The given handler (" . json_encode($this->handler) . ") is not a callable nor a Monolog\\Handler\\HandlerInterface object" ); } $this->handler = call_user_func($this->handler, $record, $this); if (!$this->handler instanceof HandlerInterface) { throw new \RuntimeException("The factory callable should return a HandlerInterface"); } } if ($this->processors) { foreach ($this->processors as $processor) { $record = call_user_func($processor, $record); } } $this->handler->handle($record); return false === $this->bubble; } /** * {@inheritdoc} */ public function handleBatch(array $records) { $filtered = array(); foreach ($records as $record) { if ($this->isHandling($record)) { $filtered[] = $record; } } $this->handler->handleBatch($filtered); } } src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php000064400000001213146412134770021426 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler\FingersCrossed; /** * Interface for activation strategies for the FingersCrossedHandler. * * @author Johannes M. Schmitt */ interface ActivationStrategyInterface { /** * Returns whether the given record activates the handler. * * @param array $record * @return Boolean */ public function isHandlerActivated(array $record); } src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php000064400000003607146412134770022077 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler\FingersCrossed; use Monolog\Logger; /** * Channel and Error level based monolog activation strategy. Allows to trigger activation * based on level per channel. e.g. trigger activation on level 'ERROR' by default, except * for records of the 'sql' channel; those should trigger activation on level 'WARN'. * * Example: * * * $activationStrategy = new ChannelLevelActivationStrategy( * Logger::CRITICAL, * array( * 'request' => Logger::ALERT, * 'sensitive' => Logger::ERROR, * ) * ); * $handler = new FingersCrossedHandler(new StreamHandler('php://stderr'), $activationStrategy); * * * @author Mike Meessen */ class ChannelLevelActivationStrategy implements ActivationStrategyInterface { private $defaultActionLevel; private $channelToActionLevel; /** * @param int $defaultActionLevel The default action level to be used if the record's category doesn't match any * @param array $channelToActionLevel An array that maps channel names to action levels. */ public function __construct($defaultActionLevel, $channelToActionLevel = array()) { $this->defaultActionLevel = Logger::toMonologLevel($defaultActionLevel); $this->channelToActionLevel = array_map('Monolog\Logger::toMonologLevel', $channelToActionLevel); } public function isHandlerActivated(array $record) { if (isset($this->channelToActionLevel[$record['channel']])) { return $record['level'] >= $this->channelToActionLevel[$record['channel']]; } return $record['level'] >= $this->defaultActionLevel; } } src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php000064400000001367146412134770021621 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler\FingersCrossed; use Monolog\Logger; /** * Error level based activation strategy. * * @author Johannes M. Schmitt */ class ErrorLevelActivationStrategy implements ActivationStrategyInterface { private $actionLevel; public function __construct($actionLevel) { $this->actionLevel = Logger::toMonologLevel($actionLevel); } public function isHandlerActivated(array $record) { return $record['level'] >= $this->actionLevel; } } src/Monolog/Handler/FingersCrossedHandler.php000064400000012446146412134770015271 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy; use Monolog\Handler\FingersCrossed\ActivationStrategyInterface; use Monolog\Logger; /** * Buffers all records until a certain level is reached * * The advantage of this approach is that you don't get any clutter in your log files. * Only requests which actually trigger an error (or whatever your actionLevel is) will be * in the logs, but they will contain all records, not only those above the level threshold. * * You can find the various activation strategies in the * Monolog\Handler\FingersCrossed\ namespace. * * @author Jordi Boggiano */ class FingersCrossedHandler extends AbstractHandler { protected $handler; protected $activationStrategy; protected $buffering = true; protected $bufferSize; protected $buffer = array(); protected $stopBuffering; protected $passthruLevel; /** * @param callable|HandlerInterface $handler Handler or factory callable($record, $fingersCrossedHandler). * @param int|ActivationStrategyInterface $activationStrategy Strategy which determines when this handler takes action * @param int $bufferSize How many entries should be buffered at most, beyond that the oldest items are removed from the buffer. * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param Boolean $stopBuffering Whether the handler should stop buffering after being triggered (default true) * @param int $passthruLevel Minimum level to always flush to handler on close, even if strategy not triggered */ public function __construct($handler, $activationStrategy = null, $bufferSize = 0, $bubble = true, $stopBuffering = true, $passthruLevel = null) { if (null === $activationStrategy) { $activationStrategy = new ErrorLevelActivationStrategy(Logger::WARNING); } // convert simple int activationStrategy to an object if (!$activationStrategy instanceof ActivationStrategyInterface) { $activationStrategy = new ErrorLevelActivationStrategy($activationStrategy); } $this->handler = $handler; $this->activationStrategy = $activationStrategy; $this->bufferSize = $bufferSize; $this->bubble = $bubble; $this->stopBuffering = $stopBuffering; $this->passthruLevel = $passthruLevel; } /** * {@inheritdoc} */ public function isHandling(array $record) { return true; } /** * {@inheritdoc} */ public function handle(array $record) { if ($this->processors) { foreach ($this->processors as $processor) { $record = call_user_func($processor, $record); } } if ($this->buffering) { $this->buffer[] = $record; if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) { array_shift($this->buffer); } if ($this->activationStrategy->isHandlerActivated($record)) { if ($this->stopBuffering) { $this->buffering = false; } if (!$this->handler instanceof HandlerInterface) { if (!is_callable($this->handler)) { throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object"); } $this->handler = call_user_func($this->handler, $record, $this); if (!$this->handler instanceof HandlerInterface) { throw new \RuntimeException("The factory callable should return a HandlerInterface"); } } $this->handler->handleBatch($this->buffer); $this->buffer = array(); } } else { $this->handler->handle($record); } return false === $this->bubble; } /** * {@inheritdoc} */ public function close() { if (null !== $this->passthruLevel) { $level = $this->passthruLevel; $this->buffer = array_filter($this->buffer, function ($record) use ($level) { return $record['level'] >= $level; }); if (count($this->buffer) > 0) { $this->handler->handleBatch($this->buffer); $this->buffer = array(); } } } /** * Resets the state of the handler. Stops forwarding records to the wrapped handler. */ public function reset() { $this->buffering = true; } /** * Clears the buffer without flushing any messages down to the wrapped handler. * * It also resets the handler to its initial buffering state. */ public function clear() { $this->buffer = array(); $this->reset(); } } src/Monolog/Handler/FirePHPHandler.php000064400000012532146412134770013602 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\WildfireFormatter; /** * Simple FirePHP Handler (http://www.firephp.org/), which uses the Wildfire protocol. * * @author Eric Clemmons (@ericclemmons) */ class FirePHPHandler extends AbstractProcessingHandler { /** * WildFire JSON header message format */ const PROTOCOL_URI = 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2'; /** * FirePHP structure for parsing messages & their presentation */ const STRUCTURE_URI = 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1'; /** * Must reference a "known" plugin, otherwise headers won't display in FirePHP */ const PLUGIN_URI = 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3'; /** * Header prefix for Wildfire to recognize & parse headers */ const HEADER_PREFIX = 'X-Wf'; /** * Whether or not Wildfire vendor-specific headers have been generated & sent yet */ protected static $initialized = false; /** * Shared static message index between potentially multiple handlers * @var int */ protected static $messageIndex = 1; protected static $sendHeaders = true; /** * Base header creation function used by init headers & record headers * * @param array $meta Wildfire Plugin, Protocol & Structure Indexes * @param string $message Log message * @return array Complete header string ready for the client as key and message as value */ protected function createHeader(array $meta, $message) { $header = sprintf('%s-%s', self::HEADER_PREFIX, join('-', $meta)); return array($header => $message); } /** * Creates message header from record * * @see createHeader() * @param array $record * @return string */ protected function createRecordHeader(array $record) { // Wildfire is extensible to support multiple protocols & plugins in a single request, // but we're not taking advantage of that (yet), so we're using "1" for simplicity's sake. return $this->createHeader( array(1, 1, 1, self::$messageIndex++), $record['formatted'] ); } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new WildfireFormatter(); } /** * Wildfire initialization headers to enable message parsing * * @see createHeader() * @see sendHeader() * @return array */ protected function getInitHeaders() { // Initial payload consists of required headers for Wildfire return array_merge( $this->createHeader(array('Protocol', 1), self::PROTOCOL_URI), $this->createHeader(array(1, 'Structure', 1), self::STRUCTURE_URI), $this->createHeader(array(1, 'Plugin', 1), self::PLUGIN_URI) ); } /** * Send header string to the client * * @param string $header * @param string $content */ protected function sendHeader($header, $content) { if (!headers_sent() && self::$sendHeaders) { header(sprintf('%s: %s', $header, $content)); } } /** * Creates & sends header for a record, ensuring init headers have been sent prior * * @see sendHeader() * @see sendInitHeaders() * @param array $record */ protected function write(array $record) { if (!self::$sendHeaders) { return; } // WildFire-specific headers must be sent prior to any messages if (!self::$initialized) { self::$initialized = true; self::$sendHeaders = $this->headersAccepted(); if (!self::$sendHeaders) { return; } foreach ($this->getInitHeaders() as $header => $content) { $this->sendHeader($header, $content); } } $header = $this->createRecordHeader($record); if (trim(current($header)) !== '') { $this->sendHeader(key($header), current($header)); } } /** * Verifies if the headers are accepted by the current user agent * * @return Boolean */ protected function headersAccepted() { if (!empty($_SERVER['HTTP_USER_AGENT']) && preg_match('{\bFirePHP/\d+\.\d+\b}', $_SERVER['HTTP_USER_AGENT'])) { return true; } return isset($_SERVER['HTTP_X_FIREPHP_VERSION']); } /** * BC getter for the sendHeaders property that has been made static */ public function __get($property) { if ('sendHeaders' !== $property) { throw new \InvalidArgumentException('Undefined property '.$property); } return static::$sendHeaders; } /** * BC setter for the sendHeaders property that has been made static */ public function __set($property, $value) { if ('sendHeaders' !== $property) { throw new \InvalidArgumentException('Undefined property '.$property); } static::$sendHeaders = $value; } } src/Monolog/Handler/FleepHookHandler.php000064400000006442146412134770014224 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\LineFormatter; use Monolog\Logger; /** * Sends logs to Fleep.io using Webhook integrations * * You'll need a Fleep.io account to use this handler. * * @see https://fleep.io/integrations/webhooks/ Fleep Webhooks Documentation * @author Ando Roots */ class FleepHookHandler extends SocketHandler { const FLEEP_HOST = 'fleep.io'; const FLEEP_HOOK_URI = '/hook/'; /** * @var string Webhook token (specifies the conversation where logs are sent) */ protected $token; /** * Construct a new Fleep.io Handler. * * For instructions on how to create a new web hook in your conversations * see https://fleep.io/integrations/webhooks/ * * @param string $token Webhook token * @param bool|int $level The minimum logging level at which this handler will be triggered * @param bool $bubble Whether the messages that are handled can bubble up the stack or not * @throws MissingExtensionException */ public function __construct($token, $level = Logger::DEBUG, $bubble = true) { if (!extension_loaded('openssl')) { throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FleepHookHandler'); } $this->token = $token; $connectionString = 'ssl://' . self::FLEEP_HOST . ':443'; parent::__construct($connectionString, $level, $bubble); } /** * Returns the default formatter to use with this handler * * Overloaded to remove empty context and extra arrays from the end of the log message. * * @return LineFormatter */ protected function getDefaultFormatter() { return new LineFormatter(null, null, true, true); } /** * Handles a log record * * @param array $record */ public function write(array $record) { parent::write($record); $this->closeSocket(); } /** * {@inheritdoc} * * @param array $record * @return string */ protected function generateDataStream($record) { $content = $this->buildContent($record); return $this->buildHeader($content) . $content; } /** * Builds the header of the API Call * * @param string $content * @return string */ private function buildHeader($content) { $header = "POST " . self::FLEEP_HOOK_URI . $this->token . " HTTP/1.1\r\n"; $header .= "Host: " . self::FLEEP_HOST . "\r\n"; $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; $header .= "Content-Length: " . strlen($content) . "\r\n"; $header .= "\r\n"; return $header; } /** * Builds the body of API call * * @param array $record * @return string */ private function buildContent($record) { $dataArray = array( 'message' => $record['formatted'] ); return http_build_query($dataArray); } } src/Monolog/Handler/FlowdockHandler.php000064400000004774146412134770014126 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Sends notifications through the Flowdock push API * * This must be configured with a FlowdockFormatter instance via setFormatter() * * Notes: * API token - Flowdock API token * * @author Dominik Liebler * @see https://www.flowdock.com/api/push */ class FlowdockHandler extends SocketHandler { /** * @var string */ protected $apiToken; /** * @param string $apiToken * @param bool|int $level The minimum logging level at which this handler will be triggered * @param bool $bubble Whether the messages that are handled can bubble up the stack or not * * @throws MissingExtensionException if OpenSSL is missing */ public function __construct($apiToken, $level = Logger::DEBUG, $bubble = true) { if (!extension_loaded('openssl')) { throw new MissingExtensionException('The OpenSSL PHP extension is required to use the FlowdockHandler'); } parent::__construct('ssl://api.flowdock.com:443', $level, $bubble); $this->apiToken = $apiToken; } /** * {@inheritdoc} * * @param array $record */ protected function write(array $record) { parent::write($record); $this->closeSocket(); } /** * {@inheritdoc} * * @param array $record * @return string */ protected function generateDataStream($record) { $content = $this->buildContent($record); return $this->buildHeader($content) . $content; } /** * Builds the body of API call * * @param array $record * @return string */ private function buildContent($record) { return json_encode($record['formatted']['flowdock']); } /** * Builds the header of the API Call * * @param string $content * @return string */ private function buildHeader($content) { $header = "POST /v1/messages/team_inbox/" . $this->apiToken . " HTTP/1.1\r\n"; $header .= "Host: api.flowdock.com\r\n"; $header .= "Content-Type: application/json\r\n"; $header .= "Content-Length: " . strlen($content) . "\r\n"; $header .= "\r\n"; return $header; } } src/Monolog/Handler/GelfHandler.php000064400000003656146412134770013231 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Gelf\IMessagePublisher; use Gelf\PublisherInterface; use InvalidArgumentException; use Monolog\Logger; use Monolog\Formatter\GelfMessageFormatter; /** * Handler to send messages to a Graylog2 (http://www.graylog2.org) server * * @author Matt Lehner * @author Benjamin Zikarsky */ class GelfHandler extends AbstractProcessingHandler { /** * @var Publisher the publisher object that sends the message to the server */ protected $publisher; /** * @param PublisherInterface|IMessagePublisher $publisher a publisher object * @param integer $level The minimum logging level at which this handler will be triggered * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($publisher, $level = Logger::DEBUG, $bubble = true) { parent::__construct($level, $bubble); if (!$publisher instanceof IMessagePublisher && !$publisher instanceof PublisherInterface) { throw new InvalidArgumentException("Invalid publisher, expected a Gelf\IMessagePublisher or Gelf\PublisherInterface instance"); } $this->publisher = $publisher; } /** * {@inheritdoc} */ public function close() { $this->publisher = null; } /** * {@inheritdoc} */ protected function write(array $record) { $this->publisher->publish($record['formatted']); } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new GelfMessageFormatter(); } } src/Monolog/Handler/GroupHandler.php000064400000003541146412134770013441 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; /** * Forwards records to multiple handlers * * @author Lenar Lõhmus */ class GroupHandler extends AbstractHandler { protected $handlers; /** * @param array $handlers Array of Handlers. * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct(array $handlers, $bubble = true) { foreach ($handlers as $handler) { if (!$handler instanceof HandlerInterface) { throw new \InvalidArgumentException('The first argument of the GroupHandler must be an array of HandlerInterface instances.'); } } $this->handlers = $handlers; $this->bubble = $bubble; } /** * {@inheritdoc} */ public function isHandling(array $record) { foreach ($this->handlers as $handler) { if ($handler->isHandling($record)) { return true; } } return false; } /** * {@inheritdoc} */ public function handle(array $record) { if ($this->processors) { foreach ($this->processors as $processor) { $record = call_user_func($processor, $record); } } foreach ($this->handlers as $handler) { $handler->handle($record); } return false === $this->bubble; } /** * {@inheritdoc} */ public function handleBatch(array $records) { foreach ($this->handlers as $handler) { $handler->handleBatch($records); } } } src/Monolog/Handler/HandlerInterface.php000064400000004766146412134770014257 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\FormatterInterface; /** * Interface that all Monolog Handlers must implement * * @author Jordi Boggiano */ interface HandlerInterface { /** * Checks whether the given record will be handled by this handler. * * This is mostly done for performance reasons, to avoid calling processors for nothing. * * Handlers should still check the record levels within handle(), returning false in isHandling() * is no guarantee that handle() will not be called, and isHandling() might not be called * for a given record. * * @param array $record * * @return Boolean */ public function isHandling(array $record); /** * Handles a record. * * All records may be passed to this method, and the handler should discard * those that it does not want to handle. * * The return value of this function controls the bubbling process of the handler stack. * Unless the bubbling is interrupted (by returning true), the Logger class will keep on * calling further handlers in the stack with a given log record. * * @param array $record The record to handle * @return Boolean true means that this handler handled the record, and that bubbling is not permitted. * false means the record was either not processed or that this handler allows bubbling. */ public function handle(array $record); /** * Handles a set of records at once. * * @param array $records The records to handle (an array of record arrays) */ public function handleBatch(array $records); /** * Adds a processor in the stack. * * @param callable $callback * @return self */ public function pushProcessor($callback); /** * Removes the processor on top of the stack and returns it. * * @return callable */ public function popProcessor(); /** * Sets the formatter. * * @param FormatterInterface $formatter * @return self */ public function setFormatter(FormatterInterface $formatter); /** * Gets the formatter. * * @return FormatterInterface */ public function getFormatter(); } src/Monolog/Handler/HipChatHandler.php000064400000020471146412134770013666 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Sends notifications through the hipchat api to a hipchat room * * Notes: * API token - HipChat API token * Room - HipChat Room Id or name, where messages are sent * Name - Name used to send the message (from) * notify - Should the message trigger a notification in the clients * * @author Rafael Dohms * @see https://www.hipchat.com/docs/api */ class HipChatHandler extends SocketHandler { /** * The maximum allowed length for the name used in the "from" field. */ const MAXIMUM_NAME_LENGTH = 15; /** * The maximum allowed length for the message. */ const MAXIMUM_MESSAGE_LENGTH = 9500; /** * @var string */ private $token; /** * @var array */ private $room; /** * @var string */ private $name; /** * @var boolean */ private $notify; /** * @var string */ private $format; /** * @param string $token HipChat API Token * @param string $room The room that should be alerted of the message (Id or Name) * @param string $name Name used in the "from" field * @param bool $notify Trigger a notification in clients or not * @param int $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param Boolean $useSSL Whether to connect via SSL. * @param string $format The format of the messages (default to text, can be set to html if you have html in the messages) */ public function __construct($token, $room, $name = 'Monolog', $notify = false, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $format = 'text') { if (!$this->validateStringLength($name, static::MAXIMUM_NAME_LENGTH)) { throw new \InvalidArgumentException('The supplied name is too long. HipChat\'s v1 API supports names up to 15 UTF-8 characters.'); } $connectionString = $useSSL ? 'ssl://api.hipchat.com:443' : 'api.hipchat.com:80'; parent::__construct($connectionString, $level, $bubble); $this->token = $token; $this->name = $name; $this->notify = $notify; $this->room = $room; $this->format = $format; } /** * {@inheritdoc} * * @param array $record * @return string */ protected function generateDataStream($record) { $content = $this->buildContent($record); return $this->buildHeader($content) . $content; } /** * Builds the body of API call * * @param array $record * @return string */ private function buildContent($record) { $dataArray = array( 'from' => $this->name, 'room_id' => $this->room, 'notify' => $this->notify, 'message' => $record['formatted'], 'message_format' => $this->format, 'color' => $this->getAlertColor($record['level']), ); return http_build_query($dataArray); } /** * Builds the header of the API Call * * @param string $content * @return string */ private function buildHeader($content) { $header = "POST /v1/rooms/message?format=json&auth_token=".$this->token." HTTP/1.1\r\n"; $header .= "Host: api.hipchat.com\r\n"; $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; $header .= "Content-Length: " . strlen($content) . "\r\n"; $header .= "\r\n"; return $header; } /** * Assigns a color to each level of log records. * * @param integer $level * @return string */ protected function getAlertColor($level) { switch (true) { case $level >= Logger::ERROR: return 'red'; case $level >= Logger::WARNING: return 'yellow'; case $level >= Logger::INFO: return 'green'; case $level == Logger::DEBUG: return 'gray'; default: return 'yellow'; } } /** * {@inheritdoc} * * @param array $record */ protected function write(array $record) { parent::write($record); $this->closeSocket(); } /** * {@inheritdoc} */ public function handleBatch(array $records) { if (count($records) == 0) { return true; } $batchRecords = $this->combineRecords($records); $handled = false; foreach ($batchRecords as $batchRecord) { if ($this->isHandling($batchRecord)) { $this->write($batchRecord); $handled = true; } } if (!$handled) { return false; } return false === $this->bubble; } /** * Combines multiple records into one. Error level of the combined record * will be the highest level from the given records. Datetime will be taken * from the first record. * * @param $records * @return array */ private function combineRecords($records) { $batchRecord = null; $batchRecords = array(); $messages = array(); $formattedMessages = array(); $level = 0; $levelName = null; $datetime = null; foreach ($records as $record) { $record = $this->processRecord($record); if ($record['level'] > $level) { $level = $record['level']; $levelName = $record['level_name']; } if (null === $datetime) { $datetime = $record['datetime']; } $messages[] = $record['message']; $messgeStr = implode(PHP_EOL, $messages); $formattedMessages[] = $this->getFormatter()->format($record); $formattedMessageStr = implode('', $formattedMessages); $batchRecord = array( 'message' => $messgeStr, 'formatted' => $formattedMessageStr, 'context' => array(), 'extra' => array(), ); if (!$this->validateStringLength($batchRecord['formatted'], static::MAXIMUM_MESSAGE_LENGTH)) { // Pop the last message and implode the remainging messages $lastMessage = array_pop($messages); $lastFormattedMessage = array_pop($formattedMessages); $batchRecord['message'] = implode(PHP_EOL, $messages); $batchRecord['formatted'] = implode('', $formattedMessages); $batchRecords[] = $batchRecord; $messages = array($lastMessage); $formattedMessages = array($lastFormattedMessage); $batchRecord = null; } } if (null !== $batchRecord) { $batchRecords[] = $batchRecord; } // Set the max level and datetime for all records foreach ($batchRecords as &$batchRecord) { $batchRecord = array_merge( $batchRecord, array( 'level' => $level, 'level_name' => $levelName, 'datetime' => $datetime ) ); } return $batchRecords; } /** * Validates the length of a string. * * If the `mb_strlen()` function is available, it will use that, as HipChat * allows UTF-8 characters. Otherwise, it will fall back to `strlen()`. * * Note that this might cause false failures in the specific case of using * a valid name with less than 16 characters, but 16 or more bytes, on a * system where `mb_strlen()` is unavailable. * * @param string $str * @param int $length * * @return bool */ private function validateStringLength($str, $length) { if (function_exists('mb_strlen')) { return (mb_strlen($str) <= $length); } return (strlen($str) <= $length); } } src/Monolog/Handler/LogEntriesHandler.php000064400000003110146412134770014410 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * @author Robert Kaufmann III */ class LogEntriesHandler extends SocketHandler { /** * @var string */ protected $logToken; /** * @param string $token Log token supplied by LogEntries * @param boolean $useSSL Whether or not SSL encryption should be used. * @param int $level The minimum logging level to trigger this handler * @param boolean $bubble Whether or not messages that are handled should bubble up the stack. * * @throws MissingExtensionExcpetion If SSL encryption is set to true and OpenSSL is missing */ public function __construct($token, $useSSL = true, $level = Logger::DEBUG, $bubble = true) { if ($useSSL && !extension_loaded('openssl')) { throw new MissingExtensionException('The OpenSSL PHP plugin is required to use SSL encrypted connection for LogEntriesHandler'); } $endpoint = $useSSL ? 'ssl://api.logentries.com:20000' : 'data.logentries.com:80'; parent::__construct($endpoint, $level, $bubble); $this->logToken = $token; } /** * {@inheritdoc} * * @param array $record * @return string */ protected function generateDataStream($record) { return $this->logToken . ' ' . $record['formatted']; } } src/Monolog/Handler/LogglyHandler.php000064400000004526146412134770013606 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Formatter\LogglyFormatter; /** * Sends errors to Loggly. * * @author Przemek Sobstel * @author Adam Pancutt */ class LogglyHandler extends AbstractProcessingHandler { const HOST = 'logs-01.loggly.com'; const ENDPOINT_SINGLE = 'inputs'; const ENDPOINT_BATCH = 'bulk'; protected $token; protected $tag; public function __construct($token, $level = Logger::DEBUG, $bubble = true) { if (!extension_loaded('curl')) { throw new \LogicException('The curl extension is needed to use the LogglyHandler'); } $this->token = $token; parent::__construct($level, $bubble); } public function setTag($tag) { $this->tag = $tag; } public function addTag($tag) { $this->tag = (strlen($this->tag) > 0) ? $this->tag .','. $tag : $tag; } protected function write(array $record) { $this->send($record["formatted"], self::ENDPOINT_SINGLE); } public function handleBatch(array $records) { $level = $this->level; $records = array_filter($records, function ($record) use ($level) { return ($record['level'] >= $level); }); if ($records) { $this->send($this->getFormatter()->formatBatch($records), self::ENDPOINT_BATCH); } } protected function send($data, $endpoint) { $url = sprintf("https://%s/%s/%s/", self::HOST, $endpoint, $this->token); $headers = array('Content-Type: application/json'); if ($this->tag) { $headers[] = "X-LOGGLY-TAG: {$this->tag}"; } $ch = curl_init(); curl_setopt($ch, CURLOPT_URL, $url); curl_setopt($ch, CURLOPT_POST, true); curl_setopt($ch, CURLOPT_POSTFIELDS, $data); curl_setopt($ch, CURLOPT_HTTPHEADER, $headers); curl_setopt($ch, CURLOPT_RETURNTRANSFER, true); curl_exec($ch); curl_close($ch); } protected function getDefaultFormatter() { return new LogglyFormatter(); } } src/Monolog/Handler/MailHandler.php000064400000002357146412134770013233 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; /** * Base class for all mail handlers * * @author Gyula Sallai */ abstract class MailHandler extends AbstractProcessingHandler { /** * {@inheritdoc} */ public function handleBatch(array $records) { $messages = array(); foreach ($records as $record) { if ($record['level'] < $this->level) { continue; } $messages[] = $this->processRecord($record); } if (!empty($messages)) { $this->send((string) $this->getFormatter()->formatBatch($messages), $messages); } } /** * Send a mail with the given content * * @param string $content * @param array $records the array of log records that formed this content */ abstract protected function send($content, array $records); /** * {@inheritdoc} */ protected function write(array $record) { $this->send((string) $record['formatted'], array($record)); } } src/Monolog/Handler/MandrillHandler.php000064400000004107146412134770014106 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * MandrillHandler uses cURL to send the emails to the Mandrill API * * @author Adam Nicholson */ class MandrillHandler extends MailHandler { protected $client; protected $message; /** * @param string $apiKey A valid Mandrill API key * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($apiKey, $message, $level = Logger::ERROR, $bubble = true) { parent::__construct($level, $bubble); if (!$message instanceof \Swift_Message && is_callable($message)) { $message = call_user_func($message); } if (!$message instanceof \Swift_Message) { throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it'); } $this->message = $message; $this->apiKey = $apiKey; } /** * {@inheritdoc} */ protected function send($content, array $records) { $message = clone $this->message; $message->setBody($content); $message->setDate(time()); $ch = curl_init(); curl_setopt($ch, CURLOPT_URL, 'https://mandrillapp.com/api/1.0/messages/send-raw.json'); curl_setopt($ch, CURLOPT_POST, 1); curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query(array( 'key' => $this->apiKey, 'raw_message' => (string) $message, 'async' => false, ))); curl_exec($ch); curl_close($ch); } } src/Monolog/Handler/MissingExtensionException.php000064400000000703146412134770016231 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; /** * Exception can be thrown if an extension for an handler is missing * * @author Christian Bergau */ class MissingExtensionException extends \Exception { } src/Monolog/Handler/MongoDBHandler.php000064400000002550146412134770013631 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Formatter\NormalizerFormatter; /** * Logs to a MongoDB database. * * usage example: * * $log = new Logger('application'); * $mongodb = new MongoDBHandler(new \Mongo("mongodb://localhost:27017"), "logs", "prod"); * $log->pushHandler($mongodb); * * @author Thomas Tourlourat */ class MongoDBHandler extends AbstractProcessingHandler { protected $mongoCollection; public function __construct($mongo, $database, $collection, $level = Logger::DEBUG, $bubble = true) { if (!($mongo instanceof \MongoClient || $mongo instanceof \Mongo)) { throw new \InvalidArgumentException('MongoClient or Mongo instance required'); } $this->mongoCollection = $mongo->selectCollection($database, $collection); parent::__construct($level, $bubble); } protected function write(array $record) { $this->mongoCollection->save($record["formatted"]); } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new NormalizerFormatter(); } } src/Monolog/Handler/NativeMailerHandler.php000064400000007603146412134770014730 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * NativeMailerHandler uses the mail() function to send the emails * * @author Christophe Coevoet * @author Mark Garrett */ class NativeMailerHandler extends MailHandler { /** * The email addresses to which the message will be sent * @var array */ protected $to; /** * The subject of the email * @var string */ protected $subject; /** * Optional headers for the message * @var array */ protected $headers = array(); /** * The wordwrap length for the message * @var integer */ protected $maxColumnWidth; /** * The Content-type for the message * @var string */ protected $contentType = 'text/plain'; /** * The encoding for the message * @var string */ protected $encoding = 'utf-8'; /** * @param string|array $to The receiver of the mail * @param string $subject The subject of the mail * @param string $from The sender of the mail * @param integer $level The minimum logging level at which this handler will be triggered * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param int $maxColumnWidth The maximum column width that the message lines will have */ public function __construct($to, $subject, $from, $level = Logger::ERROR, $bubble = true, $maxColumnWidth = 70) { parent::__construct($level, $bubble); $this->to = is_array($to) ? $to : array($to); $this->subject = $subject; $this->addHeader(sprintf('From: %s', $from)); $this->maxColumnWidth = $maxColumnWidth; } /** * Add headers to the message * * @param string|array $headers Custom added headers * @return null */ public function addHeader($headers) { foreach ((array) $headers as $header) { if (strpos($header, "\n") !== false || strpos($header, "\r") !== false) { throw new \InvalidArgumentException('Headers can not contain newline characters for security reasons'); } $this->headers[] = $header; } } /** * {@inheritdoc} */ protected function send($content, array $records) { $content = wordwrap($content, $this->maxColumnWidth); $headers = ltrim(implode("\r\n", $this->headers) . "\r\n", "\r\n"); $headers .= 'Content-type: ' . $this->getContentType() . '; charset=' . $this->getEncoding() . "\r\n"; if ($this->getContentType() == 'text/html' && false === strpos($headers, 'MIME-Version:')) { $headers .= 'MIME-Version: 1.0' . "\r\n"; } foreach ($this->to as $to) { mail($to, $this->subject, $content, $headers); } } /** * @return string $contentType */ public function getContentType() { return $this->contentType; } /** * @return string $encoding */ public function getEncoding() { return $this->encoding; } /** * @param string $contentType The content type of the email - Defaults to text/plain. Use text/html for HTML * messages. * @return self */ public function setContentType($contentType) { $this->contentType = $contentType; return $this; } /** * @param string $encoding * @return self */ public function setEncoding($encoding) { $this->encoding = $encoding; return $this; } } src/Monolog/Handler/NewRelicHandler.php000064400000005332146412134770014055 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Class to record a log on a NewRelic application * * @see https://newrelic.com/docs/php/new-relic-for-php */ class NewRelicHandler extends AbstractProcessingHandler { /** * Name of the New Relic application that will receive logs from this handler. * * @var string */ protected $appName; /** * {@inheritDoc} * * @param string $appName */ public function __construct($level = Logger::ERROR, $bubble = true, $appName = null) { parent::__construct($level, $bubble); $this->appName = $appName; } /** * {@inheritDoc} */ protected function write(array $record) { if (!$this->isNewRelicEnabled()) { throw new MissingExtensionException('The newrelic PHP extension is required to use the NewRelicHandler'); } if ($appName = $this->getAppName($record['context'])) { $this->setNewRelicAppName($appName); } if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) { newrelic_notice_error($record['message'], $record['context']['exception']); unset($record['context']['exception']); } else { newrelic_notice_error($record['message']); } foreach ($record['context'] as $key => $parameter) { newrelic_add_custom_parameter('context_' . $key, $parameter); } foreach ($record['extra'] as $key => $parameter) { newrelic_add_custom_parameter('extra_' . $key, $parameter); } } /** * Checks whether the NewRelic extension is enabled in the system. * * @return bool */ protected function isNewRelicEnabled() { return extension_loaded('newrelic'); } /** * Returns the appname where this log should be sent. Each log can override the default appname, set in this * handler's constructor, by providing the appname in its context. * * @param array $context * @return null|string */ protected function getAppName(array $context) { if (isset($context['appname'])) { return $context['appname']; } return $this->appName; } /** * Sets the NewRelic application that should receive this log. * * @param string $appName */ protected function setNewRelicAppName($appName) { newrelic_set_appname($appName); } } src/Monolog/Handler/NullHandler.php000064400000001675146412134770013265 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Blackhole * * Any record it can handle will be thrown away. This can be used * to put on top of an existing stack to override it temporarily. * * @author Jordi Boggiano */ class NullHandler extends AbstractHandler { /** * @param integer $level The minimum logging level at which this handler will be triggered */ public function __construct($level = Logger::DEBUG) { parent::__construct($level, false); } /** * {@inheritdoc} */ public function handle(array $record) { if ($record['level'] < $this->level) { return false; } return true; } } src/Monolog/Handler/PushoverHandler.php000064400000012741146412134770014162 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Sends notifications through the pushover api to mobile phones * * @author Sebastian Göttschkes * @see https://www.pushover.net/api */ class PushoverHandler extends SocketHandler { private $token; private $users; private $title; private $user; private $retry; private $expire; private $highPriorityLevel; private $emergencyLevel; /** * Sounds the api supports by default * @see https://pushover.net/api#sounds * @var array */ private $sounds = array( 'pushover', 'bike', 'bugle', 'cashregister', 'classical', 'cosmic', 'falling', 'gamelan', 'incoming', 'intermission', 'magic', 'mechanical', 'pianobar', 'siren', 'spacealarm', 'tugboat', 'alien', 'climb', 'persistent', 'echo', 'updown', 'none', ); /** * @param string $token Pushover api token * @param string|array $users Pushover user id or array of ids the message will be sent to * @param string $title Title sent to the Pushover API * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param Boolean $useSSL Whether to connect via SSL. Required when pushing messages to users that are not * the pushover.net app owner. OpenSSL is required for this option. * @param integer $highPriorityLevel The minimum logging level at which this handler will start * sending "high priority" requests to the Pushover API * @param integer $emergencyLevel The minimum logging level at which this handler will start * sending "emergency" requests to the Pushover API * @param integer $retry The retry parameter specifies how often (in seconds) the Pushover servers will send the same notification to the user. * @param integer $expire The expire parameter specifies how many seconds your notification will continue to be retried for (every retry seconds). */ public function __construct($token, $users, $title = null, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $highPriorityLevel = Logger::CRITICAL, $emergencyLevel = Logger::EMERGENCY, $retry = 30, $expire = 25200) { $connectionString = $useSSL ? 'ssl://api.pushover.net:443' : 'api.pushover.net:80'; parent::__construct($connectionString, $level, $bubble); $this->token = $token; $this->users = (array) $users; $this->title = $title ?: gethostname(); $this->highPriorityLevel = Logger::toMonologLevel($highPriorityLevel); $this->emergencyLevel = Logger::toMonologLevel($emergencyLevel); $this->retry = $retry; $this->expire = $expire; } protected function generateDataStream($record) { $content = $this->buildContent($record); return $this->buildHeader($content) . $content; } private function buildContent($record) { // Pushover has a limit of 512 characters on title and message combined. $maxMessageLength = 512 - strlen($this->title); $message = substr($record['message'], 0, $maxMessageLength); $timestamp = $record['datetime']->getTimestamp(); $dataArray = array( 'token' => $this->token, 'user' => $this->user, 'message' => $message, 'title' => $this->title, 'timestamp' => $timestamp ); if (isset($record['level']) && $record['level'] >= $this->emergencyLevel) { $dataArray['priority'] = 2; $dataArray['retry'] = $this->retry; $dataArray['expire'] = $this->expire; } elseif (isset($record['level']) && $record['level'] >= $this->highPriorityLevel) { $dataArray['priority'] = 1; } if (isset($record['context']['sound']) && in_array($record['context']['sound'], $this->sounds)) { $dataArray['sound'] = $record['context']['sound']; } elseif (isset($record['extra']['sound']) && in_array($record['extra']['sound'], $this->sounds)) { $dataArray['sound'] = $record['extra']['sound']; } return http_build_query($dataArray); } private function buildHeader($content) { $header = "POST /1/messages.json HTTP/1.1\r\n"; $header .= "Host: api.pushover.net\r\n"; $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; $header .= "Content-Length: " . strlen($content) . "\r\n"; $header .= "\r\n"; return $header; } protected function write(array $record) { foreach ($this->users as $user) { $this->user = $user; parent::write($record); $this->closeSocket(); } $this->user = null; } public function setHighPriorityLevel($value) { $this->highPriorityLevel = $value; } public function setEmergencyLevel($value) { $this->emergencyLevel = $value; } } src/Monolog/Handler/RavenHandler.php000064400000011735146412134770013424 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\LineFormatter; use Monolog\Formatter\FormatterInterface; use Monolog\Logger; use Raven_Client; /** * Handler to send messages to a Sentry (https://github.com/getsentry/sentry) server * using raven-php (https://github.com/getsentry/raven-php) * * @author Marc Abramowitz */ class RavenHandler extends AbstractProcessingHandler { /** * Translates Monolog log levels to Raven log levels. */ private $logLevels = array( Logger::DEBUG => Raven_Client::DEBUG, Logger::INFO => Raven_Client::INFO, Logger::NOTICE => Raven_Client::INFO, Logger::WARNING => Raven_Client::WARNING, Logger::ERROR => Raven_Client::ERROR, Logger::CRITICAL => Raven_Client::FATAL, Logger::ALERT => Raven_Client::FATAL, Logger::EMERGENCY => Raven_Client::FATAL, ); /** * @var Raven_Client the client object that sends the message to the server */ protected $ravenClient; /** * @var LineFormatter The formatter to use for the logs generated via handleBatch() */ protected $batchFormatter; /** * @param Raven_Client $ravenClient * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct(Raven_Client $ravenClient, $level = Logger::DEBUG, $bubble = true) { parent::__construct($level, $bubble); $this->ravenClient = $ravenClient; } /** * {@inheritdoc} */ public function handleBatch(array $records) { $level = $this->level; // filter records based on their level $records = array_filter($records, function ($record) use ($level) { return $record['level'] >= $level; }); if (!$records) { return; } // the record with the highest severity is the "main" one $record = array_reduce($records, function ($highest, $record) { if ($record['level'] >= $highest['level']) { return $record; } return $highest; }); // the other ones are added as a context item $logs = array(); foreach ($records as $r) { $logs[] = $this->processRecord($r); } if ($logs) { $record['context']['logs'] = (string) $this->getBatchFormatter()->formatBatch($logs); } $this->handle($record); } /** * Sets the formatter for the logs generated by handleBatch(). * * @param FormatterInterface $formatter */ public function setBatchFormatter(FormatterInterface $formatter) { $this->batchFormatter = $formatter; } /** * Gets the formatter for the logs generated by handleBatch(). * * @return FormatterInterface */ public function getBatchFormatter() { if (!$this->batchFormatter) { $this->batchFormatter = $this->getDefaultBatchFormatter(); } return $this->batchFormatter; } /** * {@inheritdoc} */ protected function write(array $record) { $options = array(); $options['level'] = $this->logLevels[$record['level']]; $options['tags'] = array(); if (!empty($record['extra']['tags'])) { $options['tags'] = array_merge($options['tags'], $record['extra']['tags']); unset($record['extra']['tags']); } if (!empty($record['context']['tags'])) { $options['tags'] = array_merge($options['tags'], $record['context']['tags']); unset($record['context']['tags']); } if (!empty($record['context'])) { $options['extra']['context'] = $record['context']; } if (!empty($record['extra'])) { $options['extra']['extra'] = $record['extra']; } if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) { $options['extra']['message'] = $record['formatted']; $this->ravenClient->captureException($record['context']['exception'], $options); return; } $this->ravenClient->captureMessage($record['formatted'], array(), $options); } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new LineFormatter('[%channel%] %message%'); } /** * Gets the default formatter for the logs generated by handleBatch(). * * @return FormatterInterface */ protected function getDefaultBatchFormatter() { return new LineFormatter(); } } src/Monolog/Handler/RedisHandler.php000064400000002602146412134770013410 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Formatter\LineFormatter; /** * Logs to a Redis key using rpush * * usage example: * * $log = new Logger('application'); * $redis = new RedisHandler(new Predis\Client("tcp://localhost:6379"), "logs", "prod"); * $log->pushHandler($redis); * * @author Thomas Tourlourat */ class RedisHandler extends AbstractProcessingHandler { private $redisClient; private $redisKey; # redis instance, key to use public function __construct($redis, $key, $level = Logger::DEBUG, $bubble = true) { if (!(($redis instanceof \Predis\Client) || ($redis instanceof \Redis))) { throw new \InvalidArgumentException('Predis\Client or Redis instance required'); } $this->redisClient = $redis; $this->redisKey = $key; parent::__construct($level, $bubble); } protected function write(array $record) { $this->redisClient->rpush($this->redisKey, $record["formatted"]); } /** * {@inheritDoc} */ protected function getDefaultFormatter() { return new LineFormatter(); } } src/Monolog/Handler/RollbarHandler.php000064400000003717146412134770013747 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use RollbarNotifier; use Exception; use Monolog\Logger; /** * Sends errors to Rollbar * * @author Paul Statezny */ class RollbarHandler extends AbstractProcessingHandler { /** * Rollbar notifier * * @var RollbarNotifier */ protected $rollbarNotifier; /** * @param RollbarNotifier $rollbarNotifier RollbarNotifier object constructed with valid token * @param integer $level The minimum logging level at which this handler will be triggered * @param boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct(RollbarNotifier $rollbarNotifier, $level = Logger::ERROR, $bubble = true) { $this->rollbarNotifier = $rollbarNotifier; parent::__construct($level, $bubble); } /** * {@inheritdoc} */ protected function write(array $record) { if (isset($record['context']['exception']) && $record['context']['exception'] instanceof Exception) { $this->rollbarNotifier->report_exception($record['context']['exception']); } else { $extraData = array( 'level' => $record['level'], 'channel' => $record['channel'], 'datetime' => $record['datetime']->format('U'), ); $this->rollbarNotifier->report_message( $record['message'], $record['level_name'], array_merge($record['context'], $record['extra'], $extraData) ); } } /** * {@inheritdoc} */ public function close() { $this->rollbarNotifier->flush(); } } src/Monolog/Handler/RotatingFileHandler.php000064400000010617146412134770014736 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Stores logs to files that are rotated every day and a limited number of files are kept. * * This rotation is only intended to be used as a workaround. Using logrotate to * handle the rotation is strongly encouraged when you can use it. * * @author Christophe Coevoet * @author Jordi Boggiano */ class RotatingFileHandler extends StreamHandler { protected $filename; protected $maxFiles; protected $mustRotate; protected $nextRotation; protected $filenameFormat; protected $dateFormat; /** * @param string $filename * @param integer $maxFiles The maximal amount of files to keep (0 means unlimited) * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write) * @param Boolean $useLocking Try to lock log file before doing any writes */ public function __construct($filename, $maxFiles = 0, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false) { $this->filename = $filename; $this->maxFiles = (int) $maxFiles; $this->nextRotation = new \DateTime('tomorrow'); $this->filenameFormat = '{filename}-{date}'; $this->dateFormat = 'Y-m-d'; parent::__construct($this->getTimedFilename(), $level, $bubble, $filePermission, $useLocking); } /** * {@inheritdoc} */ public function close() { parent::close(); if (true === $this->mustRotate) { $this->rotate(); } } public function setFilenameFormat($filenameFormat, $dateFormat) { $this->filenameFormat = $filenameFormat; $this->dateFormat = $dateFormat; $this->url = $this->getTimedFilename(); $this->close(); } /** * {@inheritdoc} */ protected function write(array $record) { // on the first record written, if the log is new, we should rotate (once per day) if (null === $this->mustRotate) { $this->mustRotate = !file_exists($this->url); } if ($this->nextRotation < $record['datetime']) { $this->mustRotate = true; $this->close(); } parent::write($record); } /** * Rotates the files. */ protected function rotate() { // update filename $this->url = $this->getTimedFilename(); $this->nextRotation = new \DateTime('tomorrow'); // skip GC of old logs if files are unlimited if (0 === $this->maxFiles) { return; } $logFiles = glob($this->getGlobPattern()); if ($this->maxFiles >= count($logFiles)) { // no files to remove return; } // Sorting the files by name to remove the older ones usort($logFiles, function ($a, $b) { return strcmp($b, $a); }); foreach (array_slice($logFiles, $this->maxFiles) as $file) { if (is_writable($file)) { unlink($file); } } } protected function getTimedFilename() { $fileInfo = pathinfo($this->filename); $timedFilename = str_replace( array('{filename}', '{date}'), array($fileInfo['filename'], date($this->dateFormat)), $fileInfo['dirname'] . '/' . $this->filenameFormat ); if (!empty($fileInfo['extension'])) { $timedFilename .= '.'.$fileInfo['extension']; } return $timedFilename; } protected function getGlobPattern() { $fileInfo = pathinfo($this->filename); $glob = str_replace( array('{filename}', '{date}'), array($fileInfo['filename'], '*'), $fileInfo['dirname'] . '/' . $this->filenameFormat ); if (!empty($fileInfo['extension'])) { $glob .= '.'.$fileInfo['extension']; } return $glob; } } src/Monolog/Handler/SlackHandler.php000064400000012023146412134770013375 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Sends notifications through Slack API * * @author Greg Kedzierski * @see https://api.slack.com/ */ class SlackHandler extends SocketHandler { /** * Slack API token * @var string */ private $token; /** * Slack channel (encoded ID or name) * @var string */ private $channel; /** * Name of a bot * @var string */ private $username; /** * Emoji icon name * @var string */ private $iconEmoji; /** * Whether the message should be added to Slack as attachment (plain text otherwise) * @var bool */ private $useAttachment; /** * @param string $token Slack API token * @param string $channel Slack channel (encoded ID or name) * @param string $username Name of a bot * @param bool $useAttachment Whether the message should be added to Slack as attachment (plain text otherwise) * @param string|null $iconEmoji The emoji name to use (or null) * @param int $level The minimum logging level at which this handler will be triggered * @param bool $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($token, $channel, $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $level = Logger::CRITICAL, $bubble = true) { if (!extension_loaded('openssl')) { throw new MissingExtensionException('The OpenSSL PHP extension is required to use the SlackHandler'); } parent::__construct('ssl://slack.com:443', $level, $bubble); $this->token = $token; $this->channel = $channel; $this->username = $username; $this->iconEmoji = trim($iconEmoji, ':'); $this->useAttachment = $useAttachment; } /** * {@inheritdoc} * * @param array $record * @return string */ protected function generateDataStream($record) { $content = $this->buildContent($record); return $this->buildHeader($content) . $content; } /** * Builds the body of API call * * @param array $record * @return string */ private function buildContent($record) { $dataArray = array( 'token' => $this->token, 'channel' => $this->channel, 'username' => $this->username, 'text' => '', 'attachments' => array() ); if ($this->useAttachment) { $dataArray['attachments'] = json_encode( array( array( 'fallback' => $record['message'], 'color' => $this->getAttachmentColor($record['level']), 'fields' => array( array( 'title' => 'Message', 'value' => $record['message'], 'short' => false ), array( 'title' => 'Level', 'value' => $record['level_name'], 'short' => true ) ) ) ) ); } else { $dataArray['text'] = $record['message']; } if ($this->iconEmoji) { $dataArray['icon_emoji'] = ":{$this->iconEmoji}:"; } return http_build_query($dataArray); } /** * Builds the header of the API Call * * @param string $content * @return string */ private function buildHeader($content) { $header = "POST /api/chat.postMessage HTTP/1.1\r\n"; $header .= "Host: slack.com\r\n"; $header .= "Content-Type: application/x-www-form-urlencoded\r\n"; $header .= "Content-Length: " . strlen($content) . "\r\n"; $header .= "\r\n"; return $header; } /** * {@inheritdoc} * * @param array $record */ protected function write(array $record) { parent::write($record); $this->closeSocket(); } /** * Returned a Slack message attachment color associated with * provided level. * * @param int $level * @return string */ protected function getAttachmentColor($level) { switch (true) { case $level >= Logger::ERROR: return 'danger'; case $level >= Logger::WARNING: return 'warning'; case $level >= Logger::INFO: return 'good'; default: return '#e3e4e6'; } } } src/Monolog/Handler/SocketHandler.php000064400000016247146412134770013604 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Stores to any socket - uses fsockopen() or pfsockopen(). * * @author Pablo de Leon Belloc * @see http://php.net/manual/en/function.fsockopen.php */ class SocketHandler extends AbstractProcessingHandler { private $connectionString; private $connectionTimeout; private $resource; private $timeout = 0; private $persistent = false; private $errno; private $errstr; /** * @param string $connectionString Socket connection string * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($connectionString, $level = Logger::DEBUG, $bubble = true) { parent::__construct($level, $bubble); $this->connectionString = $connectionString; $this->connectionTimeout = (float) ini_get('default_socket_timeout'); } /** * Connect (if necessary) and write to the socket * * @param array $record * * @throws \UnexpectedValueException * @throws \RuntimeException */ protected function write(array $record) { $this->connectIfNotConnected(); $data = $this->generateDataStream($record); $this->writeToSocket($data); } /** * We will not close a PersistentSocket instance so it can be reused in other requests. */ public function close() { if (!$this->isPersistent()) { $this->closeSocket(); } } /** * Close socket, if open */ public function closeSocket() { if (is_resource($this->resource)) { fclose($this->resource); $this->resource = null; } } /** * Set socket connection to nbe persistent. It only has effect before the connection is initiated. * * @param type $boolean */ public function setPersistent($boolean) { $this->persistent = (boolean) $boolean; } /** * Set connection timeout. Only has effect before we connect. * * @param float $seconds * * @see http://php.net/manual/en/function.fsockopen.php */ public function setConnectionTimeout($seconds) { $this->validateTimeout($seconds); $this->connectionTimeout = (float) $seconds; } /** * Set write timeout. Only has effect before we connect. * * @param float $seconds * * @see http://php.net/manual/en/function.stream-set-timeout.php */ public function setTimeout($seconds) { $this->validateTimeout($seconds); $this->timeout = (float) $seconds; } /** * Get current connection string * * @return string */ public function getConnectionString() { return $this->connectionString; } /** * Get persistent setting * * @return boolean */ public function isPersistent() { return $this->persistent; } /** * Get current connection timeout setting * * @return float */ public function getConnectionTimeout() { return $this->connectionTimeout; } /** * Get current in-transfer timeout * * @return float */ public function getTimeout() { return $this->timeout; } /** * Check to see if the socket is currently available. * * UDP might appear to be connected but might fail when writing. See http://php.net/fsockopen for details. * * @return boolean */ public function isConnected() { return is_resource($this->resource) && !feof($this->resource); // on TCP - other party can close connection. } /** * Wrapper to allow mocking */ protected function pfsockopen() { return @pfsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout); } /** * Wrapper to allow mocking */ protected function fsockopen() { return @fsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout); } /** * Wrapper to allow mocking * * @see http://php.net/manual/en/function.stream-set-timeout.php */ protected function streamSetTimeout() { $seconds = floor($this->timeout); $microseconds = round(($this->timeout - $seconds)*1e6); return stream_set_timeout($this->resource, $seconds, $microseconds); } /** * Wrapper to allow mocking */ protected function fwrite($data) { return @fwrite($this->resource, $data); } /** * Wrapper to allow mocking */ protected function streamGetMetadata() { return stream_get_meta_data($this->resource); } private function validateTimeout($value) { $ok = filter_var($value, FILTER_VALIDATE_FLOAT); if ($ok === false || $value < 0) { throw new \InvalidArgumentException("Timeout must be 0 or a positive float (got $value)"); } } private function connectIfNotConnected() { if ($this->isConnected()) { return; } $this->connect(); } protected function generateDataStream($record) { return (string) $record['formatted']; } private function connect() { $this->createSocketResource(); $this->setSocketTimeout(); } private function createSocketResource() { if ($this->isPersistent()) { $resource = $this->pfsockopen(); } else { $resource = $this->fsockopen(); } if (!$resource) { throw new \UnexpectedValueException("Failed connecting to $this->connectionString ($this->errno: $this->errstr)"); } $this->resource = $resource; } private function setSocketTimeout() { if (!$this->streamSetTimeout()) { throw new \UnexpectedValueException("Failed setting timeout with stream_set_timeout()"); } } private function writeToSocket($data) { $length = strlen($data); $sent = 0; while ($this->isConnected() && $sent < $length) { if (0 == $sent) { $chunk = $this->fwrite($data); } else { $chunk = $this->fwrite(substr($data, $sent)); } if ($chunk === false) { throw new \RuntimeException("Could not write to socket"); } $sent += $chunk; $socketInfo = $this->streamGetMetadata(); if ($socketInfo['timed_out']) { throw new \RuntimeException("Write timed-out"); } } if (!$this->isConnected() && $sent < $length) { throw new \RuntimeException("End-of-file reached, probably we got disconnected (sent $sent of $length)"); } } } src/Monolog/Handler/StreamHandler.php000064400000006357146412134770013610 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Stores to any stream resource * * Can be used to store into php://stderr, remote and local files, etc. * * @author Jordi Boggiano */ class StreamHandler extends AbstractProcessingHandler { protected $stream; protected $url; private $errorMessage; protected $filePermission; protected $useLocking; /** * @param resource|string $stream * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param int|null $filePermission Optional file permissions (default (0644) are only for owner read/write) * @param Boolean $useLocking Try to lock log file before doing any writes * * @throws InvalidArgumentException If stream is not a resource or string */ public function __construct($stream, $level = Logger::DEBUG, $bubble = true, $filePermission = null, $useLocking = false) { parent::__construct($level, $bubble); if (is_resource($stream)) { $this->stream = $stream; } elseif (is_string($stream)) { $this->url = $stream; } else { throw new \InvalidArgumentException('A stream must either be a resource or a string.'); } $this->filePermission = $filePermission; $this->useLocking = $useLocking; } /** * {@inheritdoc} */ public function close() { if (is_resource($this->stream)) { fclose($this->stream); } $this->stream = null; } /** * {@inheritdoc} */ protected function write(array $record) { if (!is_resource($this->stream)) { if (!$this->url) { throw new \LogicException('Missing stream url, the stream can not be opened. This may be caused by a premature call to close().'); } $this->errorMessage = null; set_error_handler(array($this, 'customErrorHandler')); $this->stream = fopen($this->url, 'a'); if ($this->filePermission !== null) { @chmod($this->url, $this->filePermission); } restore_error_handler(); if (!is_resource($this->stream)) { $this->stream = null; throw new \UnexpectedValueException(sprintf('The stream or file "%s" could not be opened: '.$this->errorMessage, $this->url)); } } if ($this->useLocking) { // ignoring errors here, there's not much we can do about them flock($this->stream, LOCK_EX); } fwrite($this->stream, (string) $record['formatted']); if ($this->useLocking) { flock($this->stream, LOCK_UN); } } private function customErrorHandler($code, $msg) { $this->errorMessage = preg_replace('{^fopen\(.*?\): }', '', $msg); } } src/Monolog/Handler/SwiftMailerHandler.php000064400000003263146412134770014574 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * SwiftMailerHandler uses Swift_Mailer to send the emails * * @author Gyula Sallai */ class SwiftMailerHandler extends MailHandler { protected $mailer; protected $message; /** * @param \Swift_Mailer $mailer The mailer to use * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct(\Swift_Mailer $mailer, $message, $level = Logger::ERROR, $bubble = true) { parent::__construct($level, $bubble); $this->mailer = $mailer; if (!$message instanceof \Swift_Message && is_callable($message)) { $message = call_user_func($message); } if (!$message instanceof \Swift_Message) { throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it'); } $this->message = $message; } /** * {@inheritdoc} */ protected function send($content, array $records) { $message = clone $this->message; $message->setBody($content); $message->setDate(time()); $this->mailer->send($message); } } src/Monolog/Handler/SyslogHandler.php000064400000003470146412134770013626 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Logs to syslog service. * * usage example: * * $log = new Logger('application'); * $syslog = new SyslogHandler('myfacility', 'local6'); * $formatter = new LineFormatter("%channel%.%level_name%: %message% %extra%"); * $syslog->setFormatter($formatter); * $log->pushHandler($syslog); * * @author Sven Paulus */ class SyslogHandler extends AbstractSyslogHandler { protected $ident; protected $logopts; /** * @param string $ident * @param mixed $facility * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not * @param int $logopts Option flags for the openlog() call, defaults to LOG_PID */ public function __construct($ident, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true, $logopts = LOG_PID) { parent::__construct($facility, $level, $bubble); $this->ident = $ident; $this->logopts = $logopts; } /** * {@inheritdoc} */ public function close() { closelog(); } /** * {@inheritdoc} */ protected function write(array $record) { if (!openlog($this->ident, $this->logopts, $this->facility)) { throw new \LogicException('Can\'t open syslog for ident "'.$this->ident.'" and facility "'.$this->facility.'"'); } syslog($this->logLevels[$record['level']], (string) $record['formatted']); } } src/Monolog/Handler/SyslogUdp/UdpSocket.php000064400000003073146412134770014701 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler\SyslogUdp; class UdpSocket { const DATAGRAM_MAX_LENGTH = 2048; public function __construct($ip, $port = 514) { $this->ip = $ip; $this->port = $port; $this->socket = socket_create(AF_INET, SOCK_DGRAM, SOL_UDP); } public function write($line, $header = "") { $remaining = $line; while (!is_null($remaining)) { list($chunk, $remaining) = $this->splitLineIfNessesary($remaining, $header); $this->send($chunk); } } public function close() { socket_close($this->socket); } protected function send($chunk) { socket_sendto($this->socket, $chunk, strlen($chunk), $flags = 0, $this->ip, $this->port); } protected function splitLineIfNessesary($line, $header) { if ($this->shouldSplitLine($line, $header)) { $chunkSize = self::DATAGRAM_MAX_LENGTH - strlen($header); $chunk = $header . substr($line, 0, $chunkSize); $remaining = substr($line, $chunkSize); } else { $chunk = $header . $line; $remaining = null; } return array($chunk, $remaining); } protected function shouldSplitLine($remaining, $header) { return strlen($header.$remaining) > self::DATAGRAM_MAX_LENGTH; } } src/Monolog/Handler/SyslogUdpHandler.php000064400000003732146412134770014300 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\Handler\SyslogUdp\UdpSocket; /** * A Handler for logging to a remote syslogd server. * * @author Jesper Skovgaard Nielsen */ class SyslogUdpHandler extends AbstractSyslogHandler { /** * @param string $host * @param int $port * @param mixed $facility * @param integer $level The minimum logging level at which this handler will be triggered * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not */ public function __construct($host, $port = 514, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true) { parent::__construct($facility, $level, $bubble); $this->socket = new UdpSocket($host, $port ?: 514); } protected function write(array $record) { $lines = $this->splitMessageIntoLines($record['formatted']); $header = $this->makeCommonSyslogHeader($this->logLevels[$record['level']]); foreach ($lines as $line) { $this->socket->write($line, $header); } } public function close() { $this->socket->close(); } private function splitMessageIntoLines($message) { if (is_array($message)) { $message = implode("\n", $message); } return preg_split('/$\R?^/m', $message); } /** * Make common syslog header (see rfc5424) */ private function makeCommonSyslogHeader($severity) { $priority = $severity + $this->facility; return "<$priority>: "; } /** * Inject your own socket, mainly used for testing */ public function setSocket($socket) { $this->socket = $socket; } } src/Monolog/Handler/TestHandler.php000064400000005760146412134770013271 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; /** * Used for testing purposes. * * It records all records and gives you access to them for verification. * * @author Jordi Boggiano */ class TestHandler extends AbstractProcessingHandler { protected $records = array(); protected $recordsByLevel = array(); public function getRecords() { return $this->records; } public function hasEmergency($record) { return $this->hasRecord($record, Logger::EMERGENCY); } public function hasAlert($record) { return $this->hasRecord($record, Logger::ALERT); } public function hasCritical($record) { return $this->hasRecord($record, Logger::CRITICAL); } public function hasError($record) { return $this->hasRecord($record, Logger::ERROR); } public function hasWarning($record) { return $this->hasRecord($record, Logger::WARNING); } public function hasNotice($record) { return $this->hasRecord($record, Logger::NOTICE); } public function hasInfo($record) { return $this->hasRecord($record, Logger::INFO); } public function hasDebug($record) { return $this->hasRecord($record, Logger::DEBUG); } public function hasEmergencyRecords() { return isset($this->recordsByLevel[Logger::EMERGENCY]); } public function hasAlertRecords() { return isset($this->recordsByLevel[Logger::ALERT]); } public function hasCriticalRecords() { return isset($this->recordsByLevel[Logger::CRITICAL]); } public function hasErrorRecords() { return isset($this->recordsByLevel[Logger::ERROR]); } public function hasWarningRecords() { return isset($this->recordsByLevel[Logger::WARNING]); } public function hasNoticeRecords() { return isset($this->recordsByLevel[Logger::NOTICE]); } public function hasInfoRecords() { return isset($this->recordsByLevel[Logger::INFO]); } public function hasDebugRecords() { return isset($this->recordsByLevel[Logger::DEBUG]); } protected function hasRecord($record, $level) { if (!isset($this->recordsByLevel[$level])) { return false; } if (is_array($record)) { $record = $record['message']; } foreach ($this->recordsByLevel[$level] as $rec) { if ($rec['message'] === $record) { return true; } } return false; } /** * {@inheritdoc} */ protected function write(array $record) { $this->recordsByLevel[$record['level']][] = $record; $this->records[] = $record; } } src/Monolog/Handler/WhatFailureGroupHandler.php000064400000002500146412134770015567 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; /** * Forwards records to multiple handlers suppressing failures of each handler * and continuing through to give every handler a chance to succeed. * * @author Craig D'Amelio */ class WhatFailureGroupHandler extends GroupHandler { /** * {@inheritdoc} */ public function handle(array $record) { if ($this->processors) { foreach ($this->processors as $processor) { $record = call_user_func($processor, $record); } } foreach ($this->handlers as $handler) { try { $handler->handle($record); } catch (\Exception $e) { // What failure? } } return false === $this->bubble; } /** * {@inheritdoc} */ public function handleBatch(array $records) { foreach ($this->handlers as $handler) { try { $handler->handleBatch($records); } catch (\Exception $e) { // What failure? } } } } src/Monolog/Handler/ZendMonitorHandler.php000064400000004300146412134770014607 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\NormalizerFormatter; use Monolog\Logger; /** * Handler sending logs to Zend Monitor * * @author Christian Bergau */ class ZendMonitorHandler extends AbstractProcessingHandler { /** * Monolog level / ZendMonitor Custom Event priority map * * @var array */ protected $levelMap = array( Logger::DEBUG => 1, Logger::INFO => 2, Logger::NOTICE => 3, Logger::WARNING => 4, Logger::ERROR => 5, Logger::CRITICAL => 6, Logger::ALERT => 7, Logger::EMERGENCY => 0, ); /** * Construct * * @param int $level * @param bool $bubble * @throws MissingExtensionException */ public function __construct($level = Logger::DEBUG, $bubble = true) { if (!function_exists('zend_monitor_custom_event')) { throw new MissingExtensionException('You must have Zend Server installed in order to use this handler'); } parent::__construct($level, $bubble); } /** * {@inheritdoc} */ protected function write(array $record) { $this->writeZendMonitorCustomEvent( $this->levelMap[$record['level']], $record['message'], $record['formatted'] ); } /** * Write a record to Zend Monitor * * @param int $level * @param string $message * @param array $formatted */ protected function writeZendMonitorCustomEvent($level, $message, $formatted) { zend_monitor_custom_event($level, $message, $formatted); } /** * {@inheritdoc} */ public function getDefaultFormatter() { return new NormalizerFormatter(); } /** * Get the level map * * @return array */ public function getLevelMap() { return $this->levelMap; } } src/Monolog/Logger.php000064400000041266146412134770010717 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog; use Monolog\Handler\HandlerInterface; use Monolog\Handler\StreamHandler; use Psr\Log\LoggerInterface; use Psr\Log\InvalidArgumentException; /** * Monolog log channel * * It contains a stack of Handlers and a stack of Processors, * and uses them to store records that are added to it. * * @author Jordi Boggiano */ class Logger implements LoggerInterface { /** * Detailed debug information */ const DEBUG = 100; /** * Interesting events * * Examples: User logs in, SQL logs. */ const INFO = 200; /** * Uncommon events */ const NOTICE = 250; /** * Exceptional occurrences that are not errors * * Examples: Use of deprecated APIs, poor use of an API, * undesirable things that are not necessarily wrong. */ const WARNING = 300; /** * Runtime errors */ const ERROR = 400; /** * Critical conditions * * Example: Application component unavailable, unexpected exception. */ const CRITICAL = 500; /** * Action must be taken immediately * * Example: Entire website down, database unavailable, etc. * This should trigger the SMS alerts and wake you up. */ const ALERT = 550; /** * Urgent alert. */ const EMERGENCY = 600; /** * Monolog API version * * This is only bumped when API breaks are done and should * follow the major version of the library * * @var int */ const API = 1; /** * Logging levels from syslog protocol defined in RFC 5424 * * @var array $levels Logging levels */ protected static $levels = array( 100 => 'DEBUG', 200 => 'INFO', 250 => 'NOTICE', 300 => 'WARNING', 400 => 'ERROR', 500 => 'CRITICAL', 550 => 'ALERT', 600 => 'EMERGENCY', ); /** * @var \DateTimeZone */ protected static $timezone; /** * @var string */ protected $name; /** * The handler stack * * @var HandlerInterface[] */ protected $handlers; /** * Processors that will process all log records * * To process records of a single handler instead, add the processor on that specific handler * * @var callable[] */ protected $processors; /** * @param string $name The logging channel * @param HandlerInterface[] $handlers Optional stack of handlers, the first one in the array is called first, etc. * @param callable[] $processors Optional array of processors */ public function __construct($name, array $handlers = array(), array $processors = array()) { $this->name = $name; $this->handlers = $handlers; $this->processors = $processors; } /** * @return string */ public function getName() { return $this->name; } /** * Pushes a handler on to the stack. * * @param HandlerInterface $handler */ public function pushHandler(HandlerInterface $handler) { array_unshift($this->handlers, $handler); } /** * Pops a handler from the stack * * @return HandlerInterface */ public function popHandler() { if (!$this->handlers) { throw new \LogicException('You tried to pop from an empty handler stack.'); } return array_shift($this->handlers); } /** * @return HandlerInterface[] */ public function getHandlers() { return $this->handlers; } /** * Adds a processor on to the stack. * * @param callable $callback */ public function pushProcessor($callback) { if (!is_callable($callback)) { throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given'); } array_unshift($this->processors, $callback); } /** * Removes the processor on top of the stack and returns it. * * @return callable */ public function popProcessor() { if (!$this->processors) { throw new \LogicException('You tried to pop from an empty processor stack.'); } return array_shift($this->processors); } /** * @return callable[] */ public function getProcessors() { return $this->processors; } /** * Adds a log record. * * @param integer $level The logging level * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addRecord($level, $message, array $context = array()) { if (!$this->handlers) { $this->pushHandler(new StreamHandler('php://stderr', static::DEBUG)); } if (!static::$timezone) { static::$timezone = new \DateTimeZone(date_default_timezone_get() ?: 'UTC'); } $record = array( 'message' => (string) $message, 'context' => $context, 'level' => $level, 'level_name' => static::getLevelName($level), 'channel' => $this->name, 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true)), static::$timezone)->setTimezone(static::$timezone), 'extra' => array(), ); // check if any handler will handle this message $handlerKey = null; foreach ($this->handlers as $key => $handler) { if ($handler->isHandling($record)) { $handlerKey = $key; break; } } // none found if (null === $handlerKey) { return false; } // found at least one, process message and dispatch it foreach ($this->processors as $processor) { $record = call_user_func($processor, $record); } while (isset($this->handlers[$handlerKey]) && false === $this->handlers[$handlerKey]->handle($record)) { $handlerKey++; } return true; } /** * Adds a log record at the DEBUG level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addDebug($message, array $context = array()) { return $this->addRecord(static::DEBUG, $message, $context); } /** * Adds a log record at the INFO level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addInfo($message, array $context = array()) { return $this->addRecord(static::INFO, $message, $context); } /** * Adds a log record at the NOTICE level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addNotice($message, array $context = array()) { return $this->addRecord(static::NOTICE, $message, $context); } /** * Adds a log record at the WARNING level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addWarning($message, array $context = array()) { return $this->addRecord(static::WARNING, $message, $context); } /** * Adds a log record at the ERROR level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addError($message, array $context = array()) { return $this->addRecord(static::ERROR, $message, $context); } /** * Adds a log record at the CRITICAL level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addCritical($message, array $context = array()) { return $this->addRecord(static::CRITICAL, $message, $context); } /** * Adds a log record at the ALERT level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addAlert($message, array $context = array()) { return $this->addRecord(static::ALERT, $message, $context); } /** * Adds a log record at the EMERGENCY level. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function addEmergency($message, array $context = array()) { return $this->addRecord(static::EMERGENCY, $message, $context); } /** * Gets all supported logging levels. * * @return array Assoc array with human-readable level names => level codes. */ public static function getLevels() { return array_flip(static::$levels); } /** * Gets the name of the logging level. * * @param integer $level * @return string */ public static function getLevelName($level) { if (!isset(static::$levels[$level])) { throw new InvalidArgumentException('Level "'.$level.'" is not defined, use one of: '.implode(', ', array_keys(static::$levels))); } return static::$levels[$level]; } /** * Converts PSR-3 levels to Monolog ones if necessary * * @param string|int Level number (monolog) or name (PSR-3) * @return int */ public static function toMonologLevel($level) { if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) { return constant(__CLASS__.'::'.strtoupper($level)); } return $level; } /** * Checks whether the Logger has a handler that listens on the given level * * @param integer $level * @return Boolean */ public function isHandling($level) { $record = array( 'level' => $level, ); foreach ($this->handlers as $handler) { if ($handler->isHandling($record)) { return true; } } return false; } /** * Adds a log record at an arbitrary level. * * This method allows for compatibility with common interfaces. * * @param mixed $level The log level * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function log($level, $message, array $context = array()) { if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) { $level = constant(__CLASS__.'::'.strtoupper($level)); } return $this->addRecord($level, $message, $context); } /** * Adds a log record at the DEBUG level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function debug($message, array $context = array()) { return $this->addRecord(static::DEBUG, $message, $context); } /** * Adds a log record at the INFO level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function info($message, array $context = array()) { return $this->addRecord(static::INFO, $message, $context); } /** * Adds a log record at the INFO level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function notice($message, array $context = array()) { return $this->addRecord(static::NOTICE, $message, $context); } /** * Adds a log record at the WARNING level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function warn($message, array $context = array()) { return $this->addRecord(static::WARNING, $message, $context); } /** * Adds a log record at the WARNING level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function warning($message, array $context = array()) { return $this->addRecord(static::WARNING, $message, $context); } /** * Adds a log record at the ERROR level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function err($message, array $context = array()) { return $this->addRecord(static::ERROR, $message, $context); } /** * Adds a log record at the ERROR level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function error($message, array $context = array()) { return $this->addRecord(static::ERROR, $message, $context); } /** * Adds a log record at the CRITICAL level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function crit($message, array $context = array()) { return $this->addRecord(static::CRITICAL, $message, $context); } /** * Adds a log record at the CRITICAL level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function critical($message, array $context = array()) { return $this->addRecord(static::CRITICAL, $message, $context); } /** * Adds a log record at the ALERT level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function alert($message, array $context = array()) { return $this->addRecord(static::ALERT, $message, $context); } /** * Adds a log record at the EMERGENCY level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function emerg($message, array $context = array()) { return $this->addRecord(static::EMERGENCY, $message, $context); } /** * Adds a log record at the EMERGENCY level. * * This method allows for compatibility with common interfaces. * * @param string $message The log message * @param array $context The log context * @return Boolean Whether the record has been processed */ public function emergency($message, array $context = array()) { return $this->addRecord(static::EMERGENCY, $message, $context); } } src/Monolog/Processor/GitProcessor.php000064400000002576146412134770014103 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\Logger; /** * Injects Git branch and Git commit SHA in all records * * @author Nick Otter * @author Jordi Boggiano */ class GitProcessor { private $level; private static $cache; public function __construct($level = Logger::DEBUG) { $this->level = Logger::toMonologLevel($level); } /** * @param array $record * @return array */ public function __invoke(array $record) { // return if the level is not high enough if ($record['level'] < $this->level) { return $record; } $record['extra']['git'] = self::getGitInfo(); return $record; } private static function getGitInfo() { if (self::$cache) { return self::$cache; } $branches = `git branch -v --no-abbrev`; if (preg_match('{^\* (.+?)\s+([a-f0-9]{40})(?:\s|$)}m', $branches, $matches)) { return self::$cache = array( 'branch' => $matches[1], 'commit' => $matches[2], ); } return self::$cache = array(); } } src/Monolog/Processor/IntrospectionProcessor.php000064400000004562146412134770016215 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\Logger; /** * Injects line/file:class/function where the log message came from * * Warning: This only works if the handler processes the logs directly. * If you put the processor on a handler that is behind a FingersCrossedHandler * for example, the processor will only be called once the trigger level is reached, * and all the log records will have the same file/line/.. data from the call that * triggered the FingersCrossedHandler. * * @author Jordi Boggiano */ class IntrospectionProcessor { private $level; private $skipClassesPartials; public function __construct($level = Logger::DEBUG, array $skipClassesPartials = array('Monolog\\')) { $this->level = Logger::toMonologLevel($level); $this->skipClassesPartials = $skipClassesPartials; } /** * @param array $record * @return array */ public function __invoke(array $record) { // return if the level is not high enough if ($record['level'] < $this->level) { return $record; } $trace = debug_backtrace(); // skip first since it's always the current method array_shift($trace); // the call_user_func call is also skipped array_shift($trace); $i = 0; while (isset($trace[$i]['class'])) { foreach ($this->skipClassesPartials as $part) { if (strpos($trace[$i]['class'], $part) !== false) { $i++; continue 2; } } break; } // we should have the call source now $record['extra'] = array_merge( $record['extra'], array( 'file' => isset($trace[$i-1]['file']) ? $trace[$i-1]['file'] : null, 'line' => isset($trace[$i-1]['line']) ? $trace[$i-1]['line'] : null, 'class' => isset($trace[$i]['class']) ? $trace[$i]['class'] : null, 'function' => isset($trace[$i]['function']) ? $trace[$i]['function'] : null, ) ); return $record; } } src/Monolog/Processor/MemoryPeakUsageProcessor.php000064400000001577146412134770016416 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Injects memory_get_peak_usage in all records * * @see Monolog\Processor\MemoryProcessor::__construct() for options * @author Rob Jensen */ class MemoryPeakUsageProcessor extends MemoryProcessor { /** * @param array $record * @return array */ public function __invoke(array $record) { $bytes = memory_get_peak_usage($this->realUsage); $formatted = $this->formatBytes($bytes); $record['extra'] = array_merge( $record['extra'], array( 'memory_peak_usage' => $formatted, ) ); return $record; } } src/Monolog/Processor/MemoryProcessor.php000064400000003426146412134770014623 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Some methods that are common for all memory processors * * @author Rob Jensen */ abstract class MemoryProcessor { /** * @var boolean If true, get the real size of memory allocated from system. Else, only the memory used by emalloc() is reported. */ protected $realUsage; /** * @var boolean If true, then format memory size to human readable string (MB, KB, B depending on size) */ protected $useFormatting; /** * @param boolean $realUsage Set this to true to get the real size of memory allocated from system. * @param boolean $useFormatting If true, then format memory size to human readable string (MB, KB, B depending on size) */ public function __construct($realUsage = true, $useFormatting = true) { $this->realUsage = (boolean) $realUsage; $this->useFormatting = (boolean) $useFormatting; } /** * Formats bytes into a human readable string if $this->useFormatting is true, otherwise return $bytes as is * * @param int $bytes * @return string|int Formatted string if $this->useFormatting is true, otherwise return $bytes as is */ protected function formatBytes($bytes) { $bytes = (int) $bytes; if (!$this->useFormatting) { return $bytes; } if ($bytes > 1024*1024) { return round($bytes/1024/1024, 2).' MB'; } elseif ($bytes > 1024) { return round($bytes/1024, 2).' KB'; } return $bytes . ' B'; } } src/Monolog/Processor/MemoryUsageProcessor.php000064400000001554146412134770015610 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Injects memory_get_usage in all records * * @see Monolog\Processor\MemoryProcessor::__construct() for options * @author Rob Jensen */ class MemoryUsageProcessor extends MemoryProcessor { /** * @param array $record * @return array */ public function __invoke(array $record) { $bytes = memory_get_usage($this->realUsage); $formatted = $this->formatBytes($bytes); $record['extra'] = array_merge( $record['extra'], array( 'memory_usage' => $formatted, ) ); return $record; } } src/Monolog/Processor/ProcessIdProcessor.php000064400000001076146412134770015245 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Adds value of getmypid into records * * @author Andreas Hörnicke */ class ProcessIdProcessor { /** * @param array $record * @return array */ public function __invoke(array $record) { $record['extra']['process_id'] = getmypid(); return $record; } } src/Monolog/Processor/PsrLogMessageProcessor.php000064400000002370146412134770016063 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Processes a record's message according to PSR-3 rules * * It replaces {foo} with the value from $context['foo'] * * @author Jordi Boggiano */ class PsrLogMessageProcessor { /** * @param array $record * @return array */ public function __invoke(array $record) { if (false === strpos($record['message'], '{')) { return $record; } $replacements = array(); foreach ($record['context'] as $key => $val) { if (is_null($val) || is_scalar($val) || (is_object($val) && method_exists($val, "__toString"))) { $replacements['{'.$key.'}'] = $val; } elseif (is_object($val)) { $replacements['{'.$key.'}'] = '[object '.get_class($val).']'; } else { $replacements['{'.$key.'}'] = '['.gettype($val).']'; } } $record['message'] = strtr($record['message'], $replacements); return $record; } } src/Monolog/Processor/TagProcessor.php000064400000001136146412134770014062 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Adds a tags array into record * * @author Martijn Riemers */ class TagProcessor { private $tags; public function __construct(array $tags = array()) { $this->tags = $tags; } public function __invoke(array $record) { $record['extra']['tags'] = $this->tags; return $record; } } src/Monolog/Processor/UidProcessor.php000064400000001505146412134770014070 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Adds a unique identifier into records * * @author Simon Mönch */ class UidProcessor { private $uid; public function __construct($length = 7) { if (!is_int($length) || $length > 32 || $length < 1) { throw new \InvalidArgumentException('The uid length must be an integer between 1 and 32'); } $this->uid = substr(hash('md5', uniqid('', true)), 0, $length); } public function __invoke(array $record) { $record['extra']['uid'] = $this->uid; return $record; } } src/Monolog/Processor/WebProcessor.php000064400000005474146412134770014075 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; /** * Injects url/method and remote IP of the current web request in all records * * @author Jordi Boggiano */ class WebProcessor { /** * @var array|\ArrayAccess */ protected $serverData; /** * @var array */ protected $extraFields = array( 'url' => 'REQUEST_URI', 'ip' => 'REMOTE_ADDR', 'http_method' => 'REQUEST_METHOD', 'server' => 'SERVER_NAME', 'referrer' => 'HTTP_REFERER', ); /** * @param array|\ArrayAccess $serverData Array or object w/ ArrayAccess that provides access to the $_SERVER data * @param array|null $extraFields Extra field names to be added (all available by default) */ public function __construct($serverData = null, array $extraFields = null) { if (null === $serverData) { $this->serverData =& $_SERVER; } elseif (is_array($serverData) || $serverData instanceof \ArrayAccess) { $this->serverData = $serverData; } else { throw new \UnexpectedValueException('$serverData must be an array or object implementing ArrayAccess.'); } if (null !== $extraFields) { foreach (array_keys($this->extraFields) as $fieldName) { if (!in_array($fieldName, $extraFields)) { unset($this->extraFields[$fieldName]); } } } } /** * @param array $record * @return array */ public function __invoke(array $record) { // skip processing if for some reason request data // is not present (CLI or wonky SAPIs) if (!isset($this->serverData['REQUEST_URI'])) { return $record; } $record['extra'] = $this->appendExtraFields($record['extra']); return $record; } /** * @param string $extraName * @param string $serverName * @return $this */ public function addExtraField($extraName, $serverName) { $this->extraFields[$extraName] = $serverName; return $this; } /** * @param array $extra * @return array */ private function appendExtraFields(array $extra) { foreach ($this->extraFields as $extraName => $serverName) { $extra[$extraName] = isset($this->serverData[$serverName]) ? $this->serverData[$serverName] : null; } if (isset($this->serverData['UNIQUE_ID'])) { $extra['unique_id'] = $this->serverData['UNIQUE_ID']; } return $extra; } } src/Monolog/Registry.php000064400000007012146412134770011277 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog; use InvalidArgumentException; /** * Monolog log registry * * Allows to get `Logger` instances in the global scope * via static method calls on this class. * * * $application = new Monolog\Logger('application'); * $api = new Monolog\Logger('api'); * * Monolog\Registry::addLogger($application); * Monolog\Registry::addLogger($api); * * function testLogger() * { * Monolog\Registry::api()->addError('Sent to $api Logger instance'); * Monolog\Registry::application()->addError('Sent to $application Logger instance'); * } * * * @author Tomas Tatarko */ class Registry { /** * List of all loggers in the registry (ba named indexes) * * @var Logger[] */ private static $loggers = array(); /** * Adds new logging channel to the registry * * @param Logger $logger Instance of the logging channel * @param string|null $name Name of the logging channel ($logger->getName() by default) * @param boolean $overwrite Overwrite instance in the registry if the given name already exists? * @throws \InvalidArgumentException If $overwrite set to false and named Logger instance already exists */ public static function addLogger(Logger $logger, $name = null, $overwrite = false) { $name = $name ?: $logger->getName(); if (isset(self::$loggers[$name]) && !$overwrite) { throw new InvalidArgumentException('Logger with the given name already exists'); } self::$loggers[$name] = $logger; } /** * Removes instance from registry by name or instance * * @param string|Logger $logger Name or logger instance */ public static function removeLogger($logger) { if ($logger instanceof Logger) { if (false !== ($idx = array_search($logger, self::$loggers, true))) { unset(self::$loggers[$idx]); } } else { unset(self::$loggers[$logger]); } } /** * Clears the registry */ public static function clear() { self::$loggers = array(); } /** * Gets Logger instance from the registry * * @param string $name Name of the requested Logger instance * @return Logger Requested instance of Logger * @throws \InvalidArgumentException If named Logger instance is not in the registry */ public static function getInstance($name) { if (!isset(self::$loggers[$name])) { throw new InvalidArgumentException(sprintf('Requested "%s" logger instance is not in the registry', $name)); } return self::$loggers[$name]; } /** * Gets Logger instance from the registry via static method call * * @param string $name Name of the requested Logger instance * @param array $arguments Arguments passed to static method call * @return Logger Requested instance of Logger * @throws \InvalidArgumentException If named Logger instance is not in the registry */ public static function __callStatic($name, $arguments) { return self::getInstance($name); } } tests/Monolog/ErrorHandlerTest.php000064400000001646146412134770013300 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog; use Monolog\Handler\TestHandler; class ErrorHandlerTest extends \PHPUnit_Framework_TestCase { public function testHandleError() { $logger = new Logger('test', array($handler = new TestHandler)); $errHandler = new ErrorHandler($logger); $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false); trigger_error('Foo', E_USER_ERROR); $this->assertCount(1, $handler->getRecords()); $this->assertTrue($handler->hasErrorRecords()); trigger_error('Foo', E_USER_NOTICE); $this->assertCount(2, $handler->getRecords()); $this->assertTrue($handler->hasEmergencyRecords()); } } tests/Monolog/Formatter/ChromePHPFormatterTest.php000064400000010227146412134770016320 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase { /** * @covers Monolog\Formatter\ChromePHPFormatter::format */ public function testDefaultFormat() { $formatter = new ChromePHPFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('ip' => '127.0.0.1'), 'message' => 'log', ); $message = $formatter->format($record); $this->assertEquals( array( 'meh', array( 'message' => 'log', 'context' => array('from' => 'logger'), 'extra' => array('ip' => '127.0.0.1'), ), 'unknown', 'error' ), $message ); } /** * @covers Monolog\Formatter\ChromePHPFormatter::format */ public function testFormatWithFileAndLine() { $formatter = new ChromePHPFormatter(); $record = array( 'level' => Logger::CRITICAL, 'level_name' => 'CRITICAL', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), 'message' => 'log', ); $message = $formatter->format($record); $this->assertEquals( array( 'meh', array( 'message' => 'log', 'context' => array('from' => 'logger'), 'extra' => array('ip' => '127.0.0.1'), ), 'test : 14', 'error' ), $message ); } /** * @covers Monolog\Formatter\ChromePHPFormatter::format */ public function testFormatWithoutContext() { $formatter = new ChromePHPFormatter(); $record = array( 'level' => Logger::DEBUG, 'level_name' => 'DEBUG', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); $message = $formatter->format($record); $this->assertEquals( array( 'meh', 'log', 'unknown', 'log' ), $message ); } /** * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch */ public function testBatchFormatThrowException() { $formatter = new ChromePHPFormatter(); $records = array( array( 'level' => Logger::INFO, 'level_name' => 'INFO', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ), array( 'level' => Logger::WARNING, 'level_name' => 'WARNING', 'channel' => 'foo', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log2', ), ); $this->assertEquals( array( array( 'meh', 'log', 'unknown', 'info' ), array( 'foo', 'log2', 'unknown', 'warn' ), ), $formatter->formatBatch($records) ); } } tests/Monolog/Formatter/ElasticaFormatterTest.php000064400000004454146412134770016265 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase { public function setUp() { if (!class_exists("Elastica\Document")) { $this->markTestSkipped("ruflin/elastica not installed"); } } /** * @covers Monolog\Formatter\ElasticaFormatter::__construct * @covers Monolog\Formatter\ElasticaFormatter::format * @covers Monolog\Formatter\ElasticaFormatter::getDocument */ public function testFormat() { // test log message $msg = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); // expected values $expected = $msg; $expected['datetime'] = '1970-01-01T00:00:00+0000'; $expected['context'] = array( 'class' => '[object] (stdClass: {})', 'foo' => 7, 0 => 'bar', ); // format log message $formatter = new ElasticaFormatter('my_index', 'doc_type'); $doc = $formatter->format($msg); $this->assertInstanceOf('Elastica\Document', $doc); // Document parameters $params = $doc->getParams(); $this->assertEquals('my_index', $params['_index']); $this->assertEquals('doc_type', $params['_type']); // Document data values $data = $doc->getData(); foreach (array_keys($expected) as $key) { $this->assertEquals($expected[$key], $data[$key]); } } /** * @covers Monolog\Formatter\ElasticaFormatter::getIndex * @covers Monolog\Formatter\ElasticaFormatter::getType */ public function testGetters() { $formatter = new ElasticaFormatter('my_index', 'doc_type'); $this->assertEquals('my_index', $formatter->getIndex()); $this->assertEquals('doc_type', $formatter->getType()); } } tests/Monolog/Formatter/FlowdockFormatterTest.php000064400000003011146412134770016274 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; use Monolog\TestCase; class FlowdockFormatterTest extends TestCase { /** * @covers Monolog\Formatter\FlowdockFormatter::format */ public function testFormat() { $formatter = new FlowdockFormatter('test_source', 'source@test.com'); $record = $this->getRecord(); $expected = array( 'source' => 'test_source', 'from_address' => 'source@test.com', 'subject' => 'in test_source: WARNING - test', 'content' => 'test', 'tags' => array('#logs', '#warning', '#test'), 'project' => 'test_source', ); $formatted = $formatter->format($record); $this->assertEquals($expected, $formatted['flowdock']); } /** * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch */ public function testFormatBatch() { $formatter = new FlowdockFormatter('test_source', 'source@test.com'); $records = array( $this->getRecord(Logger::WARNING), $this->getRecord(Logger::DEBUG), ); $formatted = $formatter->formatBatch($records); $this->assertArrayHasKey('flowdock', $formatted[0]); $this->assertArrayHasKey('flowdock', $formatted[1]); } } tests/Monolog/Formatter/GelfMessageFormatterTest.php000064400000013457146412134770016725 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase { public function setUp() { if (!class_exists('\Gelf\Message')) { $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed"); } } /** * @covers Monolog\Formatter\GelfMessageFormatter::format */ public function testDefaultFormatter() { $formatter = new GelfMessageFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $this->assertEquals(0, $message->getTimestamp()); $this->assertEquals('log', $message->getShortMessage()); $this->assertEquals('meh', $message->getFacility()); $this->assertEquals(null, $message->getLine()); $this->assertEquals(null, $message->getFile()); $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel()); $this->assertNotEmpty($message->getHost()); $formatter = new GelfMessageFormatter('mysystem'); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $this->assertEquals('mysystem', $message->getHost()); } /** * @covers Monolog\Formatter\GelfMessageFormatter::format */ public function testFormatWithFileAndLine() { $formatter = new GelfMessageFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('file' => 'test', 'line' => 14), 'message' => 'log', ); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $this->assertEquals('test', $message->getFile()); $this->assertEquals(14, $message->getLine()); } /** * @covers Monolog\Formatter\GelfMessageFormatter::format */ public function testFormatWithContext() { $formatter = new GelfMessageFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $message_array = $message->toArray(); $this->assertArrayHasKey('_ctxt_from', $message_array); $this->assertEquals('logger', $message_array['_ctxt_from']); // Test with extraPrefix $formatter = new GelfMessageFormatter(null, null, 'CTX'); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $message_array = $message->toArray(); $this->assertArrayHasKey('_CTXfrom', $message_array); $this->assertEquals('logger', $message_array['_CTXfrom']); } /** * @covers Monolog\Formatter\GelfMessageFormatter::format */ public function testFormatWithContextContainingException() { $formatter = new GelfMessageFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger', 'exception' => array( 'class' => '\Exception', 'file' => '/some/file/in/dir.php:56', 'trace' => array('/some/file/1.php:23', '/some/file/2.php:3') )), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log' ); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $this->assertEquals("/some/file/in/dir.php", $message->getFile()); $this->assertEquals("56", $message->getLine()); } /** * @covers Monolog\Formatter\GelfMessageFormatter::format */ public function testFormatWithExtra() { $formatter = new GelfMessageFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $message_array = $message->toArray(); $this->assertArrayHasKey('_key', $message_array); $this->assertEquals('pair', $message_array['_key']); // Test with extraPrefix $formatter = new GelfMessageFormatter(null, 'EXT'); $message = $formatter->format($record); $this->assertInstanceOf('Gelf\Message', $message); $message_array = $message->toArray(); $this->assertArrayHasKey('_EXTkey', $message_array); $this->assertEquals('pair', $message_array['_EXTkey']); } private function isLegacy() { return interface_exists('\Gelf\IMessagePublisher'); } } tests/Monolog/Formatter/JsonFormatterTest.php000064400000005056146412134770015450 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; use Monolog\TestCase; class JsonFormatterTest extends TestCase { /** * @covers Monolog\Formatter\JsonFormatter::__construct * @covers Monolog\Formatter\JsonFormatter::getBatchMode * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines */ public function testConstruct() { $formatter = new JsonFormatter(); $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); $this->assertEquals(true, $formatter->isAppendingNewlines()); $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false); $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); $this->assertEquals(false, $formatter->isAppendingNewlines()); } /** * @covers Monolog\Formatter\JsonFormatter::format */ public function testFormat() { $formatter = new JsonFormatter(); $record = $this->getRecord(); $this->assertEquals(json_encode($record)."\n", $formatter->format($record)); $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); $record = $this->getRecord(); $this->assertEquals(json_encode($record), $formatter->format($record)); } /** * @covers Monolog\Formatter\JsonFormatter::formatBatch * @covers Monolog\Formatter\JsonFormatter::formatBatchJson */ public function testFormatBatch() { $formatter = new JsonFormatter(); $records = array( $this->getRecord(Logger::WARNING), $this->getRecord(Logger::DEBUG), ); $this->assertEquals(json_encode($records), $formatter->formatBatch($records)); } /** * @covers Monolog\Formatter\JsonFormatter::formatBatch * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines */ public function testFormatBatchNewlines() { $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES); $records = $expected = array( $this->getRecord(Logger::WARNING), $this->getRecord(Logger::DEBUG), ); array_walk($expected, function (&$value, $key) { $value = json_encode($value); }); $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records)); } } tests/Monolog/Formatter/LineFormatterTest.php000064400000015671146412134770015432 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * @covers Monolog\Formatter\LineFormatter */ class LineFormatterTest extends \PHPUnit_Framework_TestCase { public function testDefFormatWithString() { $formatter = new LineFormatter(null, 'Y-m-d'); $message = $formatter->format(array( 'level_name' => 'WARNING', 'channel' => 'log', 'context' => array(), 'message' => 'foo', 'datetime' => new \DateTime, 'extra' => array(), )); $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); } public function testDefFormatWithArrayContext() { $formatter = new LineFormatter(null, 'Y-m-d'); $message = $formatter->format(array( 'level_name' => 'ERROR', 'channel' => 'meh', 'message' => 'foo', 'datetime' => new \DateTime, 'extra' => array(), 'context' => array( 'foo' => 'bar', 'baz' => 'qux', 'bool' => false, 'null' => null, ) )); $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message); } public function testDefFormatExtras() { $formatter = new LineFormatter(null, 'Y-m-d'); $message = $formatter->format(array( 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array('ip' => '127.0.0.1'), 'message' => 'log', )); $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message); } public function testFormatExtras() { $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d'); $message = $formatter->format(array( 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array('ip' => '127.0.0.1', 'file' => 'test'), 'message' => 'log', )); $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message); } public function testContextAndExtraOptionallyNotShownIfEmpty() { $formatter = new LineFormatter(null, 'Y-m-d', false, true); $message = $formatter->format(array( 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array(), 'message' => 'log', )); $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message); } public function testDefFormatWithObject() { $formatter = new LineFormatter(null, 'Y-m-d'); $message = $formatter->format(array( 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), 'message' => 'foobar', )); $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: {})","baz":[],"res":"[resource]"}'."\n", $message); } public function testDefFormatWithException() { $formatter = new LineFormatter(null, 'Y-m-d'); $message = $formatter->format(array( 'level_name' => 'CRITICAL', 'channel' => 'core', 'context' => array('exception' => new \RuntimeException('Foo')), 'datetime' => new \DateTime, 'extra' => array(), 'message' => 'foobar', )); $path = str_replace('\\/', '/', json_encode(__FILE__)); $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException: Foo at '.substr($path, 1, -1).':'.(__LINE__-8).')"} []'."\n", $message); } public function testDefFormatWithPreviousException() { $formatter = new LineFormatter(null, 'Y-m-d'); $previous = new \LogicException('Wut?'); $message = $formatter->format(array( 'level_name' => 'CRITICAL', 'channel' => 'core', 'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)), 'datetime' => new \DateTime, 'extra' => array(), 'message' => 'foobar', )); $path = str_replace('\\/', '/', json_encode(__FILE__)); $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException: Foo at '.substr($path, 1, -1).':'.(__LINE__-8).', LogicException: Wut? at '.substr($path, 1, -1).':'.(__LINE__-12).')"} []'."\n", $message); } public function testBatchFormat() { $formatter = new LineFormatter(null, 'Y-m-d'); $message = $formatter->formatBatch(array( array( 'level_name' => 'CRITICAL', 'channel' => 'test', 'message' => 'bar', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array(), ), array( 'level_name' => 'WARNING', 'channel' => 'log', 'message' => 'foo', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array(), ), )); $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); } public function testFormatShouldStripInlineLineBreaks() { $formatter = new LineFormatter(null, 'Y-m-d'); $message = $formatter->format( array( 'message' => "foo\nbar", 'context' => array(), 'extra' => array(), ) ); $this->assertRegExp('/foo bar/', $message); } public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet() { $formatter = new LineFormatter(null, 'Y-m-d', true); $message = $formatter->format( array( 'message' => "foo\nbar", 'context' => array(), 'extra' => array(), ) ); $this->assertRegExp('/foo\nbar/', $message); } } class TestFoo { public $foo = 'foo'; } class TestBar { public function __toString() { return 'bar'; } } tests/Monolog/Formatter/LogglyFormatterTest.php000064400000002273146412134770015772 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\TestCase; class LogglyFormatterTest extends TestCase { /** * @covers Monolog\Formatter\LogglyFormatter::__construct */ public function testConstruct() { $formatter = new LogglyFormatter(); $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON); $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); } /** * @covers Monolog\Formatter\LogglyFormatter::format */ public function testFormat() { $formatter = new LogglyFormatter(); $record = $this->getRecord(); $formatted_decoded = json_decode($formatter->format($record), true); $this->assertArrayHasKey("timestamp", $formatted_decoded); $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]); } } tests/Monolog/Formatter/LogstashFormatterTest.php000064400000023117146412134770016321 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; class LogstashFormatterTest extends \PHPUnit_Framework_TestCase { /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testDefaultFormatter() { $formatter = new LogstashFormatter('test', 'hostname'); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); $message = json_decode($formatter->format($record), true); $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); $this->assertEquals('log', $message['@message']); $this->assertEquals('meh', $message['@fields']['channel']); $this->assertContains('meh', $message['@tags']); $this->assertEquals(Logger::ERROR, $message['@fields']['level']); $this->assertEquals('test', $message['@type']); $this->assertEquals('hostname', $message['@source']); $formatter = new LogstashFormatter('mysystem'); $message = json_decode($formatter->format($record), true); $this->assertEquals('mysystem', $message['@type']); } /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testFormatWithFileAndLine() { $formatter = new LogstashFormatter('test'); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('file' => 'test', 'line' => 14), 'message' => 'log', ); $message = json_decode($formatter->format($record), true); $this->assertEquals('test', $message['@fields']['file']); $this->assertEquals(14, $message['@fields']['line']); } /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testFormatWithContext() { $formatter = new LogstashFormatter('test'); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = json_decode($formatter->format($record), true); $message_array = $message['@fields']; $this->assertArrayHasKey('ctxt_from', $message_array); $this->assertEquals('logger', $message_array['ctxt_from']); // Test with extraPrefix $formatter = new LogstashFormatter('test', null, null, 'CTX'); $message = json_decode($formatter->format($record), true); $message_array = $message['@fields']; $this->assertArrayHasKey('CTXfrom', $message_array); $this->assertEquals('logger', $message_array['CTXfrom']); } /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testFormatWithExtra() { $formatter = new LogstashFormatter('test'); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = json_decode($formatter->format($record), true); $message_array = $message['@fields']; $this->assertArrayHasKey('key', $message_array); $this->assertEquals('pair', $message_array['key']); // Test with extraPrefix $formatter = new LogstashFormatter('test', null, 'EXT'); $message = json_decode($formatter->format($record), true); $message_array = $message['@fields']; $this->assertArrayHasKey('EXTkey', $message_array); $this->assertEquals('pair', $message_array['EXTkey']); } public function testFormatWithApplicationName() { $formatter = new LogstashFormatter('app', 'test'); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = json_decode($formatter->format($record), true); $this->assertArrayHasKey('@type', $message); $this->assertEquals('app', $message['@type']); } /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testDefaultFormatterV1() { $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); $message = json_decode($formatter->format($record), true); $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); $this->assertEquals("1", $message['@version']); $this->assertEquals('log', $message['message']); $this->assertEquals('meh', $message['channel']); $this->assertEquals('ERROR', $message['level']); $this->assertEquals('test', $message['type']); $this->assertEquals('hostname', $message['host']); $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1); $message = json_decode($formatter->format($record), true); $this->assertEquals('mysystem', $message['type']); } /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testFormatWithFileAndLineV1() { $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('file' => 'test', 'line' => 14), 'message' => 'log', ); $message = json_decode($formatter->format($record), true); $this->assertEquals('test', $message['file']); $this->assertEquals(14, $message['line']); } /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testFormatWithContextV1() { $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = json_decode($formatter->format($record), true); $this->assertArrayHasKey('ctxt_from', $message); $this->assertEquals('logger', $message['ctxt_from']); // Test with extraPrefix $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1); $message = json_decode($formatter->format($record), true); $this->assertArrayHasKey('CTXfrom', $message); $this->assertEquals('logger', $message['CTXfrom']); } /** * @covers Monolog\Formatter\LogstashFormatter::format */ public function testFormatWithExtraV1() { $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = json_decode($formatter->format($record), true); $this->assertArrayHasKey('key', $message); $this->assertEquals('pair', $message['key']); // Test with extraPrefix $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1); $message = json_decode($formatter->format($record), true); $this->assertArrayHasKey('EXTkey', $message); $this->assertEquals('pair', $message['EXTkey']); } public function testFormatWithApplicationNameV1() { $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('key' => 'pair'), 'message' => 'log' ); $message = json_decode($formatter->format($record), true); $this->assertArrayHasKey('type', $message); $this->assertEquals('app', $message['type']); } } tests/Monolog/Formatter/NormalizerFormatterTest.php000064400000012702146412134770016655 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; /** * @covers Monolog\Formatter\NormalizerFormatter */ class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase { public function testFormat() { $formatter = new NormalizerFormatter('Y-m-d'); $formatted = $formatter->format(array( 'level_name' => 'ERROR', 'channel' => 'meh', 'message' => 'foo', 'datetime' => new \DateTime, 'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), 'context' => array( 'foo' => 'bar', 'baz' => 'qux', ), )); $this->assertEquals(array( 'level_name' => 'ERROR', 'channel' => 'meh', 'message' => 'foo', 'datetime' => date('Y-m-d'), 'extra' => array( 'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})', 'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: {})', 'baz' => array(), 'res' => '[resource]', ), 'context' => array( 'foo' => 'bar', 'baz' => 'qux', ) ), $formatted); } public function testFormatExceptions() { $formatter = new NormalizerFormatter('Y-m-d'); $e = new \LogicException('bar'); $e2 = new \RuntimeException('foo', 0, $e); $formatted = $formatter->format(array( 'exception' => $e2, )); $this->assertGreaterThan(5, count($formatted['exception']['trace'])); $this->assertTrue(isset($formatted['exception']['previous'])); unset($formatted['exception']['trace'], $formatted['exception']['previous']); $this->assertEquals(array( 'exception' => array( 'class' => get_class($e2), 'message' => $e2->getMessage(), 'file' => $e2->getFile().':'.$e2->getLine(), ) ), $formatted); } public function testBatchFormat() { $formatter = new NormalizerFormatter('Y-m-d'); $formatted = $formatter->formatBatch(array( array( 'level_name' => 'CRITICAL', 'channel' => 'test', 'message' => 'bar', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array(), ), array( 'level_name' => 'WARNING', 'channel' => 'log', 'message' => 'foo', 'context' => array(), 'datetime' => new \DateTime, 'extra' => array(), ), )); $this->assertEquals(array( array( 'level_name' => 'CRITICAL', 'channel' => 'test', 'message' => 'bar', 'context' => array(), 'datetime' => date('Y-m-d'), 'extra' => array(), ), array( 'level_name' => 'WARNING', 'channel' => 'log', 'message' => 'foo', 'context' => array(), 'datetime' => date('Y-m-d'), 'extra' => array(), ), ), $formatted); } /** * Test issue #137 */ public function testIgnoresRecursiveObjectReferences() { // set up the recursion $foo = new \stdClass(); $bar = new \stdClass(); $foo->bar = $bar; $bar->foo = $foo; // set an error handler to assert that the error is not raised anymore $that = $this; set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { if (error_reporting() & $level) { restore_error_handler(); $that->fail("$message should not be raised"); } }); $formatter = new NormalizerFormatter(); $reflMethod = new \ReflectionMethod($formatter, 'toJson'); $reflMethod->setAccessible(true); $res = $reflMethod->invoke($formatter, array($foo, $bar), true); restore_error_handler(); $this->assertEquals(@json_encode(array($foo, $bar)), $res); } public function testIgnoresInvalidTypes() { // set up the recursion $resource = fopen(__FILE__, 'r'); // set an error handler to assert that the error is not raised anymore $that = $this; set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { if (error_reporting() & $level) { restore_error_handler(); $that->fail("$message should not be raised"); } }); $formatter = new NormalizerFormatter(); $reflMethod = new \ReflectionMethod($formatter, 'toJson'); $reflMethod->setAccessible(true); $res = $reflMethod->invoke($formatter, array($resource), true); restore_error_handler(); $this->assertEquals(@json_encode(array($resource)), $res); } } class TestFooNorm { public $foo = 'foo'; } class TestBarNorm { public function __toString() { return 'bar'; } } tests/Monolog/Formatter/ScalarFormatterTest.php000064400000005523146412134770015743 0ustar00formatter = new ScalarFormatter(); } public function buildTrace(\Exception $e) { $data = array(); $trace = $e->getTrace(); foreach ($trace as $frame) { if (isset($frame['file'])) { $data[] = $frame['file'].':'.$frame['line']; } else { $data[] = json_encode($frame); } } return $data; } public function encodeJson($data) { if (version_compare(PHP_VERSION, '5.4.0', '>=')) { return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); } return json_encode($data); } public function testFormat() { $exception = new \Exception('foo'); $formatted = $this->formatter->format(array( 'foo' => 'string', 'bar' => 1, 'baz' => false, 'bam' => array(1,2,3), 'bat' => array('foo' => 'bar'), 'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'), 'ban' => $exception )); $this->assertSame(array( 'foo' => 'string', 'bar' => 1, 'baz' => false, 'bam' => $this->encodeJson(array(1,2,3)), 'bat' => $this->encodeJson(array('foo' => 'bar')), 'bap' => '1970-01-01 00:00:00', 'ban' => $this->encodeJson(array( 'class' => get_class($exception), 'message' => $exception->getMessage(), 'file' => $exception->getFile() . ':' . $exception->getLine(), 'trace' => $this->buildTrace($exception) )) ), $formatted); } public function testFormatWithErrorContext() { $context = array('file' => 'foo', 'line' => 1); $formatted = $this->formatter->format(array( 'context' => $context )); $this->assertSame(array( 'context' => $this->encodeJson($context) ), $formatted); } public function testFormatWithExceptionContext() { $exception = new \Exception('foo'); $formatted = $this->formatter->format(array( 'context' => array( 'exception' => $exception ) )); $this->assertSame(array( 'context' => $this->encodeJson(array( 'exception' => array( 'class' => get_class($exception), 'message' => $exception->getMessage(), 'file' => $exception->getFile() . ':' . $exception->getLine(), 'trace' => $this->buildTrace($exception) ) )) ), $formatted); } } tests/Monolog/Formatter/WildfireFormatterTest.php000064400000010222146412134770016273 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Formatter; use Monolog\Logger; class WildfireFormatterTest extends \PHPUnit_Framework_TestCase { /** * @covers Monolog\Formatter\WildfireFormatter::format */ public function testDefaultFormat() { $wildfire = new WildfireFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('ip' => '127.0.0.1'), 'message' => 'log', ); $message = $wildfire->format($record); $this->assertEquals( '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},' .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', $message ); } /** * @covers Monolog\Formatter\WildfireFormatter::format */ public function testFormatWithFileAndLine() { $wildfire = new WildfireFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('from' => 'logger'), 'datetime' => new \DateTime("@0"), 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), 'message' => 'log', ); $message = $wildfire->format($record); $this->assertEquals( '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},' .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', $message ); } /** * @covers Monolog\Formatter\WildfireFormatter::format */ public function testFormatWithoutContext() { $wildfire = new WildfireFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); $message = $wildfire->format($record); $this->assertEquals( '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|', $message ); } /** * @covers Monolog\Formatter\WildfireFormatter::formatBatch * @expectedException BadMethodCallException */ public function testBatchFormatThrowException() { $wildfire = new WildfireFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array(), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); $wildfire->formatBatch(array($record)); } /** * @covers Monolog\Formatter\WildfireFormatter::format */ public function testTableFormat() { $wildfire = new WildfireFormatter(); $record = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'table-channel', 'context' => array( WildfireFormatter::TABLE => array( array('col1', 'col2', 'col3'), array('val1', 'val2', 'val3'), array('foo1', 'foo2', 'foo3'), array('bar1', 'bar2', 'bar3'), ), ), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'table-message', ); $message = $wildfire->format($record); $this->assertEquals( '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|', $message ); } } tests/Monolog/Functional/Handler/FirePHPHandlerTest.php000064400000001400146412134770017107 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ spl_autoload_register(function ($class) { $file = __DIR__.'/../../../../src/'.strtr($class, '\\', '/').'.php'; if (file_exists($file)) { require $file; return true; } }); use Monolog\Logger; use Monolog\Handler\FirePHPHandler; use Monolog\Handler\ChromePHPHandler; $logger = new Logger('firephp'); $logger->pushHandler(new FirePHPHandler); $logger->pushHandler(new ChromePHPHandler()); $logger->addDebug('Debug'); $logger->addInfo('Info'); $logger->addWarning('Warning'); $logger->addError('Error'); tests/Monolog/Handler/AbstractHandlerTest.php000064400000007771146412134770015334 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; use Monolog\Formatter\LineFormatter; use Monolog\Processor\WebProcessor; class AbstractHandlerTest extends TestCase { /** * @covers Monolog\Handler\AbstractHandler::__construct * @covers Monolog\Handler\AbstractHandler::getLevel * @covers Monolog\Handler\AbstractHandler::setLevel * @covers Monolog\Handler\AbstractHandler::getBubble * @covers Monolog\Handler\AbstractHandler::setBubble * @covers Monolog\Handler\AbstractHandler::getFormatter * @covers Monolog\Handler\AbstractHandler::setFormatter */ public function testConstructAndGetSet() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); $this->assertEquals(Logger::WARNING, $handler->getLevel()); $this->assertEquals(false, $handler->getBubble()); $handler->setLevel(Logger::ERROR); $handler->setBubble(true); $handler->setFormatter($formatter = new LineFormatter); $this->assertEquals(Logger::ERROR, $handler->getLevel()); $this->assertEquals(true, $handler->getBubble()); $this->assertSame($formatter, $handler->getFormatter()); } /** * @covers Monolog\Handler\AbstractHandler::handleBatch */ public function testHandleBatch() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); $handler->expects($this->exactly(2)) ->method('handle'); $handler->handleBatch(array($this->getRecord(), $this->getRecord())); } /** * @covers Monolog\Handler\AbstractHandler::isHandling */ public function testIsHandling() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); $this->assertTrue($handler->isHandling($this->getRecord())); $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); } /** * @covers Monolog\Handler\AbstractHandler::__construct */ public function testHandlesPsrStyleLevels() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false)); $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); $handler->setLevel('debug'); $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); } /** * @covers Monolog\Handler\AbstractHandler::getFormatter * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter */ public function testGetFormatterInitializesDefault() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter()); } /** * @covers Monolog\Handler\AbstractHandler::pushProcessor * @covers Monolog\Handler\AbstractHandler::popProcessor * @expectedException LogicException */ public function testPushPopProcessor() { $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); $processor1 = new WebProcessor; $processor2 = new WebProcessor; $logger->pushProcessor($processor1); $logger->pushProcessor($processor2); $this->assertEquals($processor2, $logger->popProcessor()); $this->assertEquals($processor1, $logger->popProcessor()); $logger->popProcessor(); } /** * @covers Monolog\Handler\AbstractHandler::pushProcessor * @expectedException InvalidArgumentException */ public function testPushProcessorWithNonCallable() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); $handler->pushProcessor(new \stdClass()); } } tests/Monolog/Handler/AbstractProcessingHandlerTest.php000064400000005140146412134770017355 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; use Monolog\Processor\WebProcessor; class AbstractProcessingHandlerTest extends TestCase { /** * @covers Monolog\Handler\AbstractProcessingHandler::handle */ public function testHandleLowerLevelMessage() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true)); $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); } /** * @covers Monolog\Handler\AbstractProcessingHandler::handle */ public function testHandleBubbling() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true)); $this->assertFalse($handler->handle($this->getRecord())); } /** * @covers Monolog\Handler\AbstractProcessingHandler::handle */ public function testHandleNotBubbling() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false)); $this->assertTrue($handler->handle($this->getRecord())); } /** * @covers Monolog\Handler\AbstractProcessingHandler::handle */ public function testHandleIsFalseWhenNotHandled() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false)); $this->assertTrue($handler->handle($this->getRecord())); $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); } /** * @covers Monolog\Handler\AbstractProcessingHandler::processRecord */ public function testProcessRecord() { $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler'); $handler->pushProcessor(new WebProcessor(array( 'REQUEST_URI' => '', 'REQUEST_METHOD' => '', 'REMOTE_ADDR' => '', 'SERVER_NAME' => '', 'UNIQUE_ID' => '', ))); $handledRecord = null; $handler->expects($this->once()) ->method('write') ->will($this->returnCallback(function ($record) use (&$handledRecord) { $handledRecord = $record; })) ; $handler->handle($this->getRecord()); $this->assertEquals(6, count($handledRecord['extra'])); } } tests/Monolog/Handler/AmqpHandlerTest.php000064400000010201146412134770014445 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; use PhpAmqpLib\Message\AMQPMessage; use PhpAmqpLib\Channel\AMQPChannel; use PhpAmqpLib\Connection\AMQPConnection; /** * @covers Monolog\Handler\RotatingFileHandler */ class AmqpHandlerTest extends TestCase { public function testHandleAmqpExt() { if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) { $this->markTestSkipped("amqp-php not installed"); } if (!class_exists('AMQPChannel')) { $this->markTestSkipped("Please update AMQP to version >= 1.0"); } $messages = array(); $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false); $exchange->expects($this->once()) ->method('setName') ->with('log') ; $exchange->expects($this->any()) ->method('publish') ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) { $messages[] = array($message, $routing_key, $flags, $attributes); })) ; $handler = new AmqpHandler($exchange, 'log'); $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); $expected = array( array( 'message' => 'test', 'context' => array( 'data' => array(), 'foo' => 34, ), 'level' => 300, 'level_name' => 'WARNING', 'channel' => 'test', 'extra' => array(), ), 'warn.test', 0, array( 'delivery_mode' => 2, 'Content-type' => 'application/json' ) ); $handler->handle($record); $this->assertCount(1, $messages); $messages[0][0] = json_decode($messages[0][0], true); unset($messages[0][0]['datetime']); $this->assertEquals($expected, $messages[0]); } public function testHandlePhpAmqpLib() { if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) { $this->markTestSkipped("php-amqplib not installed"); } $messages = array(); $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false); $exchange->expects($this->any()) ->method('basic_publish') ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) { $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket); })) ; $handler = new AmqpHandler($exchange, 'log'); $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); $expected = array( array( 'message' => 'test', 'context' => array( 'data' => array(), 'foo' => 34, ), 'level' => 300, 'level_name' => 'WARNING', 'channel' => 'test', 'extra' => array(), ), 'log', 'warn.test', false, false, null, array( 'delivery_mode' => 2, 'content_type' => 'application/json' ) ); $handler->handle($record); $this->assertCount(1, $messages); /* @var $msg AMQPMessage */ $msg = $messages[0][0]; $messages[0][0] = json_decode($msg->body, true); $messages[0][] = $msg->get_properties(); unset($messages[0][0]['datetime']); $this->assertEquals($expected, $messages[0]); } } tests/Monolog/Handler/BrowserConsoleHandlerTest.php000064400000010154146412134770016524 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @covers Monolog\Handler\BrowserConsoleHandlerTest */ class BrowserConsoleHandlerTest extends TestCase { protected function setUp() { BrowserConsoleHandler::reset(); } protected function generateScript() { $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript'); $reflMethod->setAccessible(true); return $reflMethod->invoke(null); } public function testStyling() { $handler = new BrowserConsoleHandler(); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}')); $expected = <<assertEquals($expected, $this->generateScript()); } public function testEscaping() { $handler = new BrowserConsoleHandler(); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}")); $expected = <<assertEquals($expected, $this->generateScript()); } public function testAutolabel() { $handler = new BrowserConsoleHandler(); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}')); $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); $expected = <<assertEquals($expected, $this->generateScript()); } public function testContext() { $handler = new BrowserConsoleHandler(); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar'))); $expected = <<assertEquals($expected, $this->generateScript()); } public function testConcurrentHandlers() { $handler1 = new BrowserConsoleHandler(); $handler1->setFormatter($this->getIdentityFormatter()); $handler2 = new BrowserConsoleHandler(); $handler2->setFormatter($this->getIdentityFormatter()); $handler1->handle($this->getRecord(Logger::DEBUG, 'test1')); $handler2->handle($this->getRecord(Logger::DEBUG, 'test2')); $handler1->handle($this->getRecord(Logger::DEBUG, 'test3')); $handler2->handle($this->getRecord(Logger::DEBUG, 'test4')); $expected = <<assertEquals($expected, $this->generateScript()); } } tests/Monolog/Handler/BufferHandlerTest.php000064400000012357146412134770014776 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class BufferHandlerTest extends TestCase { private $shutdownCheckHandler; /** * @covers Monolog\Handler\BufferHandler::__construct * @covers Monolog\Handler\BufferHandler::handle * @covers Monolog\Handler\BufferHandler::close */ public function testHandleBuffers() { $test = new TestHandler(); $handler = new BufferHandler($test); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $this->assertFalse($test->hasDebugRecords()); $this->assertFalse($test->hasInfoRecords()); $handler->close(); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue(count($test->getRecords()) === 2); } /** * @covers Monolog\Handler\BufferHandler::close * @covers Monolog\Handler\BufferHandler::flush */ public function testPropagatesRecordsAtEndOfRequest() { $test = new TestHandler(); $handler = new BufferHandler($test); $handler->handle($this->getRecord(Logger::WARNING)); $handler->handle($this->getRecord(Logger::DEBUG)); $this->shutdownCheckHandler = $test; register_shutdown_function(array($this, 'checkPropagation')); } public function checkPropagation() { if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) { echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL; exit(1); } } /** * @covers Monolog\Handler\BufferHandler::handle */ public function testHandleBufferLimit() { $test = new TestHandler(); $handler = new BufferHandler($test, 2); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $handler->handle($this->getRecord(Logger::WARNING)); $handler->close(); $this->assertTrue($test->hasWarningRecords()); $this->assertTrue($test->hasInfoRecords()); $this->assertFalse($test->hasDebugRecords()); } /** * @covers Monolog\Handler\BufferHandler::handle */ public function testHandleBufferLimitWithFlushOnOverflow() { $test = new TestHandler(); $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true); // send two records $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::DEBUG)); $this->assertFalse($test->hasDebugRecords()); $this->assertCount(0, $test->getRecords()); // overflow $handler->handle($this->getRecord(Logger::INFO)); $this->assertTrue($test->hasDebugRecords()); $this->assertCount(3, $test->getRecords()); // should buffer again $handler->handle($this->getRecord(Logger::WARNING)); $this->assertCount(3, $test->getRecords()); $handler->close(); $this->assertCount(5, $test->getRecords()); $this->assertTrue($test->hasWarningRecords()); $this->assertTrue($test->hasInfoRecords()); } /** * @covers Monolog\Handler\BufferHandler::handle */ public function testHandleLevel() { $test = new TestHandler(); $handler = new BufferHandler($test, 0, Logger::INFO); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $handler->handle($this->getRecord(Logger::WARNING)); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->close(); $this->assertTrue($test->hasWarningRecords()); $this->assertTrue($test->hasInfoRecords()); $this->assertFalse($test->hasDebugRecords()); } /** * @covers Monolog\Handler\BufferHandler::flush */ public function testFlush() { $test = new TestHandler(); $handler = new BufferHandler($test, 0); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $handler->flush(); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue($test->hasDebugRecords()); $this->assertFalse($test->hasWarningRecords()); } /** * @covers Monolog\Handler\BufferHandler::handle */ public function testHandleUsesProcessors() { $test = new TestHandler(); $handler = new BufferHandler($test); $handler->pushProcessor(function ($record) { $record['extra']['foo'] = true; return $record; }); $handler->handle($this->getRecord(Logger::WARNING)); $handler->flush(); $this->assertTrue($test->hasWarningRecords()); $records = $test->getRecords(); $this->assertTrue($records[0]['extra']['foo']); } } tests/Monolog/Handler/ChromePHPHandlerTest.php000064400000010234146412134770015342 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @covers Monolog\Handler\ChromePHPHandler */ class ChromePHPHandlerTest extends TestCase { protected function setUp() { TestChromePHPHandler::reset(); $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0'; } public function testHeaders() { $handler = new TestChromePHPHandler(); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::WARNING)); $expected = array( 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( 'version' => ChromePHPHandler::VERSION, 'columns' => array('label', 'log', 'backtrace', 'type'), 'rows' => array( 'test', 'test', ), 'request_uri' => '', )))) ); $this->assertEquals($expected, $handler->getHeaders()); } public function testHeadersOverflow() { $handler = new TestChromePHPHandler(); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150*1024))); // overflow chrome headers limit $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100*1024))); $expected = array( 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( 'version' => ChromePHPHandler::VERSION, 'columns' => array('label', 'log', 'backtrace', 'type'), 'rows' => array( array( 'test', 'test', 'unknown', 'log', ), array( 'test', str_repeat('a', 150*1024), 'unknown', 'warn', ), array( 'monolog', 'Incomplete logs, chrome header size limit reached', 'unknown', 'warn', ), ), 'request_uri' => '', )))) ); $this->assertEquals($expected, $handler->getHeaders()); } public function testConcurrentHandlers() { $handler = new TestChromePHPHandler(); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::WARNING)); $handler2 = new TestChromePHPHandler(); $handler2->setFormatter($this->getIdentityFormatter()); $handler2->handle($this->getRecord(Logger::DEBUG)); $handler2->handle($this->getRecord(Logger::WARNING)); $expected = array( 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( 'version' => ChromePHPHandler::VERSION, 'columns' => array('label', 'log', 'backtrace', 'type'), 'rows' => array( 'test', 'test', 'test', 'test', ), 'request_uri' => '', )))) ); $this->assertEquals($expected, $handler2->getHeaders()); } } class TestChromePHPHandler extends ChromePHPHandler { protected $headers = array(); public static function reset() { self::$initialized = false; self::$overflowed = false; self::$sendHeaders = true; self::$json['rows'] = array(); } protected function sendHeader($header, $content) { $this->headers[$header] = $content; } public function getHeaders() { return $this->headers; } } tests/Monolog/Handler/CouchDBHandlerTest.php000064400000002137146412134770015027 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class CouchDBHandlerTest extends TestCase { public function testHandle() { $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); $expected = array( 'message' => 'test', 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), 'level' => Logger::WARNING, 'level_name' => 'WARNING', 'channel' => 'test', 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), 'extra' => array(), ); $handler = new CouchDBHandler(); try { $handler->handle($record); } catch (\RuntimeException $e) { $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984'); } } } tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php000064400000002706146412134770016521 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class DoctrineCouchDBHandlerTest extends TestCase { protected function setup() { if (!class_exists('Doctrine\CouchDB\CouchDBClient')) { $this->markTestSkipped('The "doctrine/couchdb" package is not installed'); } } public function testHandle() { $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient') ->setMethods(array('postDocument')) ->disableOriginalConstructor() ->getMock(); $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); $expected = array( 'message' => 'test', 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), 'level' => Logger::WARNING, 'level_name' => 'WARNING', 'channel' => 'test', 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), 'extra' => array(), ); $client->expects($this->once()) ->method('postDocument') ->with($expected); $handler = new DoctrineCouchDBHandler($client); $handler->handle($record); } } tests/Monolog/Handler/DynamoDbHandlerTest.php000064400000004224146412134770015254 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; class DynamoDbHandlerTest extends TestCase { public function setUp() { if (!class_exists('Aws\DynamoDb\DynamoDbClient')) { $this->markTestSkipped('aws/aws-sdk-php not installed'); } $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient') ->setMethods(array('formatAttributes', '__call')) ->disableOriginalConstructor()->getMock(); } public function testConstruct() { $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo')); } public function testInterface() { $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo')); } public function testGetFormatter() { $handler = new DynamoDbHandler($this->client, 'foo'); $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter()); } public function testHandle() { $record = $this->getRecord(); $formatter = $this->getMock('Monolog\Formatter\FormatterInterface'); $formatted = array('foo' => 1, 'bar' => 2); $handler = new DynamoDbHandler($this->client, 'foo'); $handler->setFormatter($formatter); $formatter ->expects($this->once()) ->method('format') ->with($record) ->will($this->returnValue($formatted)); $this->client ->expects($this->once()) ->method('formatAttributes') ->with($this->isType('array')) ->will($this->returnValue($formatted)); $this->client ->expects($this->once()) ->method('__call') ->with('putItem', array(array( 'TableName' => 'foo', 'Item' => $formatted ))); $handler->handle($record); } } tests/Monolog/Handler/ElasticSearchHandlerTest.php000064400000017010146412134770016266 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\ElasticaFormatter; use Monolog\Formatter\NormalizerFormatter; use Monolog\TestCase; use Monolog\Logger; use Elastica\Client; use Elastica\Request; use Elastica\Response; class ElasticSearchHandlerTest extends TestCase { /** * @var Client mock */ protected $client; /** * @var array Default handler options */ protected $options = array( 'index' => 'my_index', 'type' => 'doc_type', ); public function setUp() { // Elastica lib required if (!class_exists("Elastica\Client")) { $this->markTestSkipped("ruflin/elastica not installed"); } // base mock Elastica Client object $this->client = $this->getMockBuilder('Elastica\Client') ->setMethods(array('addDocuments')) ->disableOriginalConstructor() ->getMock(); } /** * @covers Monolog\Handler\ElasticSearchHandler::write * @covers Monolog\Handler\ElasticSearchHandler::handleBatch * @covers Monolog\Handler\ElasticSearchHandler::bulkSend * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter */ public function testHandle() { // log message $msg = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); // format expected result $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']); $expected = array($formatter->format($msg)); // setup ES client mock $this->client->expects($this->any()) ->method('addDocuments') ->with($expected); // perform tests $handler = new ElasticSearchHandler($this->client, $this->options); $handler->handle($msg); $handler->handleBatch(array($msg)); } /** * @covers Monolog\Handler\ElasticSearchHandler::setFormatter */ public function testSetFormatter() { $handler = new ElasticSearchHandler($this->client); $formatter = new ElasticaFormatter('index_new', 'type_new'); $handler->setFormatter($formatter); $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter()); $this->assertEquals('index_new', $handler->getFormatter()->getIndex()); $this->assertEquals('type_new', $handler->getFormatter()->getType()); } /** * @covers Monolog\Handler\ElasticSearchHandler::setFormatter * @expectedException InvalidArgumentException * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter */ public function testSetFormatterInvalid() { $handler = new ElasticSearchHandler($this->client); $formatter = new NormalizerFormatter(); $handler->setFormatter($formatter); } /** * @covers Monolog\Handler\ElasticSearchHandler::__construct * @covers Monolog\Handler\ElasticSearchHandler::getOptions */ public function testOptions() { $expected = array( 'index' => $this->options['index'], 'type' => $this->options['type'], 'ignore_error' => false, ); $handler = new ElasticSearchHandler($this->client, $this->options); $this->assertEquals($expected, $handler->getOptions()); } /** * @covers Monolog\Handler\ElasticSearchHandler::bulkSend * @dataProvider providerTestConnectionErrors */ public function testConnectionErrors($ignore, $expectedError) { $clientOpts = array('host' => '127.0.0.1', 'port' => 1); $client = new Client($clientOpts); $handlerOpts = array('ignore_error' => $ignore); $handler = new ElasticSearchHandler($client, $handlerOpts); if ($expectedError) { $this->setExpectedException($expectedError[0], $expectedError[1]); $handler->handle($this->getRecord()); } else { $this->assertFalse($handler->handle($this->getRecord())); } } /** * @return array */ public function providerTestConnectionErrors() { return array( array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')), array(true, false), ); } /** * Integration test using localhost Elastic Search server * * @covers Monolog\Handler\ElasticSearchHandler::__construct * @covers Monolog\Handler\ElasticSearchHandler::handleBatch * @covers Monolog\Handler\ElasticSearchHandler::bulkSend * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter */ public function testHandleIntegration() { $msg = array( 'level' => Logger::ERROR, 'level_name' => 'ERROR', 'channel' => 'meh', 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), 'datetime' => new \DateTime("@0"), 'extra' => array(), 'message' => 'log', ); $expected = $msg; $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601); $expected['context'] = array( 'class' => '[object] (stdClass: {})', 'foo' => 7, 0 => 'bar', ); $client = new Client(); $handler = new ElasticSearchHandler($client, $this->options); try { $handler->handleBatch(array($msg)); } catch (\RuntimeException $e) { $this->markTestSkipped("Cannot connect to Elastic Search server on localhost"); } // check document id from ES server response $documentId = $this->getCreatedDocId($client->getLastResponse()); $this->assertNotEmpty($documentId, 'No elastic document id received'); // retrieve document source from ES and validate $document = $this->getDocSourceFromElastic( $client, $this->options['index'], $this->options['type'], $documentId ); $this->assertEquals($expected, $document); // remove test index from ES $client->request("/{$this->options['index']}", Request::DELETE); } /** * Return last created document id from ES response * @param Response $response Elastica Response object * @return string|null */ protected function getCreatedDocId(Response $response) { $data = $response->getData(); if (!empty($data['items'][0]['create']['_id'])) { return $data['items'][0]['create']['_id']; } } /** * Retrieve document by id from Elasticsearch * @param Client $client Elastica client * @param string $index * @param string $type * @param string $documentId * @return array */ protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId) { $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET); $data = $resp->getData(); if (!empty($data['_source'])) { return $data['_source']; } return array(); } } tests/Monolog/Handler/ErrorLogHandlerTest.php000064400000004144146412134770015313 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; use Monolog\Formatter\LineFormatter; function error_log() { $GLOBALS['error_log'][] = func_get_args(); } class ErrorLogHandlerTest extends TestCase { protected function setUp() { $GLOBALS['error_log'] = array(); } /** * @covers Monolog\Handler\ErrorLogHandler::__construct * @expectedException InvalidArgumentException * @expectedExceptionMessage The given message type "42" is not supported */ public function testShouldNotAcceptAnInvalidTypeOnContructor() { new ErrorLogHandler(42); } /** * @covers Monolog\Handler\ErrorLogHandler::write */ public function testShouldLogMessagesUsingErrorLogFuncion() { $type = ErrorLogHandler::OPERATING_SYSTEM; $handler = new ErrorLogHandler($type); $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true)); $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]); $this->assertSame($GLOBALS['error_log'][0][1], $type); $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true); $handler->setFormatter(new LineFormatter(null, null, true)); $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]); $this->assertSame($GLOBALS['error_log'][1][1], $type); $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]); $this->assertSame($GLOBALS['error_log'][2][1], $type); $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]); $this->assertSame($GLOBALS['error_log'][3][1], $type); } } tests/Monolog/Handler/FilterHandlerTest.php000064400000014407146412134770015010 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\TestCase; class FilterHandlerTest extends TestCase { /** * @covers Monolog\Handler\FilterHandler::isHandling */ public function testIsHandling() { $test = new TestHandler(); $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO))); $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE))); $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING))); $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR))); $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL))); $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT))); $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY))); } /** * @covers Monolog\Handler\FilterHandler::handle * @covers Monolog\Handler\FilterHandler::setAcceptedLevels * @covers Monolog\Handler\FilterHandler::isHandling */ public function testHandleProcessOnlyNeededLevels() { $test = new TestHandler(); $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); $handler->handle($this->getRecord(Logger::DEBUG)); $this->assertFalse($test->hasDebugRecords()); $handler->handle($this->getRecord(Logger::INFO)); $this->assertTrue($test->hasInfoRecords()); $handler->handle($this->getRecord(Logger::NOTICE)); $this->assertTrue($test->hasNoticeRecords()); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertFalse($test->hasWarningRecords()); $handler->handle($this->getRecord(Logger::ERROR)); $this->assertFalse($test->hasErrorRecords()); $handler->handle($this->getRecord(Logger::CRITICAL)); $this->assertFalse($test->hasCriticalRecords()); $handler->handle($this->getRecord(Logger::ALERT)); $this->assertFalse($test->hasAlertRecords()); $handler->handle($this->getRecord(Logger::EMERGENCY)); $this->assertFalse($test->hasEmergencyRecords()); $test = new TestHandler(); $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR)); $handler->handle($this->getRecord(Logger::DEBUG)); $this->assertFalse($test->hasDebugRecords()); $handler->handle($this->getRecord(Logger::INFO)); $this->assertTrue($test->hasInfoRecords()); $handler->handle($this->getRecord(Logger::NOTICE)); $this->assertFalse($test->hasNoticeRecords()); $handler->handle($this->getRecord(Logger::ERROR)); $this->assertTrue($test->hasErrorRecords()); $handler->handle($this->getRecord(Logger::CRITICAL)); $this->assertFalse($test->hasCriticalRecords()); } /** * @covers Monolog\Handler\FilterHandler::setAcceptedLevels * @covers Monolog\Handler\FilterHandler::getAcceptedLevels */ public function testAcceptedLevelApi() { $test = new TestHandler(); $handler = new FilterHandler($test); $levels = array(Logger::INFO, Logger::ERROR); $handler->setAcceptedLevels($levels); $this->assertSame($levels, $handler->getAcceptedLevels()); $handler->setAcceptedLevels(array('info', 'error')); $this->assertSame($levels, $handler->getAcceptedLevels()); $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY); $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY); $this->assertSame($levels, $handler->getAcceptedLevels()); $handler->setAcceptedLevels('critical', 'emergency'); $this->assertSame($levels, $handler->getAcceptedLevels()); } /** * @covers Monolog\Handler\FilterHandler::handle */ public function testHandleUsesProcessors() { $test = new TestHandler(); $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY); $handler->pushProcessor( function ($record) { $record['extra']['foo'] = true; return $record; } ); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasWarningRecords()); $records = $test->getRecords(); $this->assertTrue($records[0]['extra']['foo']); } /** * @covers Monolog\Handler\FilterHandler::handle */ public function testHandleRespectsBubble() { $test = new TestHandler(); $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false); $this->assertTrue($handler->handle($this->getRecord(Logger::INFO))); $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true); $this->assertFalse($handler->handle($this->getRecord(Logger::INFO))); $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); } /** * @covers Monolog\Handler\FilterHandler::handle */ public function testHandleWithCallback() { $test = new TestHandler(); $handler = new FilterHandler( function ($record, $handler) use ($test) { return $test; }, Logger::INFO, Logger::NOTICE, false ); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $this->assertFalse($test->hasDebugRecords()); $this->assertTrue($test->hasInfoRecords()); } /** * @covers Monolog\Handler\FilterHandler::handle * @expectedException \RuntimeException */ public function testHandleWithBadCallbackThrowsException() { $handler = new FilterHandler( function ($record, $handler) { return 'foo'; } ); $handler->handle($this->getRecord(Logger::WARNING)); } } tests/Monolog/Handler/FingersCrossedHandlerTest.php000064400000022233146412134770016477 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy; use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy; class FingersCrossedHandlerTest extends TestCase { /** * @covers Monolog\Handler\FingersCrossedHandler::__construct * @covers Monolog\Handler\FingersCrossedHandler::handle */ public function testHandleBuffers() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $this->assertFalse($test->hasDebugRecords()); $this->assertFalse($test->hasInfoRecords()); $handler->handle($this->getRecord(Logger::WARNING)); $handler->close(); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue(count($test->getRecords()) === 3); } /** * @covers Monolog\Handler\FingersCrossedHandler::handle */ public function testHandleStopsBufferingAfterTrigger() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test); $handler->handle($this->getRecord(Logger::WARNING)); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->close(); $this->assertTrue($test->hasWarningRecords()); $this->assertTrue($test->hasDebugRecords()); } /** * @covers Monolog\Handler\FingersCrossedHandler::handle * @covers Monolog\Handler\FingersCrossedHandler::reset */ public function testHandleRestartBufferingAfterReset() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test); $handler->handle($this->getRecord(Logger::WARNING)); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->reset(); $handler->handle($this->getRecord(Logger::INFO)); $handler->close(); $this->assertTrue($test->hasWarningRecords()); $this->assertTrue($test->hasDebugRecords()); $this->assertFalse($test->hasInfoRecords()); } /** * @covers Monolog\Handler\FingersCrossedHandler::handle */ public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::WARNING)); $handler->handle($this->getRecord(Logger::INFO)); $handler->close(); $this->assertTrue($test->hasWarningRecords()); $this->assertTrue($test->hasDebugRecords()); $this->assertFalse($test->hasInfoRecords()); } /** * @covers Monolog\Handler\FingersCrossedHandler::handle */ public function testHandleBufferLimit() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, Logger::WARNING, 2); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasWarningRecords()); $this->assertTrue($test->hasInfoRecords()); $this->assertFalse($test->hasDebugRecords()); } /** * @covers Monolog\Handler\FingersCrossedHandler::handle */ public function testHandleWithCallback() { $test = new TestHandler(); $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) { return $test; }); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $this->assertFalse($test->hasDebugRecords()); $this->assertFalse($test->hasInfoRecords()); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue(count($test->getRecords()) === 3); } /** * @covers Monolog\Handler\FingersCrossedHandler::handle * @expectedException RuntimeException */ public function testHandleWithBadCallbackThrowsException() { $handler = new FingersCrossedHandler(function ($record, $handler) { return 'foo'; }); $handler->handle($this->getRecord(Logger::WARNING)); } /** * @covers Monolog\Handler\FingersCrossedHandler::isHandling */ public function testIsHandlingAlways() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, Logger::ERROR); $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); } /** * @covers Monolog\Handler\FingersCrossedHandler::__construct * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated */ public function testErrorLevelActivationStrategy() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING)); $handler->handle($this->getRecord(Logger::DEBUG)); $this->assertFalse($test->hasDebugRecords()); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasWarningRecords()); } /** * @covers Monolog\Handler\FingersCrossedHandler::__construct * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated */ public function testErrorLevelActivationStrategyWithPsrLevel() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning')); $handler->handle($this->getRecord(Logger::DEBUG)); $this->assertFalse($test->hasDebugRecords()); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasWarningRecords()); } /** * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated */ public function testChannelLevelActivationStrategy() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG))); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertFalse($test->hasWarningRecords()); $record = $this->getRecord(Logger::DEBUG); $record['channel'] = 'othertest'; $handler->handle($record); $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasWarningRecords()); } /** * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated */ public function testChannelLevelActivationStrategyWithPsrLevels() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug'))); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertFalse($test->hasWarningRecords()); $record = $this->getRecord(Logger::DEBUG); $record['channel'] = 'othertest'; $handler->handle($record); $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasWarningRecords()); } /** * @covers Monolog\Handler\FingersCrossedHandler::handle */ public function testHandleUsesProcessors() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, Logger::INFO); $handler->pushProcessor(function ($record) { $record['extra']['foo'] = true; return $record; }); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasWarningRecords()); $records = $test->getRecords(); $this->assertTrue($records[0]['extra']['foo']); } /** * @covers Monolog\Handler\FingersCrossedHandler::close */ public function testPassthruOnClose() { $test = new TestHandler(); $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); $handler->close(); $this->assertFalse($test->hasDebugRecords()); $this->assertTrue($test->hasInfoRecords()); } } tests/Monolog/Handler/FirePHPHandlerTest.php000064400000005617146412134770015023 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @covers Monolog\Handler\FirePHPHandler */ class FirePHPHandlerTest extends TestCase { public function setUp() { TestFirePHPHandler::reset(); $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0'; } public function testHeaders() { $handler = new TestFirePHPHandler; $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::WARNING)); $expected = array( 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', 'X-Wf-1-1-1-1' => 'test', 'X-Wf-1-1-1-2' => 'test', ); $this->assertEquals($expected, $handler->getHeaders()); } public function testConcurrentHandlers() { $handler = new TestFirePHPHandler; $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::WARNING)); $handler2 = new TestFirePHPHandler; $handler2->setFormatter($this->getIdentityFormatter()); $handler2->handle($this->getRecord(Logger::DEBUG)); $handler2->handle($this->getRecord(Logger::WARNING)); $expected = array( 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', 'X-Wf-1-1-1-1' => 'test', 'X-Wf-1-1-1-2' => 'test', ); $expected2 = array( 'X-Wf-1-1-1-3' => 'test', 'X-Wf-1-1-1-4' => 'test', ); $this->assertEquals($expected, $handler->getHeaders()); $this->assertEquals($expected2, $handler2->getHeaders()); } } class TestFirePHPHandler extends FirePHPHandler { protected $headers = array(); public static function reset() { self::$initialized = false; self::$sendHeaders = true; self::$messageIndex = 1; } protected function sendHeader($header, $content) { $this->headers[$header] = $content; } public function getHeaders() { return $this->headers; } } tests/Monolog/Handler/Fixtures/.gitkeep000064400000000000146412134770014136 0ustar00tests/Monolog/Handler/FleepHookHandlerTest.php000064400000004304146412134770015432 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\LineFormatter; use Monolog\Logger; use Monolog\TestCase; /** * @coversDefaultClass \Monolog\Handler\FleepHookHandler */ class FleepHookHandlerTest extends TestCase { /** * Default token to use in tests */ const TOKEN = '123abc'; /** * @var FleepHookHandler */ private $handler; public function setUp() { parent::setUp(); if (!extension_loaded('openssl')) { $this->markTestSkipped('This test requires openssl extension to run'); } // Create instances of the handler and logger for convenience $this->handler = new FleepHookHandler(self::TOKEN); } /** * @covers ::__construct */ public function testConstructorSetsExpectedDefaults() { $this->assertEquals(Logger::DEBUG, $this->handler->getLevel()); $this->assertEquals(true, $this->handler->getBubble()); } /** * @covers ::getDefaultFormatter */ public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays() { $record = array( 'message' => 'msg', 'context' => array(), 'level' => Logger::DEBUG, 'level_name' => Logger::getLevelName(Logger::DEBUG), 'channel' => 'channel', 'datetime' => new \DateTime(), 'extra' => array(), ); $expectedFormatter = new LineFormatter(null, null, true, true); $expected = $expectedFormatter->format($record); $handlerFormatter = $this->handler->getFormatter(); $actual = $handlerFormatter->format($record); $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered'); } /** * @covers ::__construct */ public function testConnectionStringisConstructedCorrectly() { $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString()); } } tests/Monolog/Handler/FlowdockHandlerTest.php000064400000005043146412134770015327 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Formatter\FlowdockFormatter; use Monolog\TestCase; use Monolog\Logger; /** * @author Dominik Liebler * @see https://www.hipchat.com/docs/api */ class FlowdockHandlerTest extends TestCase { /** * @var resource */ private $res; /** * @var FlowdockHandler */ private $handler; public function setUp() { if (!extension_loaded('openssl')) { $this->markTestSkipped('This test requires openssl to run'); } } public function testWriteHeader() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); return $content; } /** * @depends testWriteHeader */ public function testWriteContent($content) { $this->assertRegexp('/"source":"test_source"/', $content); $this->assertRegexp('/"from_address":"source@test\.com"/', $content); } private function createHandler($token = 'myToken') { $constructorArgs = array($token, Logger::DEBUG); $this->res = fopen('php://memory', 'a'); $this->handler = $this->getMock( '\Monolog\Handler\FlowdockHandler', array('fsockopen', 'streamSetTimeout', 'closeSocket'), $constructorArgs ); $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); $reflectionProperty->setAccessible(true); $reflectionProperty->setValue($this->handler, 'localhost:1234'); $this->handler->expects($this->any()) ->method('fsockopen') ->will($this->returnValue($this->res)); $this->handler->expects($this->any()) ->method('streamSetTimeout') ->will($this->returnValue(true)); $this->handler->expects($this->any()) ->method('closeSocket') ->will($this->returnValue(true)); $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com')); } } tests/Monolog/Handler/GelfHandlerLegacyTest.php000064400000006062146412134770015563 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Gelf\Message; use Monolog\TestCase; use Monolog\Logger; use Monolog\Formatter\GelfMessageFormatter; class GelfHandlerLegacyTest extends TestCase { public function setUp() { if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) { $this->markTestSkipped("mlehner/gelf-php not installed"); } } /** * @covers Monolog\Handler\GelfHandler::__construct */ public function testConstruct() { $handler = new GelfHandler($this->getMessagePublisher()); $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); } protected function getHandler($messagePublisher) { $handler = new GelfHandler($messagePublisher); return $handler; } protected function getMessagePublisher() { return new MockMessagePublisher('localhost'); } public function testDebug() { $messagePublisher = $this->getMessagePublisher(); $handler = $this->getHandler($messagePublisher); $record = $this->getRecord(Logger::DEBUG, "A test debug message"); $handler->handle($record); $this->assertEquals(7, $messagePublisher->lastMessage->getLevel()); $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); } public function testWarning() { $messagePublisher = $this->getMessagePublisher(); $handler = $this->getHandler($messagePublisher); $record = $this->getRecord(Logger::WARNING, "A test warning message"); $handler->handle($record); $this->assertEquals(4, $messagePublisher->lastMessage->getLevel()); $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); } public function testInjectedGelfMessageFormatter() { $messagePublisher = $this->getMessagePublisher(); $handler = $this->getHandler($messagePublisher); $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); $record = $this->getRecord(Logger::WARNING, "A test warning message"); $record['extra']['blarg'] = 'yep'; $record['context']['from'] = 'logger'; $handler->handle($record); $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost()); $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray()); $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray()); } } tests/Monolog/Handler/GelfHandlerTest.php000064400000006475146412134770014446 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Gelf\Message; use Monolog\TestCase; use Monolog\Logger; use Monolog\Formatter\GelfMessageFormatter; class GelfHandlerTest extends TestCase { public function setUp() { if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) { $this->markTestSkipped("graylog2/gelf-php not installed"); } } /** * @covers Monolog\Handler\GelfHandler::__construct */ public function testConstruct() { $handler = new GelfHandler($this->getMessagePublisher()); $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); } protected function getHandler($messagePublisher) { $handler = new GelfHandler($messagePublisher); return $handler; } protected function getMessagePublisher() { return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false); } public function testDebug() { $record = $this->getRecord(Logger::DEBUG, "A test debug message"); $expectedMessage = new Message(); $expectedMessage ->setLevel(7) ->setFacility("test") ->setShortMessage($record['message']) ->setTimestamp($record['datetime']) ; $messagePublisher = $this->getMessagePublisher(); $messagePublisher->expects($this->once()) ->method('publish') ->with($expectedMessage); $handler = $this->getHandler($messagePublisher); $handler->handle($record); } public function testWarning() { $record = $this->getRecord(Logger::WARNING, "A test warning message"); $expectedMessage = new Message(); $expectedMessage ->setLevel(4) ->setFacility("test") ->setShortMessage($record['message']) ->setTimestamp($record['datetime']) ; $messagePublisher = $this->getMessagePublisher(); $messagePublisher->expects($this->once()) ->method('publish') ->with($expectedMessage); $handler = $this->getHandler($messagePublisher); $handler->handle($record); } public function testInjectedGelfMessageFormatter() { $record = $this->getRecord(Logger::WARNING, "A test warning message"); $record['extra']['blarg'] = 'yep'; $record['context']['from'] = 'logger'; $expectedMessage = new Message(); $expectedMessage ->setLevel(4) ->setFacility("test") ->setHost("mysystem") ->setShortMessage($record['message']) ->setTimestamp($record['datetime']) ->setAdditional("EXTblarg", 'yep') ->setAdditional("CTXfrom", 'logger') ; $messagePublisher = $this->getMessagePublisher(); $messagePublisher->expects($this->once()) ->method('publish') ->with($expectedMessage); $handler = $this->getHandler($messagePublisher); $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); $handler->handle($record); } } tests/Monolog/Handler/GroupHandlerTest.php000064400000005527146412134770014662 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class GroupHandlerTest extends TestCase { /** * @covers Monolog\Handler\GroupHandler::__construct * @expectedException InvalidArgumentException */ public function testConstructorOnlyTakesHandler() { new GroupHandler(array(new TestHandler(), "foo")); } /** * @covers Monolog\Handler\GroupHandler::__construct * @covers Monolog\Handler\GroupHandler::handle */ public function testHandle() { $testHandlers = array(new TestHandler(), new TestHandler()); $handler = new GroupHandler($testHandlers); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); foreach ($testHandlers as $test) { $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue(count($test->getRecords()) === 2); } } /** * @covers Monolog\Handler\GroupHandler::handleBatch */ public function testHandleBatch() { $testHandlers = array(new TestHandler(), new TestHandler()); $handler = new GroupHandler($testHandlers); $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); foreach ($testHandlers as $test) { $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue(count($test->getRecords()) === 2); } } /** * @covers Monolog\Handler\GroupHandler::isHandling */ public function testIsHandling() { $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); $handler = new GroupHandler($testHandlers); $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); } /** * @covers Monolog\Handler\GroupHandler::handle */ public function testHandleUsesProcessors() { $test = new TestHandler(); $handler = new GroupHandler(array($test)); $handler->pushProcessor(function ($record) { $record['extra']['foo'] = true; return $record; }); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasWarningRecords()); $records = $test->getRecords(); $this->assertTrue($records[0]['extra']['foo']); } } tests/Monolog/Handler/HipChatHandlerTest.php000064400000013425146412134770015102 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @author Rafael Dohms * @see https://www.hipchat.com/docs/api */ class HipChatHandlerTest extends TestCase { private $res; private $handler; public function testWriteHeader() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); return $content; } /** * @depends testWriteHeader */ public function testWriteContent($content) { $this->assertRegexp('/from=Monolog&room_id=room1¬ify=0&message=test1&message_format=text&color=red$/', $content); } public function testWriteWithComplexMessage() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); } /** * @dataProvider provideLevelColors */ public function testWriteWithErrorLevelsAndColors($level, $expectedColor) { $this->createHandler(); $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/color='.$expectedColor.'/', $content); } public function provideLevelColors() { return array( array(Logger::DEBUG, 'gray'), array(Logger::INFO, 'green'), array(Logger::WARNING, 'yellow'), array(Logger::ERROR, 'red'), array(Logger::CRITICAL, 'red'), array(Logger::ALERT, 'red'), array(Logger::EMERGENCY,'red'), array(Logger::NOTICE, 'green'), ); } /** * @dataProvider provideBatchRecords */ public function testHandleBatch($records, $expectedColor) { $this->createHandler(); $this->handler->handleBatch($records); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/color='.$expectedColor.'/', $content); } public function provideBatchRecords() { return array( array( array( array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime()) ), 'red', ), array( array( array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), ), 'yellow', ), array( array( array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), ), 'green', ), array( array( array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), ), 'gray', ), ); } private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false) { $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG); $this->res = fopen('php://memory', 'a'); $this->handler = $this->getMock( '\Monolog\Handler\HipChatHandler', array('fsockopen', 'streamSetTimeout', 'closeSocket'), $constructorArgs ); $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); $reflectionProperty->setAccessible(true); $reflectionProperty->setValue($this->handler, 'localhost:1234'); $this->handler->expects($this->any()) ->method('fsockopen') ->will($this->returnValue($this->res)); $this->handler->expects($this->any()) ->method('streamSetTimeout') ->will($this->returnValue(true)); $this->handler->expects($this->any()) ->method('closeSocket') ->will($this->returnValue(true)); $this->handler->setFormatter($this->getIdentityFormatter()); } /** * @expectedException InvalidArgumentException */ public function testCreateWithTooLongName() { $hipChatHandler = new \Monolog\Handler\HipChatHandler('token', 'room', 'SixteenCharsHere'); } } tests/Monolog/Handler/LogEntriesHandlerTest.php000064400000004536146412134770015640 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @author Robert Kaufmann III */ class LogEntriesHandlerTest extends TestCase { /** * @var resource */ private $res; /** * @var LogEntriesHandler */ private $handler; public function testWriteContent() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content); } public function testWriteBatchContent() { $records = array( $this->getRecord(), $this->getRecord(), $this->getRecord() ); $this->createHandler(); $this->handler->handleBatch($records); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content); } private function createHandler() { $useSSL = extension_loaded('openssl'); $args = array('testToken', $useSSL, Logger::DEBUG, true); $this->res = fopen('php://memory', 'a'); $this->handler = $this->getMock( '\Monolog\Handler\LogEntriesHandler', array('fsockopen', 'streamSetTimeout', 'closeSocket'), $args ); $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); $reflectionProperty->setAccessible(true); $reflectionProperty->setValue($this->handler, 'localhost:1234'); $this->handler->expects($this->any()) ->method('fsockopen') ->will($this->returnValue($this->res)); $this->handler->expects($this->any()) ->method('streamSetTimeout') ->will($this->returnValue(true)); $this->handler->expects($this->any()) ->method('closeSocket') ->will($this->returnValue(true)); } } tests/Monolog/Handler/MailHandlerTest.php000064400000004233146412134770014441 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; use Monolog\TestCase; class MailHandlerTest extends TestCase { /** * @covers Monolog\Handler\MailHandler::handleBatch */ public function testHandleBatch() { $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); $formatter->expects($this->once()) ->method('formatBatch'); // Each record is formatted $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); $handler->expects($this->once()) ->method('send'); $handler->expects($this->never()) ->method('write'); // write is for individual records $handler->setFormatter($formatter); $handler->handleBatch($this->getMultipleRecords()); } /** * @covers Monolog\Handler\MailHandler::handleBatch */ public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel() { $records = array( $this->getRecord(Logger::DEBUG, 'debug message 1'), $this->getRecord(Logger::DEBUG, 'debug message 2'), $this->getRecord(Logger::INFO, 'information'), ); $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); $handler->expects($this->never()) ->method('send'); $handler->setLevel(Logger::ERROR); $handler->handleBatch($records); } /** * @covers Monolog\Handler\MailHandler::write */ public function testHandle() { $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); $record = $this->getRecord(); $records = array($record); $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n"; $handler->expects($this->once()) ->method('send') ->with($records[0]['formatted'], $records); $handler->handle($record); } } tests/Monolog/Handler/MockRavenClient.php000064400000001001146412134770014433 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Raven_Client; class MockRavenClient extends Raven_Client { public function capture($data, $stack, $vars = null) { $this->lastData = $data; $this->lastStack = $stack; } public $lastData; public $lastStack; } tests/Monolog/Handler/MongoDBHandlerTest.php000064400000003305146412134770015043 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class MongoDBHandlerTest extends TestCase { /** * @expectedException InvalidArgumentException */ public function testConstructorShouldThrowExceptionForInvalidMongo() { new MongoDBHandler(new \stdClass(), 'DB', 'Collection'); } public function testHandle() { $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false); $collection = $this->getMock('stdClass', array('save')); $mongo->expects($this->once()) ->method('selectCollection') ->with('DB', 'Collection') ->will($this->returnValue($collection)); $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); $expected = array( 'message' => 'test', 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), 'level' => Logger::WARNING, 'level_name' => 'WARNING', 'channel' => 'test', 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), 'extra' => array(), ); $collection->expects($this->once()) ->method('save') ->with($expected); $handler = new MongoDBHandler($mongo, 'DB', 'Collection'); $handler->handle($record); } } if (!class_exists('Mongo')) { class Mongo { public function selectCollection() {} } } tests/Monolog/Handler/NativeMailerHandlerTest.php000064400000002337146412134770016142 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; class NativeMailerHandlerTest extends TestCase { /** * @expectedException InvalidArgumentException */ public function testConstructorHeaderInjection() { $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org"); } /** * @expectedException InvalidArgumentException */ public function testSetterHeaderInjection() { $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org"); } /** * @expectedException InvalidArgumentException */ public function testSetterArrayHeaderInjection() { $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org")); } } tests/Monolog/Handler/NewRelicHandlerTest.php000064400000006757146412134770015304 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class NewRelicHandlerTest extends TestCase { public static $appname; public static $customParameters; public function setUp() { self::$appname = null; self::$customParameters = array(); } /** * @expectedException Monolog\Handler\MissingExtensionException */ public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded() { $handler = new StubNewRelicHandlerWithoutExtension(); $handler->handle($this->getRecord(Logger::ERROR)); } public function testThehandlerCanHandleTheRecord() { $handler = new StubNewRelicHandler(); $handler->handle($this->getRecord(Logger::ERROR)); } public function testThehandlerCanAddContextParamsToTheNewRelicTrace() { $handler = new StubNewRelicHandler(); $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'))); $this->assertEquals(array('context_a' => 'b'), self::$customParameters); } public function testThehandlerCanAddExtraParamsToTheNewRelicTrace() { $record = $this->getRecord(Logger::ERROR, 'log message'); $record['extra'] = array('c' => 'd'); $handler = new StubNewRelicHandler(); $handler->handle($record); $this->assertEquals(array('extra_c' => 'd'), self::$customParameters); } public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace() { $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')); $record['extra'] = array('c' => 'd'); $handler = new StubNewRelicHandler(); $handler->handle($record); $expected = array( 'context_a' => 'b', 'extra_c' => 'd', ); $this->assertEquals($expected, self::$customParameters); } public function testTheAppNameIsNullByDefault() { $handler = new StubNewRelicHandler(); $handler->handle($this->getRecord(Logger::ERROR, 'log message')); $this->assertEquals(null, self::$appname); } public function testTheAppNameCanBeInjectedFromtheConstructor() { $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); $handler->handle($this->getRecord(Logger::ERROR, 'log message')); $this->assertEquals('myAppName', self::$appname); } public function testTheAppNameCanBeOverriddenFromEachLog() { $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName'))); $this->assertEquals('logAppName', self::$appname); } } class StubNewRelicHandlerWithoutExtension extends NewRelicHandler { protected function isNewRelicEnabled() { return false; } } class StubNewRelicHandler extends NewRelicHandler { protected function isNewRelicEnabled() { return true; } } function newrelic_notice_error() { return true; } function newrelic_set_appname($appname) { return NewRelicHandlerTest::$appname = $appname; } function newrelic_add_custom_parameter($key, $value) { NewRelicHandlerTest::$customParameters[$key] = $value; return true; } tests/Monolog/Handler/NullHandlerTest.php000064400000001353146412134770014471 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @covers Monolog\Handler\NullHandler::handle */ class NullHandlerTest extends TestCase { public function testHandle() { $handler = new NullHandler(); $this->assertTrue($handler->handle($this->getRecord())); } public function testHandleLowerLevelRecord() { $handler = new NullHandler(Logger::WARNING); $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); } } tests/Monolog/Handler/PushoverHandlerTest.php000064400000012226146412134770015373 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * Almost all examples (expected header, titles, messages) taken from * https://www.pushover.net/api * @author Sebastian Göttschkes * @see https://www.pushover.net/api */ class PushoverHandlerTest extends TestCase { private $res; private $handler; public function testWriteHeader() { $this->createHandler(); $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); return $content; } /** * @depends testWriteHeader */ public function testWriteContent($content) { $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}$/', $content); } public function testWriteWithComplexTitle() { $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1', Logger::EMERGENCY); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content); } public function testWriteWithComplexMessage() { $this->createHandler(); $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); } public function testWriteWithTooLongMessage() { $message = str_pad('test', 520, 'a'); $this->createHandler(); $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications $this->handler->handle($this->getRecord(Logger::CRITICAL, $message)); fseek($this->res, 0); $content = fread($this->res, 1024); $expectedMessage = substr($message, 0, 505); $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content); } public function testWriteWithHighPriority() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=1$/', $content); } public function testWriteWithEmergencyPriority() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); } public function testWriteToMultipleUsers() { $this->createHandler('myToken', array('userA', 'userB')); $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content); $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); } private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog') { $constructorArgs = array($token, $user, $title); $this->res = fopen('php://memory', 'a'); $this->handler = $this->getMock( '\Monolog\Handler\PushoverHandler', array('fsockopen', 'streamSetTimeout', 'closeSocket'), $constructorArgs ); $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); $reflectionProperty->setAccessible(true); $reflectionProperty->setValue($this->handler, 'localhost:1234'); $this->handler->expects($this->any()) ->method('fsockopen') ->will($this->returnValue($this->res)); $this->handler->expects($this->any()) ->method('streamSetTimeout') ->will($this->returnValue(true)); $this->handler->expects($this->any()) ->method('closeSocket') ->will($this->returnValue(true)); $this->handler->setFormatter($this->getIdentityFormatter()); } } tests/Monolog/Handler/RavenHandlerTest.php000064400000011202146412134770014624 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; use Monolog\Formatter\LineFormatter; class RavenHandlerTest extends TestCase { public function setUp() { if (!class_exists("Raven_Client")) { $this->markTestSkipped("raven/raven not installed"); } require_once __DIR__ . '/MockRavenClient.php'; } /** * @covers Monolog\Handler\RavenHandler::__construct */ public function testConstruct() { $handler = new RavenHandler($this->getRavenClient()); $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler); } protected function getHandler($ravenClient) { $handler = new RavenHandler($ravenClient); return $handler; } protected function getRavenClient() { $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1'; return new MockRavenClient($dsn); } public function testDebug() { $ravenClient = $this->getRavenClient(); $handler = $this->getHandler($ravenClient); $record = $this->getRecord(Logger::DEBUG, "A test debug message"); $handler->handle($record); $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']); $this->assertContains($record['message'], $ravenClient->lastData['message']); } public function testWarning() { $ravenClient = $this->getRavenClient(); $handler = $this->getHandler($ravenClient); $record = $this->getRecord(Logger::WARNING, "A test warning message"); $handler->handle($record); $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']); $this->assertContains($record['message'], $ravenClient->lastData['message']); } public function testTag() { $ravenClient = $this->getRavenClient(); $handler = $this->getHandler($ravenClient); $tags = array(1, 2, 'foo'); $record = $this->getRecord(Logger::INFO, "test", array('tags' => $tags)); $handler->handle($record); $this->assertEquals($tags, $ravenClient->lastData['tags']); } public function testException() { $ravenClient = $this->getRavenClient(); $handler = $this->getHandler($ravenClient); try { $this->methodThatThrowsAnException(); } catch (\Exception $e) { $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e)); $handler->handle($record); } $this->assertEquals($record['message'], $ravenClient->lastData['message']); } public function testHandleBatch() { $records = $this->getMultipleRecords(); $records[] = $this->getRecord(Logger::WARNING, 'warning'); $records[] = $this->getRecord(Logger::WARNING, 'warning'); $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); $logFormatter->expects($this->once())->method('formatBatch'); $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) { return $record['level'] == 400; })); $handler = $this->getHandler($this->getRavenClient()); $handler->setBatchFormatter($logFormatter); $handler->setFormatter($formatter); $handler->handleBatch($records); } public function testHandleBatchDoNothingIfRecordsAreBelowLevel() { $records = array( $this->getRecord(Logger::DEBUG, 'debug message 1'), $this->getRecord(Logger::DEBUG, 'debug message 2'), $this->getRecord(Logger::INFO, 'information'), ); $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient())); $handler->expects($this->never())->method('handle'); $handler->setLevel(Logger::ERROR); $handler->handleBatch($records); } public function testGetSetBatchFormatter() { $ravenClient = $this->getRavenClient(); $handler = $this->getHandler($ravenClient); $handler->setBatchFormatter($formatter = new LineFormatter()); $this->assertSame($formatter, $handler->getBatchFormatter()); } private function methodThatThrowsAnException() { throw new \Exception('This is an exception'); } } tests/Monolog/Handler/RedisHandlerTest.php000064400000003766146412134770014637 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; use Monolog\Formatter\LineFormatter; class RedisHandlerTest extends TestCase { /** * @expectedException InvalidArgumentException */ public function testConstructorShouldThrowExceptionForInvalidRedis() { new RedisHandler(new \stdClass(), 'key'); } public function testConstructorShouldWorkWithPredis() { $redis = $this->getMock('Predis\Client'); $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); } public function testConstructorShouldWorkWithRedis() { $redis = $this->getMock('Redis'); $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); } public function testPredisHandle() { $redis = $this->getMock('Predis\Client', array('rpush')); // Predis\Client uses rpush $redis->expects($this->once()) ->method('rpush') ->with('key', 'test'); $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); $handler = new RedisHandler($redis, 'key'); $handler->setFormatter(new LineFormatter("%message%")); $handler->handle($record); } public function testRedisHandle() { $redis = $this->getMock('Redis', array('rpush')); // Redis uses rPush $redis->expects($this->once()) ->method('rPush') ->with('key', 'test'); $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); $handler = new RedisHandler($redis, 'key'); $handler->setFormatter(new LineFormatter("%message%")); $handler->handle($record); } } tests/Monolog/Handler/RotatingFileHandlerTest.php000064400000006071146412134770016150 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; /** * @covers Monolog\Handler\RotatingFileHandler */ class RotatingFileHandlerTest extends TestCase { public function setUp() { $dir = __DIR__.'/Fixtures'; chmod($dir, 0777); if (!is_writable($dir)) { $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.'); } } public function testRotationCreatesNewFile() { touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot'); $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord()); $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; $this->assertTrue(file_exists($log)); $this->assertEquals('test', file_get_contents($log)); } /** * @dataProvider rotationTests */ public function testRotation($createFile) { touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot'); touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot'); touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot'); touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot'); $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; if ($createFile) { touch($log); } $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord()); $handler->close(); $this->assertTrue(file_exists($log)); $this->assertTrue(file_exists($old1)); $this->assertEquals($createFile, file_exists($old2)); $this->assertEquals($createFile, file_exists($old3)); $this->assertEquals($createFile, file_exists($old4)); $this->assertEquals('test', file_get_contents($log)); } public function rotationTests() { return array( 'Rotation is triggered when the file of the current day is not present' => array(true), 'Rotation is not triggered when the file is already present' => array(false), ); } public function testReuseCurrentFile() { $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; file_put_contents($log, "foo"); $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord()); $this->assertEquals('footest', file_get_contents($log)); } public function tearDown() { foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) { unlink($file); } } } tests/Monolog/Handler/SlackHandlerTest.php000064400000010331146412134770014610 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @author Greg Kedzierski * @see https://api.slack.com/ */ class SlackHandlerTest extends TestCase { /** * @var resource */ private $res; /** * @var SlackHandler */ private $handler; public function setUp() { if (!extension_loaded('openssl')) { $this->markTestSkipped('This test requires openssl to run'); } } public function testWriteHeader() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); } public function testWriteContent() { $this->createHandler(); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/token=myToken&channel=channel1&username=Monolog&text=&attachments=.*$/', $content); } public function testWriteContentWithEmoji() { $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien'); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/icon_emoji=%3Aalien%3A$/', $content); } /** * @dataProvider provideLevelColors */ public function testWriteContentWithColors($level, $expectedColor) { $this->createHandler(); $this->handler->handle($this->getRecord($level, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/color%22%3A%22'.$expectedColor.'/', $content); } public function testWriteContentWithPlainTextMessage() { $this->createHandler('myToken', 'channel1', 'Monolog', false); $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); fseek($this->res, 0); $content = fread($this->res, 1024); $this->assertRegexp('/text=test1/', $content); } public function provideLevelColors() { return array( array(Logger::DEBUG, '%23e3e4e6'), // escaped #e3e4e6 array(Logger::INFO, 'good'), array(Logger::NOTICE, 'good'), array(Logger::WARNING, 'warning'), array(Logger::ERROR, 'danger'), array(Logger::CRITICAL, 'danger'), array(Logger::ALERT, 'danger'), array(Logger::EMERGENCY,'danger'), ); } private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null) { $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true); $this->res = fopen('php://memory', 'a'); $this->handler = $this->getMock( '\Monolog\Handler\SlackHandler', array('fsockopen', 'streamSetTimeout', 'closeSocket'), $constructorArgs ); $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); $reflectionProperty->setAccessible(true); $reflectionProperty->setValue($this->handler, 'localhost:1234'); $this->handler->expects($this->any()) ->method('fsockopen') ->will($this->returnValue($this->res)); $this->handler->expects($this->any()) ->method('streamSetTimeout') ->will($this->returnValue(true)); $this->handler->expects($this->any()) ->method('closeSocket') ->will($this->returnValue(true)); $this->handler->setFormatter($this->getIdentityFormatter()); } } tests/Monolog/Handler/SocketHandlerTest.php000064400000017303146412134770015011 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @author Pablo de Leon Belloc */ class SocketHandlerTest extends TestCase { /** * @var Monolog\Handler\SocketHandler */ private $handler; /** * @var resource */ private $res; /** * @expectedException UnexpectedValueException */ public function testInvalidHostname() { $this->createHandler('garbage://here'); $this->writeRecord('data'); } /** * @expectedException \InvalidArgumentException */ public function testBadConnectionTimeout() { $this->createHandler('localhost:1234'); $this->handler->setConnectionTimeout(-1); } public function testSetConnectionTimeout() { $this->createHandler('localhost:1234'); $this->handler->setConnectionTimeout(10.1); $this->assertEquals(10.1, $this->handler->getConnectionTimeout()); } /** * @expectedException \InvalidArgumentException */ public function testBadTimeout() { $this->createHandler('localhost:1234'); $this->handler->setTimeout(-1); } public function testSetTimeout() { $this->createHandler('localhost:1234'); $this->handler->setTimeout(10.25); $this->assertEquals(10.25, $this->handler->getTimeout()); } public function testSetConnectionString() { $this->createHandler('tcp://localhost:9090'); $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString()); } /** * @expectedException UnexpectedValueException */ public function testExceptionIsThrownOnFsockopenError() { $this->setMockHandler(array('fsockopen')); $this->handler->expects($this->once()) ->method('fsockopen') ->will($this->returnValue(false)); $this->writeRecord('Hello world'); } /** * @expectedException UnexpectedValueException */ public function testExceptionIsThrownOnPfsockopenError() { $this->setMockHandler(array('pfsockopen')); $this->handler->expects($this->once()) ->method('pfsockopen') ->will($this->returnValue(false)); $this->handler->setPersistent(true); $this->writeRecord('Hello world'); } /** * @expectedException UnexpectedValueException */ public function testExceptionIsThrownIfCannotSetTimeout() { $this->setMockHandler(array('streamSetTimeout')); $this->handler->expects($this->once()) ->method('streamSetTimeout') ->will($this->returnValue(false)); $this->writeRecord('Hello world'); } /** * @expectedException RuntimeException */ public function testWriteFailsOnIfFwriteReturnsFalse() { $this->setMockHandler(array('fwrite')); $callback = function ($arg) { $map = array( 'Hello world' => 6, 'world' => false, ); return $map[$arg]; }; $this->handler->expects($this->exactly(2)) ->method('fwrite') ->will($this->returnCallback($callback)); $this->writeRecord('Hello world'); } /** * @expectedException RuntimeException */ public function testWriteFailsIfStreamTimesOut() { $this->setMockHandler(array('fwrite', 'streamGetMetadata')); $callback = function ($arg) { $map = array( 'Hello world' => 6, 'world' => 5, ); return $map[$arg]; }; $this->handler->expects($this->exactly(1)) ->method('fwrite') ->will($this->returnCallback($callback)); $this->handler->expects($this->exactly(1)) ->method('streamGetMetadata') ->will($this->returnValue(array('timed_out' => true))); $this->writeRecord('Hello world'); } /** * @expectedException RuntimeException */ public function testWriteFailsOnIncompleteWrite() { $this->setMockHandler(array('fwrite', 'streamGetMetadata')); $res = $this->res; $callback = function ($string) use ($res) { fclose($res); return strlen('Hello'); }; $this->handler->expects($this->exactly(1)) ->method('fwrite') ->will($this->returnCallback($callback)); $this->handler->expects($this->exactly(1)) ->method('streamGetMetadata') ->will($this->returnValue(array('timed_out' => false))); $this->writeRecord('Hello world'); } public function testWriteWithMemoryFile() { $this->setMockHandler(); $this->writeRecord('test1'); $this->writeRecord('test2'); $this->writeRecord('test3'); fseek($this->res, 0); $this->assertEquals('test1test2test3', fread($this->res, 1024)); } public function testWriteWithMock() { $this->setMockHandler(array('fwrite')); $callback = function ($arg) { $map = array( 'Hello world' => 6, 'world' => 5, ); return $map[$arg]; }; $this->handler->expects($this->exactly(2)) ->method('fwrite') ->will($this->returnCallback($callback)); $this->writeRecord('Hello world'); } public function testClose() { $this->setMockHandler(); $this->writeRecord('Hello world'); $this->assertInternalType('resource', $this->res); $this->handler->close(); $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler"); } public function testCloseDoesNotClosePersistentSocket() { $this->setMockHandler(); $this->handler->setPersistent(true); $this->writeRecord('Hello world'); $this->assertTrue(is_resource($this->res)); $this->handler->close(); $this->assertTrue(is_resource($this->res)); } private function createHandler($connectionString) { $this->handler = new SocketHandler($connectionString); $this->handler->setFormatter($this->getIdentityFormatter()); } private function writeRecord($string) { $this->handler->handle($this->getRecord(Logger::WARNING, $string)); } private function setMockHandler(array $methods = array()) { $this->res = fopen('php://memory', 'a'); $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout'); $newMethods = array_diff($methods, $defaultMethods); $finalMethods = array_merge($defaultMethods, $newMethods); $this->handler = $this->getMock( '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234') ); if (!in_array('fsockopen', $methods)) { $this->handler->expects($this->any()) ->method('fsockopen') ->will($this->returnValue($this->res)); } if (!in_array('pfsockopen', $methods)) { $this->handler->expects($this->any()) ->method('pfsockopen') ->will($this->returnValue($this->res)); } if (!in_array('streamSetTimeout', $methods)) { $this->handler->expects($this->any()) ->method('streamSetTimeout') ->will($this->returnValue(true)); } $this->handler->setFormatter($this->getIdentityFormatter()); } } tests/Monolog/Handler/StreamHandlerTest.php000064400000006557146412134770015025 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class StreamHandlerTest extends TestCase { /** * @covers Monolog\Handler\StreamHandler::__construct * @covers Monolog\Handler\StreamHandler::write */ public function testWrite() { $handle = fopen('php://memory', 'a+'); $handler = new StreamHandler($handle); $handler->setFormatter($this->getIdentityFormatter()); $handler->handle($this->getRecord(Logger::WARNING, 'test')); $handler->handle($this->getRecord(Logger::WARNING, 'test2')); $handler->handle($this->getRecord(Logger::WARNING, 'test3')); fseek($handle, 0); $this->assertEquals('testtest2test3', fread($handle, 100)); } /** * @covers Monolog\Handler\StreamHandler::close */ public function testClose() { $handle = fopen('php://memory', 'a+'); $handler = new StreamHandler($handle); $this->assertTrue(is_resource($handle)); $handler->close(); $this->assertFalse(is_resource($handle)); } /** * @covers Monolog\Handler\StreamHandler::write */ public function testWriteCreatesTheStreamResource() { $handler = new StreamHandler('php://memory'); $handler->handle($this->getRecord()); } /** * @covers Monolog\Handler\StreamHandler::__construct * @covers Monolog\Handler\StreamHandler::write */ public function testWriteLocking() { $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log'; $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true); $handler->handle($this->getRecord()); } /** * @expectedException LogicException * @covers Monolog\Handler\StreamHandler::__construct * @covers Monolog\Handler\StreamHandler::write */ public function testWriteMissingResource() { $handler = new StreamHandler(null); $handler->handle($this->getRecord()); } public function invalidArgumentProvider() { return array( array(1), array(array()), array(array('bogus://url')), ); } /** * @dataProvider invalidArgumentProvider * @expectedException InvalidArgumentException * @covers Monolog\Handler\StreamHandler::__construct */ public function testWriteInvalidArgument($invalidArgument) { $handler = new StreamHandler($invalidArgument); } /** * @expectedException UnexpectedValueException * @covers Monolog\Handler\StreamHandler::__construct * @covers Monolog\Handler\StreamHandler::write */ public function testWriteInvalidResource() { $handler = new StreamHandler('bogus://url'); $handler->handle($this->getRecord()); } /** * @expectedException UnexpectedValueException * @covers Monolog\Handler\StreamHandler::__construct * @covers Monolog\Handler\StreamHandler::write */ public function testWriteNonExistingResource() { $handler = new StreamHandler('/foo/bar/baz/'.rand(0, 10000)); $handler->handle($this->getRecord()); } } tests/Monolog/Handler/SyslogHandlerTest.php000064400000002402146412134770015033 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\Logger; class SyslogHandlerTest extends \PHPUnit_Framework_TestCase { /** * @covers Monolog\Handler\SyslogHandler::__construct */ public function testConstruct() { $handler = new SyslogHandler('test'); $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); $handler = new SyslogHandler('test', LOG_USER); $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); $handler = new SyslogHandler('test', 'user'); $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR); $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); } /** * @covers Monolog\Handler\SyslogHandler::__construct */ public function testConstructInvalidFacility() { $this->setExpectedException('UnexpectedValueException'); $handler = new SyslogHandler('test', 'unknown'); } } tests/Monolog/Handler/SyslogUdpHandlerTest.php000064400000002667146412134770015521 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; /** * @requires extension sockets */ class SyslogUdpHandlerTest extends \PHPUnit_Framework_TestCase { /** * @expectedException UnexpectedValueException */ public function testWeValidateFacilities() { $handler = new SyslogUdpHandler("ip", null, "invalidFacility"); } public function testWeSplitIntoLines() { $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv"); $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter()); $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol')); $socket->expects($this->at(0)) ->method('write') ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">: "); $socket->expects($this->at(1)) ->method('write') ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">: "); $handler->setSocket($socket); $handler->handle($this->getRecordWithMessage("hej\nlol")); } protected function getRecordWithMessage($msg) { return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol'); } } tests/Monolog/Handler/TestHandlerTest.php000064400000003152146412134770014475 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; /** * @covers Monolog\Handler\TestHandler */ class TestHandlerTest extends TestCase { /** * @dataProvider methodProvider */ public function testHandler($method, $level) { $handler = new TestHandler; $record = $this->getRecord($level, 'test'.$method); $this->assertFalse($handler->{'has'.$method}($record)); $this->assertFalse($handler->{'has'.$method.'Records'}()); $handler->handle($record); $this->assertFalse($handler->{'has'.$method}('bar')); $this->assertTrue($handler->{'has'.$method}($record)); $this->assertTrue($handler->{'has'.$method}('test'.$method)); $this->assertTrue($handler->{'has'.$method.'Records'}()); $records = $handler->getRecords(); unset($records[0]['formatted']); $this->assertEquals(array($record), $records); } public function methodProvider() { return array( array('Emergency', Logger::EMERGENCY), array('Alert' , Logger::ALERT), array('Critical' , Logger::CRITICAL), array('Error' , Logger::ERROR), array('Warning' , Logger::WARNING), array('Info' , Logger::INFO), array('Notice' , Logger::NOTICE), array('Debug' , Logger::DEBUG), ); } } tests/Monolog/Handler/UdpSocketTest.php000064400000003157146412134770014166 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; /** * @requires extension sockets */ class UdpSocketTest extends TestCase { public function testWeDoNotSplitShortMessages() { $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); $socket->expects($this->at(0)) ->method('send') ->with("HEADER: The quick brown fox jumps over the lazy dog"); $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: "); } public function testWeSplitLongMessages() { $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); $socket->expects($this->at(1)) ->method('send') ->with("The quick brown fox jumps over the lazy dog"); $aStringOfLength2048 = str_repeat("derp", 2048/4); $socket->write($aStringOfLength2048."The quick brown fox jumps over the lazy dog"); } public function testAllSplitMessagesHasAHeader() { $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); $socket->expects($this->exactly(5)) ->method('send') ->with($this->stringStartsWith("HEADER")); $aStringOfLength8192 = str_repeat("derp", 2048); $socket->write($aStringOfLength8192, "HEADER"); } } tests/Monolog/Handler/WhatFailureGroupHandlerTest.php000064400000007145146412134770017014 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; use Monolog\Logger; class WhatFailureGroupHandlerTest extends TestCase { /** * @covers Monolog\Handler\WhatFailureGroupHandler::__construct * @expectedException InvalidArgumentException */ public function testConstructorOnlyTakesHandler() { new WhatFailureGroupHandler(array(new TestHandler(), "foo")); } /** * @covers Monolog\Handler\WhatFailureGroupHandler::__construct * @covers Monolog\Handler\WhatFailureGroupHandler::handle */ public function testHandle() { $testHandlers = array(new TestHandler(), new TestHandler()); $handler = new WhatFailureGroupHandler($testHandlers); $handler->handle($this->getRecord(Logger::DEBUG)); $handler->handle($this->getRecord(Logger::INFO)); foreach ($testHandlers as $test) { $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue(count($test->getRecords()) === 2); } } /** * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch */ public function testHandleBatch() { $testHandlers = array(new TestHandler(), new TestHandler()); $handler = new WhatFailureGroupHandler($testHandlers); $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); foreach ($testHandlers as $test) { $this->assertTrue($test->hasDebugRecords()); $this->assertTrue($test->hasInfoRecords()); $this->assertTrue(count($test->getRecords()) === 2); } } /** * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling */ public function testIsHandling() { $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); $handler = new WhatFailureGroupHandler($testHandlers); $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); } /** * @covers Monolog\Handler\WhatFailureGroupHandler::handle */ public function testHandleUsesProcessors() { $test = new TestHandler(); $handler = new WhatFailureGroupHandler(array($test)); $handler->pushProcessor(function ($record) { $record['extra']['foo'] = true; return $record; }); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasWarningRecords()); $records = $test->getRecords(); $this->assertTrue($records[0]['extra']['foo']); } /** * @covers Monolog\Handler\WhatFailureGroupHandler::handle */ public function testHandleException() { $test = new TestHandler(); $exception = new ExceptionTestHandler(); $handler = new WhatFailureGroupHandler(array($exception, $test, $exception)); $handler->pushProcessor(function ($record) { $record['extra']['foo'] = true; return $record; }); $handler->handle($this->getRecord(Logger::WARNING)); $this->assertTrue($test->hasWarningRecords()); $records = $test->getRecords(); $this->assertTrue($records[0]['extra']['foo']); } } tests/Monolog/Handler/ZendMonitorHandlerTest.php000064400000003766146412134770016041 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Handler; use Monolog\TestCase; class ZendMonitorHandlerTest extends TestCase { protected $zendMonitorHandler; public function setUp() { if (!function_exists('zend_monitor_custom_event')) { $this->markTestSkipped('ZendServer is not installed'); } } /** * @covers Monolog\Handler\ZendMonitorHandler::write */ public function testWrite() { $record = $this->getRecord(); $formatterResult = array( 'message' => $record['message'] ); $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler') ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter')) ->getMock(); $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter') ->disableOriginalConstructor() ->getMock(); $formatterMock->expects($this->once()) ->method('format') ->will($this->returnValue($formatterResult)); $zendMonitor->expects($this->once()) ->method('getDefaultFormatter') ->will($this->returnValue($formatterMock)); $levelMap = $zendMonitor->getLevelMap(); $zendMonitor->expects($this->once()) ->method('writeZendMonitorCustomEvent') ->with($levelMap[$record['level']], $record['message'], $formatterResult); $zendMonitor->handle($record); } /** * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter */ public function testGetDefaultFormatterReturnsNormalizerFormatter() { $zendMonitor = new ZendMonitorHandler(); $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter()); } } tests/Monolog/LoggerTest.php000064400000027603146412134770012131 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog; use Monolog\Processor\WebProcessor; use Monolog\Handler\TestHandler; class LoggerTest extends \PHPUnit_Framework_TestCase { /** * @covers Monolog\Logger::getName */ public function testGetName() { $logger = new Logger('foo'); $this->assertEquals('foo', $logger->getName()); } /** * @covers Monolog\Logger::getLevelName */ public function testGetLevelName() { $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR)); } /** * @covers Monolog\Logger::getLevelName * @expectedException InvalidArgumentException */ public function testGetLevelNameThrows() { Logger::getLevelName(5); } /** * @covers Monolog\Logger::__construct */ public function testChannel() { $logger = new Logger('foo'); $handler = new TestHandler; $logger->pushHandler($handler); $logger->addWarning('test'); list($record) = $handler->getRecords(); $this->assertEquals('foo', $record['channel']); } /** * @covers Monolog\Logger::addRecord */ public function testLog() { $logger = new Logger(__METHOD__); $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle')); $handler->expects($this->once()) ->method('handle'); $logger->pushHandler($handler); $this->assertTrue($logger->addWarning('test')); } /** * @covers Monolog\Logger::addRecord */ public function testLogNotHandled() { $logger = new Logger(__METHOD__); $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR)); $handler->expects($this->never()) ->method('handle'); $logger->pushHandler($handler); $this->assertFalse($logger->addWarning('test')); } public function testHandlersInCtor() { $handler1 = new TestHandler; $handler2 = new TestHandler; $logger = new Logger(__METHOD__, array($handler1, $handler2)); $this->assertEquals($handler1, $logger->popHandler()); $this->assertEquals($handler2, $logger->popHandler()); } public function testProcessorsInCtor() { $processor1 = new WebProcessor; $processor2 = new WebProcessor; $logger = new Logger(__METHOD__, array(), array($processor1, $processor2)); $this->assertEquals($processor1, $logger->popProcessor()); $this->assertEquals($processor2, $logger->popProcessor()); } /** * @covers Monolog\Logger::pushHandler * @covers Monolog\Logger::popHandler * @expectedException LogicException */ public function testPushPopHandler() { $logger = new Logger(__METHOD__); $handler1 = new TestHandler; $handler2 = new TestHandler; $logger->pushHandler($handler1); $logger->pushHandler($handler2); $this->assertEquals($handler2, $logger->popHandler()); $this->assertEquals($handler1, $logger->popHandler()); $logger->popHandler(); } /** * @covers Monolog\Logger::pushProcessor * @covers Monolog\Logger::popProcessor * @expectedException LogicException */ public function testPushPopProcessor() { $logger = new Logger(__METHOD__); $processor1 = new WebProcessor; $processor2 = new WebProcessor; $logger->pushProcessor($processor1); $logger->pushProcessor($processor2); $this->assertEquals($processor2, $logger->popProcessor()); $this->assertEquals($processor1, $logger->popProcessor()); $logger->popProcessor(); } /** * @covers Monolog\Logger::pushProcessor * @expectedException InvalidArgumentException */ public function testPushProcessorWithNonCallable() { $logger = new Logger(__METHOD__); $logger->pushProcessor(new \stdClass()); } /** * @covers Monolog\Logger::addRecord */ public function testProcessorsAreExecuted() { $logger = new Logger(__METHOD__); $handler = new TestHandler; $logger->pushHandler($handler); $logger->pushProcessor(function ($record) { $record['extra']['win'] = true; return $record; }); $logger->addError('test'); list($record) = $handler->getRecords(); $this->assertTrue($record['extra']['win']); } /** * @covers Monolog\Logger::addRecord */ public function testProcessorsAreCalledOnlyOnce() { $logger = new Logger(__METHOD__); $handler = $this->getMock('Monolog\Handler\HandlerInterface'); $handler->expects($this->any()) ->method('isHandling') ->will($this->returnValue(true)) ; $handler->expects($this->any()) ->method('handle') ->will($this->returnValue(true)) ; $logger->pushHandler($handler); $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor') ->disableOriginalConstructor() ->setMethods(array('__invoke')) ->getMock() ; $processor->expects($this->once()) ->method('__invoke') ->will($this->returnArgument(0)) ; $logger->pushProcessor($processor); $logger->addError('test'); } /** * @covers Monolog\Logger::addRecord */ public function testProcessorsNotCalledWhenNotHandled() { $logger = new Logger(__METHOD__); $handler = $this->getMock('Monolog\Handler\HandlerInterface'); $handler->expects($this->once()) ->method('isHandling') ->will($this->returnValue(false)) ; $logger->pushHandler($handler); $that = $this; $logger->pushProcessor(function ($record) use ($that) { $that->fail('The processor should not be called'); }); $logger->addAlert('test'); } /** * @covers Monolog\Logger::addRecord */ public function testHandlersNotCalledBeforeFirstHandling() { $logger = new Logger(__METHOD__); $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler1->expects($this->never()) ->method('isHandling') ->will($this->returnValue(false)) ; $handler1->expects($this->once()) ->method('handle') ->will($this->returnValue(false)) ; $logger->pushHandler($handler1); $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler2->expects($this->once()) ->method('isHandling') ->will($this->returnValue(true)) ; $handler2->expects($this->once()) ->method('handle') ->will($this->returnValue(false)) ; $logger->pushHandler($handler2); $handler3 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler3->expects($this->once()) ->method('isHandling') ->will($this->returnValue(false)) ; $handler3->expects($this->never()) ->method('handle') ; $logger->pushHandler($handler3); $logger->debug('test'); } /** * @covers Monolog\Logger::addRecord */ public function testBubblingWhenTheHandlerReturnsFalse() { $logger = new Logger(__METHOD__); $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler1->expects($this->any()) ->method('isHandling') ->will($this->returnValue(true)) ; $handler1->expects($this->once()) ->method('handle') ->will($this->returnValue(false)) ; $logger->pushHandler($handler1); $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler2->expects($this->any()) ->method('isHandling') ->will($this->returnValue(true)) ; $handler2->expects($this->once()) ->method('handle') ->will($this->returnValue(false)) ; $logger->pushHandler($handler2); $logger->debug('test'); } /** * @covers Monolog\Logger::addRecord */ public function testNotBubblingWhenTheHandlerReturnsTrue() { $logger = new Logger(__METHOD__); $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler1->expects($this->any()) ->method('isHandling') ->will($this->returnValue(true)) ; $handler1->expects($this->never()) ->method('handle') ; $logger->pushHandler($handler1); $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler2->expects($this->any()) ->method('isHandling') ->will($this->returnValue(true)) ; $handler2->expects($this->once()) ->method('handle') ->will($this->returnValue(true)) ; $logger->pushHandler($handler2); $logger->debug('test'); } /** * @covers Monolog\Logger::isHandling */ public function testIsHandling() { $logger = new Logger(__METHOD__); $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler1->expects($this->any()) ->method('isHandling') ->will($this->returnValue(false)) ; $logger->pushHandler($handler1); $this->assertFalse($logger->isHandling(Logger::DEBUG)); $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); $handler2->expects($this->any()) ->method('isHandling') ->will($this->returnValue(true)) ; $logger->pushHandler($handler2); $this->assertTrue($logger->isHandling(Logger::DEBUG)); } /** * @dataProvider logMethodProvider * @covers Monolog\Logger::addDebug * @covers Monolog\Logger::addInfo * @covers Monolog\Logger::addNotice * @covers Monolog\Logger::addWarning * @covers Monolog\Logger::addError * @covers Monolog\Logger::addCritical * @covers Monolog\Logger::addAlert * @covers Monolog\Logger::addEmergency * @covers Monolog\Logger::debug * @covers Monolog\Logger::info * @covers Monolog\Logger::notice * @covers Monolog\Logger::warn * @covers Monolog\Logger::err * @covers Monolog\Logger::crit * @covers Monolog\Logger::alert * @covers Monolog\Logger::emerg */ public function testLogMethods($method, $expectedLevel) { $logger = new Logger('foo'); $handler = new TestHandler; $logger->pushHandler($handler); $logger->{$method}('test'); list($record) = $handler->getRecords(); $this->assertEquals($expectedLevel, $record['level']); } public function logMethodProvider() { return array( // monolog methods array('addDebug', Logger::DEBUG), array('addInfo', Logger::INFO), array('addNotice', Logger::NOTICE), array('addWarning', Logger::WARNING), array('addError', Logger::ERROR), array('addCritical', Logger::CRITICAL), array('addAlert', Logger::ALERT), array('addEmergency', Logger::EMERGENCY), // ZF/Sf2 compat methods array('debug', Logger::DEBUG), array('info', Logger::INFO), array('notice', Logger::NOTICE), array('warn', Logger::WARNING), array('err', Logger::ERROR), array('crit', Logger::CRITICAL), array('alert', Logger::ALERT), array('emerg', Logger::EMERGENCY), ); } } tests/Monolog/Processor/GitProcessorTest.php000064400000001245146412134770015306 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\TestCase; class GitProcessorTest extends TestCase { /** * @covers Monolog\Processor\GitProcessor::__invoke */ public function testProcessor() { $processor = new GitProcessor(); $record = $processor($this->getRecord()); $this->assertArrayHasKey('git', $record['extra']); $this->assertTrue(!is_array($record['extra']['git']['branch'])); } } tests/Monolog/Processor/IntrospectionProcessorTest.php000064400000006121146412134770017421 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Acme; class Tester { public function test($handler, $record) { $handler->handle($record); } } function tester($handler, $record) { $handler->handle($record); } namespace Monolog\Processor; use Monolog\Logger; use Monolog\TestCase; use Monolog\Handler\TestHandler; class IntrospectionProcessorTest extends TestCase { public function getHandler() { $processor = new IntrospectionProcessor(); $handler = new TestHandler(); $handler->pushProcessor($processor); return $handler; } public function testProcessorFromClass() { $handler = $this->getHandler(); $tester = new \Acme\Tester; $tester->test($handler, $this->getRecord()); list($record) = $handler->getRecords(); $this->assertEquals(__FILE__, $record['extra']['file']); $this->assertEquals(18, $record['extra']['line']); $this->assertEquals('Acme\Tester', $record['extra']['class']); $this->assertEquals('test', $record['extra']['function']); } public function testProcessorFromFunc() { $handler = $this->getHandler(); \Acme\tester($handler, $this->getRecord()); list($record) = $handler->getRecords(); $this->assertEquals(__FILE__, $record['extra']['file']); $this->assertEquals(24, $record['extra']['line']); $this->assertEquals(null, $record['extra']['class']); $this->assertEquals('Acme\tester', $record['extra']['function']); } public function testLevelTooLow() { $input = array( 'level' => Logger::DEBUG, 'extra' => array(), ); $expected = $input; $processor = new IntrospectionProcessor(Logger::CRITICAL); $actual = $processor($input); $this->assertEquals($expected, $actual); } public function testLevelEqual() { $input = array( 'level' => Logger::CRITICAL, 'extra' => array(), ); $expected = $input; $expected['extra'] = array( 'file' => null, 'line' => null, 'class' => 'ReflectionMethod', 'function' => 'invokeArgs', ); $processor = new IntrospectionProcessor(Logger::CRITICAL); $actual = $processor($input); $this->assertEquals($expected, $actual); } public function testLevelHigher() { $input = array( 'level' => Logger::EMERGENCY, 'extra' => array(), ); $expected = $input; $expected['extra'] = array( 'file' => null, 'line' => null, 'class' => 'ReflectionMethod', 'function' => 'invokeArgs', ); $processor = new IntrospectionProcessor(Logger::CRITICAL); $actual = $processor($input); $this->assertEquals($expected, $actual); } } tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php000064400000002521146412134770017617 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\TestCase; class MemoryPeakUsageProcessorTest extends TestCase { /** * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke * @covers Monolog\Processor\MemoryProcessor::formatBytes */ public function testProcessor() { $processor = new MemoryPeakUsageProcessor(); $record = $processor($this->getRecord()); $this->assertArrayHasKey('memory_peak_usage', $record['extra']); $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']); } /** * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke * @covers Monolog\Processor\MemoryProcessor::formatBytes */ public function testProcessorWithoutFormatting() { $processor = new MemoryPeakUsageProcessor(true, false); $record = $processor($this->getRecord()); $this->assertArrayHasKey('memory_peak_usage', $record['extra']); $this->assertInternalType('int', $record['extra']['memory_peak_usage']); $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']); } } tests/Monolog/Processor/MemoryUsageProcessorTest.php000064400000002444146412134770017022 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\TestCase; class MemoryUsageProcessorTest extends TestCase { /** * @covers Monolog\Processor\MemoryUsageProcessor::__invoke * @covers Monolog\Processor\MemoryProcessor::formatBytes */ public function testProcessor() { $processor = new MemoryUsageProcessor(); $record = $processor($this->getRecord()); $this->assertArrayHasKey('memory_usage', $record['extra']); $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']); } /** * @covers Monolog\Processor\MemoryUsageProcessor::__invoke * @covers Monolog\Processor\MemoryProcessor::formatBytes */ public function testProcessorWithoutFormatting() { $processor = new MemoryUsageProcessor(true, false); $record = $processor($this->getRecord()); $this->assertArrayHasKey('memory_usage', $record['extra']); $this->assertInternalType('int', $record['extra']['memory_usage']); $this->assertGreaterThan(0, $record['extra']['memory_usage']); } } tests/Monolog/Processor/ProcessIdProcessorTest.php000064400000001514146412134770016455 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\TestCase; class ProcessIdProcessorTest extends TestCase { /** * @covers Monolog\Processor\ProcessIdProcessor::__invoke */ public function testProcessor() { $processor = new ProcessIdProcessor(); $record = $processor($this->getRecord()); $this->assertArrayHasKey('process_id', $record['extra']); $this->assertInternalType('int', $record['extra']['process_id']); $this->assertGreaterThan(0, $record['extra']['process_id']); $this->assertEquals(getmypid(), $record['extra']['process_id']); } } tests/Monolog/Processor/PsrLogMessageProcessorTest.php000064400000002116146412134770017274 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\Processor\PsrLogMessageProcessor; class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase { /** * @dataProvider getPairs */ public function testReplacement($val, $expected) { $proc = new PsrLogMessageProcessor; $message = $proc(array( 'message' => '{foo}', 'context' => array('foo' => $val) )); $this->assertEquals($expected, $message['message']); } public function getPairs() { return array( array('foo', 'foo'), array('3', '3'), array(3, '3'), array(null, ''), array(true, '1'), array(false, ''), array(new \stdClass, '[object stdClass]'), array(array(), '[array]'), ); } } tests/Monolog/Processor/TagProcessorTest.php000064400000001204146412134770015271 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\TestCase; class TagProcessorTest extends TestCase { /** * @covers Monolog\Processor\TagProcessor::__invoke */ public function testProcessor() { $tags = array(1, 2, 3); $processor = new TagProcessor($tags); $record = $processor($this->getRecord()); $this->assertEquals($tags, $record['extra']['tags']); } } tests/Monolog/Processor/UidProcessorTest.php000064400000001133146412134770015300 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\TestCase; class UidProcessorTest extends TestCase { /** * @covers Monolog\Processor\UidProcessor::__invoke */ public function testProcessor() { $processor = new UidProcessor(); $record = $processor($this->getRecord()); $this->assertArrayHasKey('uid', $record['extra']); } } tests/Monolog/Processor/WebProcessorTest.php000064400000005730146412134770015303 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog\Processor; use Monolog\TestCase; class WebProcessorTest extends TestCase { public function testProcessor() { $server = array( 'REQUEST_URI' => 'A', 'REMOTE_ADDR' => 'B', 'REQUEST_METHOD' => 'C', 'HTTP_REFERER' => 'D', 'SERVER_NAME' => 'F', 'UNIQUE_ID' => 'G', ); $processor = new WebProcessor($server); $record = $processor($this->getRecord()); $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']); $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']); $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']); $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']); $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']); $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']); } public function testProcessorDoNothingIfNoRequestUri() { $server = array( 'REMOTE_ADDR' => 'B', 'REQUEST_METHOD' => 'C', ); $processor = new WebProcessor($server); $record = $processor($this->getRecord()); $this->assertEmpty($record['extra']); } public function testProcessorReturnNullIfNoHttpReferer() { $server = array( 'REQUEST_URI' => 'A', 'REMOTE_ADDR' => 'B', 'REQUEST_METHOD' => 'C', 'SERVER_NAME' => 'F', ); $processor = new WebProcessor($server); $record = $processor($this->getRecord()); $this->assertNull($record['extra']['referrer']); } public function testProcessorDoesNotAddUniqueIdIfNotPresent() { $server = array( 'REQUEST_URI' => 'A', 'REMOTE_ADDR' => 'B', 'REQUEST_METHOD' => 'C', 'SERVER_NAME' => 'F', ); $processor = new WebProcessor($server); $record = $processor($this->getRecord()); $this->assertFalse(isset($record['extra']['unique_id'])); } public function testProcessorAddsOnlyRequestedExtraFields() { $server = array( 'REQUEST_URI' => 'A', 'REMOTE_ADDR' => 'B', 'REQUEST_METHOD' => 'C', 'SERVER_NAME' => 'F', ); $processor = new WebProcessor($server, array('url', 'http_method')); $record = $processor($this->getRecord()); $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']); } /** * @expectedException UnexpectedValueException */ public function testInvalidData() { new WebProcessor(new \stdClass); } } tests/Monolog/PsrLogCompatTest.php000064400000002227146412134770013257 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog; use Monolog\Handler\TestHandler; use Monolog\Formatter\LineFormatter; use Monolog\Processor\PsrLogMessageProcessor; use Psr\Log\Test\LoggerInterfaceTest; class PsrLogCompatTest extends LoggerInterfaceTest { private $handler; public function getLogger() { $logger = new Logger('foo'); $logger->pushHandler($handler = new TestHandler); $logger->pushProcessor(new PsrLogMessageProcessor); $handler->setFormatter(new LineFormatter('%level_name% %message%')); $this->handler = $handler; return $logger; } public function getLogs() { $convert = function ($record) { $lower = function ($match) { return strtolower($match[0]); }; return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']); }; return array_map($convert, $this->handler->getRecords()); } } tests/Monolog/TestCase.php000064400000003154146412134770011560 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ namespace Monolog; class TestCase extends \PHPUnit_Framework_TestCase { /** * @return array Record */ protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array()) { return array( 'message' => $message, 'context' => $context, 'level' => $level, 'level_name' => Logger::getLevelName($level), 'channel' => 'test', 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))), 'extra' => array(), ); } /** * @return array */ protected function getMultipleRecords() { return array( $this->getRecord(Logger::DEBUG, 'debug message 1'), $this->getRecord(Logger::DEBUG, 'debug message 2'), $this->getRecord(Logger::INFO, 'information'), $this->getRecord(Logger::WARNING, 'warning'), $this->getRecord(Logger::ERROR, 'error') ); } /** * @return Monolog\Formatter\FormatterInterface */ protected function getIdentityFormatter() { $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); $formatter->expects($this->any()) ->method('format') ->will($this->returnCallback(function ($record) { return $record['message']; })); return $formatter; } } tests/bootstrap.php000064400000000571146412134770010450 0ustar00 * * For the full copyright and license information, please view the LICENSE * file that was distributed with this source code. */ $loader = require __DIR__ . "/../vendor/autoload.php"; $loader->addPsr4('Monolog\\', __DIR__.'/Monolog'); date_default_timezone_set('UTC');